Page MenuHomeFreeBSD
Files F87066493

No OneTemporary
Actions

View Options

This file is larger than 256 KB, so syntax highlighting was skipped.
This document is not UTF8. It was detected as Shift JIS and converted to UTF8 for display.
diff --git a/en_US.ISO8859-1/books/handbook/Makefile b/en_US.ISO8859-1/books/handbook/Makefile
index 1bc6551f70..9f0e64d027 100644
--- a/en_US.ISO8859-1/books/handbook/Makefile
+++ b/en_US.ISO8859-1/books/handbook/Makefile
@@ -1,96 +1,153 @@
#
-# $FreeBSD: doc/en_US.ISO8859-1/books/handbook/Makefile,v 1.41 2001/08/08 19:23:55 murray Exp $
+# $FreeBSD: doc/en_US.ISO8859-1/books/handbook/Makefile,v 1.42 2001/08/10 00:30:43 murray Exp $
#
# Build the FreeBSD Handbook.
#
# ------------------------------------------------------------------------
#
# Handbook-specific variables
#
# WITH_PGPKEYS The print version of the handbook only prints PGP
# fingerprints by default. If you would like for the
# entire key to be displayed, then set this variable.
# This option has no affect on the HTML formats.
#
# ------------------------------------------------------------------------
MAINTAINER=nik@FreeBSD.org
DOC?= book
FORMATS?= html-split
INSTALL_COMPRESSED?= gz
INSTALL_ONLY_COMPRESSED?=
IMAGES = advanced-networking/isdn-bus.eps
IMAGES+= advanced-networking/isdn-twisted-pair.eps
IMAGES+= advanced-networking/natd.eps
+IMAGES+= install/userconfig.scr
+IMAGES+= install/userconfig2.scr
+IMAGES+= install/hdwrconf.scr
+IMAGES+= install/probstart.scr
+IMAGES+= install/main1.scr
+IMAGES+= install/sysinstall-exit.scr
+IMAGES+= install/main-doc.scr
+IMAGES+= install/docmenu1.scr
+IMAGES+= install/main-keymap.scr
+IMAGES+= install/keymap.scr
+IMAGES+= install/main-options.scr
+IMAGES+= install/options.scr
+IMAGES+= install/main-std.scr
+IMAGES+= install/fdisk-drive1.scr
+IMAGES+= install/fdisk-edit1.scr
+IMAGES+= install/fdisk-edit2.scr
+IMAGES+= install/boot-mgr.scr
+IMAGES+= install/fdisk-drive2.scr
+IMAGES+= install/disklabel-ed1.scr
+IMAGES+= install/disklabel-auto.scr
+IMAGES+= install/disklabel-root1.scr
+IMAGES+= install/disklabel-root2.scr
+IMAGES+= install/disklabel-fs.scr
+IMAGES+= install/disklabel-root3.scr
+IMAGES+= install/disklabel-ed2.scr
+IMAGES+= install/dist-set.scr
+IMAGES+= install/dist-set2.scr
+IMAGES+= install/media.scr
+IMAGES+= install/ed0-conf.scr
+IMAGES+= install/ed0-conf2.scr
+IMAGES+= install/ftp-anon1.scr
+IMAGES+= install/ftp-anon2.scr
+IMAGES+= install/nfs-server-edit.scr
+IMAGES+= install/security.scr
+IMAGES+= install/console-saver1.scr
+IMAGES+= install/console-saver2.scr
+IMAGES+= install/console-saver3.scr
+IMAGES+= install/console-saver4.scr
+IMAGES+= install/timezone1.scr
+IMAGES+= install/timezone2.scr
+IMAGES+= install/timezone3.scr
+IMAGES+= install/mouse1.scr
+IMAGES+= install/mouse2.scr
+IMAGES+= install/mouse3.scr
+IMAGES+= install/mouse4.scr
+IMAGES+= install/mouse5.scr
+IMAGES+= install/mouse6.scr
+IMAGES+= install/xf86setup.scr
+IMAGES+= install/desktop.scr
+IMAGES+= install/pkg-cat.scr
+IMAGES+= install/pkg-sel.scr
+IMAGES+= install/pkg-install.scr
+IMAGES+= install/pkg-confirm.scr
+IMAGES+= install/adduser1.scr
+IMAGES+= install/adduser2.scr
+IMAGES+= install/adduser3.scr
+IMAGES+= install/mainexit.scr
#
# SRCS lists the individual SGML files that make up the document. Changes
# to any of these files will force a rebuild
#
# SGML content
SRCS= book.sgml
SRCS+= advanced-networking/chapter.sgml
SRCS+= backups/chapter.sgml
SRCS+= basics/chapter.sgml
SRCS+= bibliography/chapter.sgml
SRCS+= config/chapter.sgml
SRCS+= boot/chapter.sgml
SRCS+= contrib/chapter.sgml
SRCS+= cutting-edge/chapter.sgml
SRCS+= disks/chapter.sgml
SRCS+= eresources/chapter.sgml
SRCS+= install/chapter.sgml
SRCS+= introduction/chapter.sgml
SRCS+= kernelconfig/chapter.sgml
SRCS+= l10n/chapter.sgml
SRCS+= linuxemu/chapter.sgml
SRCS+= mail/chapter.sgml
SRCS+= mirrors/chapter.sgml
SRCS+= pgpkeys/chapter.sgml
SRCS+= ppp-and-slip/chapter.sgml
SRCS+= printing/chapter.sgml
SRCS+= security/chapter.sgml
SRCS+= serialcomms/chapter.sgml
SRCS+= sound/chapter.sgml
SRCS+= users/chapter.sgml
SRCS+= x11/chapter.sgml
SRCS+= ports/chapter.sgml
SRCS+= colophon.sgml
# Entities
SRCS+= authors.ent
SRCS+= chapters.ent
SYMLINKS= ${DESTDIR} index.html handbook.html
# Turn on all the chapters.
CHAPTERS?= ${SRCS:M*chapter.sgml}
JADEFLAGS+= ${CHAPTERS:S/\/chapter.sgml//:S/^/-i chap./}
# XXX The Handbook build currently overflows some internal, hardcoded
# limits in pdftex. Until we split the Handbook up, build the PDF
# version using ps2pdf instead of pdftex.
book.tex-pdf:
touch book.tex-pdf
book.pdf: book.ps
ps2pdf book.ps book.pdf
DOC_PREFIX?= ${.CURDIR}/../../..
#
# Handbook-specific variables
#
.if defined(WITH_PGPKEYS)
JADEFLAGS+= -V withpgpkeys
.endif
.include "${DOC_PREFIX}/share/mk/doc.project.mk"
diff --git a/en_US.ISO8859-1/books/handbook/install/adduser1.scr b/en_US.ISO8859-1/books/handbook/install/adduser1.scr
new file mode 100644
index 0000000000..87c752f62f
--- /dev/null
+++ b/en_US.ISO8859-1/books/handbook/install/adduser1.scr
@@ -0,0 +1 @@
+SCRSHOT_P                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                           ﾚﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄ ~U~s~e~r~ ~a~n~d~ ~g~r~o~u~p~ ~m~a~n~a~g~e~m~e~n~t~ ~ﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｿp                       ｳ pTphpep pspupbpmpepnpupsp phpeprpep paplplpopwp ptpop pmpapnpipppuplpaptpep pupspeprp pgprpopupppsp papnpdp pｳp                       ｳ plpopgpipnp papcpcpopupnptpsp.p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳp                       ｳ p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳp                       ｳ pﾚpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpｿ pｳp                       ｳ pｳp p pX| ~E~x~i~t~ p pEpxpiptp ptphpipsp pmpepnpup p(prpeptpuprpnpipnpgp ptpop ppprpepvpipopupsp)p p p pｳ pｳp                       ｳ pｳp p pUser p p p pAdd a new user to the system. p p p p p p p p p p p pｳ pｳp                       ｳ pｳp p pG|r~o~u~p~ p p pApdpdp pap pnpepwp pupspeprp pgprpopuppp ptpop ptphpep pspypsptpepmp.p p p p p p pｳ pｳp                       ｳ pﾀpﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾙ pｳp                       ﾃﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｴp                       ｳ p p p p p p p p p p p p p p p p[  OK  ] p p p p p p pCtapnpcpeplp p p p p p p p p p p p p p p p p p pｳp                       ﾀﾄpﾄpﾄpﾄpﾄpﾄpﾄp[~ ~C~o~n~f~i~g~u~r~e~ ~y~o~u~r~ ~u~s~e~r~ ~g~r~o~u~p~s~ ~a~n~d~ ~u~s~e~r~s~ ~]~ﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾙp                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                            
\ No newline at end of file
diff --git a/en_US.ISO8859-1/books/handbook/install/adduser2.scr b/en_US.ISO8859-1/books/handbook/install/adduser2.scr
new file mode 100644
index 0000000000..633dfc654f
--- /dev/null
+++ b/en_US.ISO8859-1/books/handbook/install/adduser2.scr
@@ -0,0 +1 @@
+SCRSHOT_P        ﾚﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄ pUpspeprp papnpdp pGprpopuppp pMpapnpapgpepmpepnptp pﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｿp                ｳ p pﾚﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄ pApdpdp pap pnpepwp pupspeprp pﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｿp p pｳp                ｳ p pｳ p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳp p pｳp                ｳ p pｳ p p pLpopgpipnp pIpDp:p p p p p p p p pUpIpDp:p p p p p p pGprpopuppp:p p p p pPpapspspwpoprpdp:p p p p p p p pｳp p pｳp                ｳ p pｳ p pﾚﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｿp pﾚﾄﾄﾄﾄﾄﾄｿp p pﾚﾄﾄﾄﾄﾄﾄｿp p pﾚﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｿp p pｳp p pｳp                ｳ p pｳ p pｳrppprpaptptp p p p p p p p pｳp pｳ1p0p0p1p p pｳp p pｳ p p p p p pｳp p pｳ*p*p*p*p*p*p*p*p*p*p p p pｳp p pｳp p pｳp                ｳ p pｳ p pﾀﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾙp pﾀﾄpﾄpﾄpﾄpﾄpﾄpﾙp p pﾀﾄpﾄpﾄpﾄpﾄpﾄpﾙp p pﾀﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾙp p pｳp p pｳp                ｳ p pｳ p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳp p pｳp                ｳ p pｳ p p pFpuplplp pnpapmpep:p p p p p p p p p p p p p p p p p p p p p p p p p p p pMpepmpbpeprp pgprpopupppsp:p p pｳp p pｳp                ｳ p pｳ p pﾚﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｿp p p p pﾚﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｿp p pｳp p pｳp                ｳ p pｳ p pｳRpapnpdpyp pPprpaptptp p p p p p p p p p p p p p p p p p p p pｳp p p p pｳwphpepeplp p p p p p p p pｳp p pｳp p pｳp                ｳ p pｳ p pﾀﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾙp p p p pﾀﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾙp p pｳp p pｳp                ｳ p pｳ p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳp p pｳp                ｳ p pｳ p p pHpopmpep pdpiprpepcptpoprpyp:p p p p p p p p pLpopgpipnp psphpeplplp:p p p p p p p p p p p p p p p p p p pｳp p pｳp                ｳ p pｳ p pﾚﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｿp p p pﾚﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｿp p pｳp p pｳp                ｳ p pｳ p pｳ/phpopmpep/prppprpaptptp p p p p p pｳp p p pｳ/pupsprp/plpopcpaplp/pbpipnp/pbpapsphp p p p p p p p pｳp p pｳp p pｳp                ｳ p pｳ p pﾀﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾙp p p pﾀﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾙp p pｳp p pｳp                ｳ p pﾀﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾙp p pｳp                ｳ p p p p p p p p p p p p p pﾚﾄﾄﾄﾄﾄﾄｿp p p p p p p p p p p p pﾚﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｿp p p p p p p p p p p p p p p p pｳp                ｳ p p p p p p p p p p p p p pｳ p[OK] pｳp p p p p p p p p p p p pｳ p pCtApNpCpEpLp p pｳp p p p p p p p p p p p p p p p pｳp                ｳ p p p p p p p p p p p p p pﾀﾄpﾄpﾄpﾄpﾄpﾄpﾙp p p p p p p p p p p p pﾀﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾙp p p p p p p p p p p p p p p p pｳp                ｳ p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳp                ﾀﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾙp                                                                                         [~ ~S~e~l~e~c~t~ ~t~h~i~s~ ~i~f~ ~y~o~u~ ~a~r~e~ ~h~a~p~p~y~ ~w~i~t~h~ ~t~h~e~s~e~ ~s~e~t~t~i~n~g~s~ ~ ~ ~ ~ ~ ~ ~ ~ ~ ~ ~ ~ ~ ~ ~ ~ ~ ~ ~ ~ ~ ~ ~ ~ ~ ~]~  
\ No newline at end of file
diff --git a/en_US.ISO8859-1/books/handbook/install/adduser3.scr b/en_US.ISO8859-1/books/handbook/install/adduser3.scr
new file mode 100644
index 0000000000..4cec6d5b18
--- /dev/null
+++ b/en_US.ISO8859-1/books/handbook/install/adduser3.scr
@@ -0,0 +1 @@
+SCRSHOT_P                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                           ﾚﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄ ~U~s~e~r~ ~a~n~d~ ~g~r~o~u~p~ ~m~a~n~a~g~e~m~e~n~t~ ~ﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｿp                       ｳ pTphpep pspupbpmpepnpupsp phpeprpep paplplpopwp ptpop pmpapnpipppuplpaptpep pupspeprp pgprpopupppsp papnpdp pｳp                       ｳ plpopgpipnp papcpcpopupnptpsp.p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳp                       ｳ p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳp                       ｳ pﾚpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpｿ pｳp                       ｳ pｳp p pX Exit p pExit this menu (returning to previous) p p pｳ pｳp                       ｳ pｳp p pU|s~e~r~ p p p pApdpdp pap pnpepwp pupspeprp ptpop ptphpep pspypsptpepmp.p p p p p p p p p p p p pｳ pｳp                       ｳ pｳp p pG|r~o~u~p~ p p pApdpdp pap pnpepwp pupspeprp pgprpopuppp ptpop ptphpep pspypsptpepmp.p p p p p p pｳ pｳp                       ｳ pﾀpﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾙ pｳp                       ﾃﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｴp                       ｳ p p p p p p p p p p p p p p p p[  OK  ] p p p p p p pCtapnpcpeplp p p p p p p p p p p p p p p p p p pｳp                       ﾀﾄpﾄpﾄpﾄpﾄpﾄpﾄp[~ ~C~o~n~f~i~g~u~r~e~ ~y~o~u~r~ ~u~s~e~r~ ~g~r~o~u~p~s~ ~a~n~d~ ~u~s~e~r~s~ ~]~ﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾙp                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                            
\ No newline at end of file
diff --git a/en_US.ISO8859-1/books/handbook/install/boot-mgr.scr b/en_US.ISO8859-1/books/handbook/install/boot-mgr.scr
new file mode 100644
index 0000000000..281f07e257
--- /dev/null
+++ b/en_US.ISO8859-1/books/handbook/install/boot-mgr.scr
@@ -0,0 +1 @@
+SCRSHOT_P                                                                                                                                                                                                                                                   ﾚﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄ ~I~n~s~t~a~l~l~ ~B~o~o~t~ ~M~a~n~a~g~e~r~ ~f~o~r~ ~d~r~i~v~e~ ~a~d~0~?~ ~ﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｿp      ｳ pFprpepepBpSpDp pcpopmpepsp pwpiptphp pap pbpopoptp pspeplpepcptpoprp ptphpaptp paplplpopwpsp pypopup ptpop pepapspiplpyp p p p p p p p p p p pｳp      ｳ pspeplpepcptp pbpeptpwpepepnp pFprpepepBpSpDp papnpdp papnpyp poptphpeprp popppeprpaptpipnpgp pspypsptpepmpsp popnp pypopuprp pmpapcphpipnpep pｳp      ｳ paptp pbpopoptp ptpipmpep.p p pIpfp pypopup phpapvpep pmpoprpep ptphpapnp popnpep pdprpipvpep papnpdp pwpapnptp ptpop pbpopoptp p p p p p p p pｳp      ｳ pfprpopmp ptphpep pspepcpopnpdp popnpep,p ptphpep pbpopoptp pspeplpepcptpoprp pwpiplplp paplpspop pmpapkpep piptp pppopspspipbplpep p p p p p pｳp      ｳ ptpop pdpop pspop p(plpipmpiptpaptpipopnpsp pipnp ptphpep pPpCp pBpIpOpSp pupspupaplplpyp ppprpepvpepnptp ptphpipsp poptphpeprpwpipspep)p.p p pｳp      ｳ pIpfp pypopup pdpop pnpoptp pwpapnptp pap pbpopoptp pspeplpepcptpoprp,p poprp pwpipsphp ptpop prpeppplpapcpep papnp pepxpipsptpipnpgp p p p p pｳp      ｳ popnpep,p pspeplpepcptp p"psptpapnpdpaprpdp"p.p p pIpfp pypopup pwpopuplpdp ppprpepfpeprp pypopuprp pMpapsptpeprp pBpopoptp p p p p p p p p p pｳp      ｳ pRpepcpoprpdp ptpop prpepmpapipnp pupnptpopupcphpepdp ptphpepnp pspeplpepcptp p"pNpopnpep"p.p p p p p p p p p p p p p p p p p p p p p p p p p pｳp      ｳ p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳp      ｳ p p pNpOpTpEp:p p pPpCp-pDpOpSp pupspeprpsp pwpiplplp paplpmpopsptp pcpeprptpapipnplpyp prpepqpupiprpep p"pNpopnpep"p!p p p p p p p p p p p p pｳp      ｳ pﾚpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpｿ pｳp      ｳ pｳp p p p p p p p(p p)p pB|o~o~t~M~g~r~ p p pIpnpsptpaplplp ptphpep pFprpepepBpSpDp pBpopoptp pMpapnpapgpeprp p p p p p p p p p p p p p p pｳ pｳp      ｳ pｳp p p p p p p p(*) pStandard p pInstall a standard MBR (no boot manager) p p p p p p pｳ pｳp      ｳ pｳp p p p p p p p(p p)p pN|o~n~e~ p p p p p pLpepapvpep ptphpep pMpapsptpeprp pBpopoptp pRpepcpoprpdp pupnptpopupcphpepdp p p p p p p p p pｳ pｳp      ｳ pﾀpﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾙ pｳp      ﾃﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｴp      ｳ p p p p p p p p p p p p p p p p p p p p p p p p p[  OK  ] p p p p p p pCtapnpcpeplp p p p p p p p p p p p p p p p p p p p p p p p p p pｳp      ﾀﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄp[~ ~P~r~e~s~s~ ~F~1~ ~t~o~ ~r~e~a~d~ ~a~b~o~u~t~ ~d~r~i~v~e~ ~s~e~t~u~p~ ~]~ﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾙp                                                                                                                                                                                                                                                   
\ No newline at end of file
diff --git a/en_US.ISO8859-1/books/handbook/install/chapter.sgml b/en_US.ISO8859-1/books/handbook/install/chapter.sgml
index 6c3acd3b04..a5b24759b5 100644
--- a/en_US.ISO8859-1/books/handbook/install/chapter.sgml
+++ b/en_US.ISO8859-1/books/handbook/install/chapter.sgml
@@ -1,1170 +1,3494 @@
<!--
The FreeBSD Documentation Project
- $FreeBSD: doc/en_US.ISO8859-1/books/handbook/install/chapter.sgml,v 1.84 2001/08/10 16:01:35 bmah Exp $
+ $FreeBSD: doc/en_US.ISO8859-1/books/handbook/install/chapter.sgml,v 1.85 2001/08/10 22:58:13 chern Exp $
-->
<chapter id="install">
<chapterinfo>
<authorgroup>
<author>
<firstname>Jim</firstname>
<surname>Mock</surname>
<contrib>Restructured, reorganized, and parts
rewritten by </contrib>
</author>
</authorgroup>
<!-- January 2000 -->
</chapterinfo>
<title>Installing FreeBSD</title>
<sect1>
<title>Synopsis</title>
<indexterm><primary>installation</primary></indexterm>
<para>The following chapter will attempt to guide you through the
installation of FreeBSD on your system. It can be installed through a
variety of methods, including anonymous FTP (assuming you have
network connectivity via modem or local network), CDROM, floppy
disk, tape, an MS-DOS partition, or even NFS.</para>
<para>No matter which method you choose, you will need to get started
by creating the <emphasis>installation disks</emphasis> as described
in the <link linkend="install-floppies">next section</link>.
Booting into the FreeBSD installer, even if you are not planning on
installing FreeBSD right away, will provide important information
about compatibility with your hardware. This information may
dictate which installation options are even possible for you. It
can also provide clues early-on in the process to potential problems
you may come across later.</para>
<indexterm>
<primary>installation</primary>
<secondary>network</secondary>
<tertiary>anonymous FTP</tertiary>
</indexterm>
<para>If you plan to install FreeBSD via anonymous FTP, the only
things you will need are the <link
linkend="install-floppies">installation floppies</link>. The
installation program itself will handle anything else that is
required.</para>
<para>For more information about obtaining FreeBSD, see the <link
linkend="mirrors">Obtaining FreeBSD</link> section of the
Appendix.</para>
<para>By now, you are probably wondering what exactly it is you need
to do. Continue on to the installation guide.</para>
</sect1>
<sect1 id="install-guide">
- <title>Installation Guide</title>
+ <title>Preparing for Installation</title>
<para>The following sections will guide you through preparing for and
actually installing FreeBSD. If you find something missing, please
let us know about it by sending email to the &a.doc;.</para>
<sect2 id="install-prepare">
<title>Preparing for the Installation</title>
<para>There are various things you should do in preparation for the
installation. The following describes what needs to be done prior to
each type of installation.</para>
<para>The first thing to do is to make sure your hardware is
supported by FreeBSD. The Hardware Notes document for your
release of FreeBSD (which is usually named
<filename>HARDWARE.TXT</filename>) should
come in handy here. It would also be a good idea to make a
list of any <quote>special</quote> cards you have installed,
such as SCSI controllers, Ethernet cards, sound cards, etc..
The list should include their IRQs and IO port addresses.</para>
<sect3 id="install-floppies">
<title>Creating the Installation Floppies</title>
<indexterm>
<primary>installation</primary>
<secondary>boot floppies</secondary>
</indexterm>
<indexterm>
<primary>installation</primary>
<secondary>CDROM</secondary>
</indexterm>
<para>You may need to prepare some floppy disks. These disks will
be used to boot your computer in to the FreeBSD install process.
This step is not necessary <emphasis>if</emphasis> you are
installing from CDROM, <emphasis>and</emphasis> your computer
supports booting from the CDROM. If you do not meet these
requirements then you will need to create some floppies to boot
from.</para>
<note>
<para>If you are not sure whether your computer can boot from the
CDROM it does not hurt to try. Just insert the CDROM as
normal and restart your computer. You might need to adjust some
options in your BIOS so that your computer will try and boot
from the CDROM drive before the hard disk.</para>
</note>
<tip>
<para>Even if you have the CDROM it might make sense for you to
download the files. There have been occasions where bugs in the
FreeBSD installer have been discovered after the CDs have been
released. When this happens the copies of the images on the FTP
site will be fixed as soon as possible. Obviously, it is not
possible to update the CDs after they have been pressed.</para>
</tip>
<procedure>
<step>
<title>Acquire the Boot Floppy Images</title>
<para>These are files with a <filename>.flp</filename>
extension. If you have a CDROM release of FreeBSD then you
will find the files in the <filename>floppies</filename>
subdirectory. Alternatively, you can download the images from
the <ulink
url="ftp://ftp.FreeBSD.org/pub/FreeBSD/releases/i386/&rel.current;-RELEASE/floppies/">floppies directory</ulink> of the FreeBSD FTP site or your local mirror.</para>
<para>The names of the files you will need varies between
FreeBSD releases (sometimes) and the architecture you will be
installing on. The <ulink
url="ftp://ftp.FreeBSD.org/pub/FreeBSD/releases/i386/&rel.current;-RELEASE/floppies/README.TXT">installation
boot image information</ulink> on the FTP site provides
up-to-the-minute information about the specific files you will
need.</para>
</step>
<step>
<title>Prepare the Floppy Disks</title>
<para>You must prepare one floppy disk per image file you had to
download. It is imperative that these disks are free from
defects. The easiest way to test this is to format the disks
for yourself. Do not trust pre-formatted floppies.</para>
<important>
<para>If you try to install FreeBSD and the installation
program crashes, freezes, or otherwise misbehaves one of
the first things to suspect is the floppies. Try writing
the floppy image files to some other disks, and try
again.</para>
</important>
</step>
<step>
<title>Write the Image Files to the Floppy Disks.</title>
<para>The image files, such as <filename>kern.flp</filename>,
are <emphasis>not</emphasis> regular files you copy to the
disk. Instead, they are images of the complete contents of
the disk.</para>
<para>This means that you can <emphasis>not</emphasis> use
commands like DOS' <command>copy</command> to write the
files. Instead, you must use specific tools to write the
images directly to the disk.</para>
<indexterm><primary>DOS</primary></indexterm>
<para>If you are creating the floppies on a computer running DOS
then we provide a tool to do this called
<command>fdimage</command>.</para>
<para>If you are using the floppies from the CDROM, and your
CDROM is the <devicename>E:</devicename> drive then you would
run this:</para>
<screen><prompt>E:\&gt;</prompt> <userinput>tools\fdimage floppies\kern.flp A:</userinput></screen>
<para>Repeat this command for each <filename>.flp</filename>
file, replacing the floppy disk each time. Adjust the command
line as necessary, depending on where you have placed the
<filename>.flp</filename> files. If you do not have the
CDROM then <command>fdimage</command> can be downloaded from
the <ulink
url="ftp://ftp.FreeBSD.org/pub/FreeBSD/tools/"><filename>tools</filename> directory</ulink> on the FreeBSD FTP site.</para>
<para>If you are writing the floppies on a Unix system (such as
another FreeBSD system) you can use the &man.dd.1; command to
write the image files directly to disk. On FreeBSD you would
run:</para>
<screen>&prompt.root; <userinput>dd if=kern.flp of=/dev/fd0</userinput></screen>
<para>On FreeBSD <filename>/dev/fd0</filename> refers to the
first floppy disk (the <devicename>A:</devicename> drive).
<filename>/dev/fd1</filename> would be the
<devicename>B:</devicename> drive, and so on. Other Unix
variants might have different names for the floppy disk
devices, and you will need to check the documentation for the
system as necessary.</para>
</step>
</procedure>
</sect3>
<sect3 id="install-cdrom">
<title>Before Installing from CDROM</title>
<para>If your CDROM is of an unsupported type, please skip ahead
to the <link linkend="install-msdos">MS-DOS Preparation</link>
section.</para>
<para>There is not a whole lot of preparation needed if you are
installing from a FreeBSD CDROM. You can either boot into the
CD installation directly from DOS using the
<filename>install.bat</filename> or you can make floppies with
the <filename>makeflp.bat</filename> command.</para>
<para>If the CD has El Torito boot support and your system
supports booting directly from the CDROM drive (many older
systems do <emphasis>NOT</emphasis>), simply insert the first
CD of the set into the drive and reboot your system. You
will be put into the installation menu directly from the CD.</para>
<indexterm><primary>DOS</primary></indexterm>
<para>If you are installing from an MS-DOS partition and have
the proper drivers to access your CD, run the
<filename>install.bat</filename> script provided on the CDROM.
This will attempt to boot the FreeBSD installation directly
from DOS.</para>
<note>
<para>You must do this from actual DOS (i.e., boot in DOS
mode) and not from a DOS window under Windows.</para>
</note>
<para>For the easiest interface of all (from DOS), type
<command>view</command>. This will bring up a DOS menu utility
that leads you through all of the available options.</para>
<indexterm><primary>Unix</primary></indexterm>
<para>If you are creating the boot floppies from a Unix machine,
see the <link linkend="install-floppies">Creating the Boot
Floppies</link> section of this guide for examples.</para>
<para>Once you have booted from DOS or floppy, you should then be
able to select CDROM as the media type during the install
process and load the entire distribution from CDROM. No other
types of installation media should be required.</para>
<para>After your system is fully installed and you have rebooted
(from the hard disk), you can mount the CDROM at any time by
typing:</para>
<screen>&prompt.root; <userinput>mount /cdrom</userinput></screen>
<para>Before removing the CD from the drive again, you must first
unmount it. This is done with the following command:</para>
<screen>&prompt.root; <userinput>umount /cdrom</userinput></screen>
<para>Do not just remove it from the drive!</para>
<note>
<para>Before invoking the installation, be sure that the CDROM
is in the drive so that the install probe can find it. This
is also true if you wish the CDROM to be added to the default
system configuration automatically during the installation (whether
or not you actually use it as the installation media).</para>
</note>
<indexterm>
<primary>installation</primary>
<secondary>network</secondary>
<tertiary>FTP</tertiary>
</indexterm>
<para>Finally, if you would like people to be able to FTP install
FreeBSD directly from the CDROM in your machine, you will find
it quite easy. After the machine is fully installed, you simply
need to add the following line to the password file (using the
<command>vipw</command> command):</para>
<programlisting>ftp:*:99:99::0:0:FTP:/cdrom:/nonexistent</programlisting>
<para>Anyone with network connectivity to your machine can now
chose a media type of FTP and type in
<userinput>ftp://<replaceable>your machine</replaceable></userinput>
after picking <quote>Other</quote> in the FTP sites menu during
the install.</para>
<note><para>If you choose to enable anonymous FTP during the
installation of your system, the installation program will do
the above for you.</para></note>
</sect3>
<sect3>
<title>Before Installing from Floppies</title>
<indexterm>
<primary>installation</primary>
<secondary>floppies</secondary>
</indexterm>
<para>If you must install from floppy disk (which we suggest you
do <emphasis>NOT</emphasis> do), either due to unsupported
hardware or simply because you insist on doing things the hard
way, you must first prepare some floppies for the installation.</para>
<para>At a minimum, you will need as many 1.44MB or 1.2MB floppies
as it takes to hold all the files in the
<filename>bin</filename> (binary distribution) directory. If
you are preparing the floppies from DOS, then they
<emphasis>MUST</emphasis> be formatted using the MS-DOS
<command>FORMAT</command> command. If you are using Windows,
use Explorer to format the disks (right-click on the
<devicename>A:</devicename> drive, and select &quot;Format&quot;.</para>
<para>Do <emphasis>NOT</emphasis> trust factory pre-formatted
floppies! Format them again yourself, just to be sure. Many
problems reported by our users in the past have resulted from
the use of improperly formatted media, which is why we are
making a point of it now.</para>
<para>If you are creating the floppies on another FreeBSD machine,
a format is still not a bad idea, though you do not need to put
a DOS filesystem on each floppy. You can use the
<command>disklabel</command> and <command>newfs</command>
commands to put a UFS filesystem on them instead, as the
following sequence of commands (for a 3.5" 1.44MB floppy)
illustrates:</para>
<screen>&prompt.root; <userinput>fdformat -f 1440 fd0.1440</userinput>
&prompt.root; <userinput>disklabel -w -r fd0.1440 floppy3</userinput>
&prompt.root; <userinput>newfs -t 2 -u 18 -l 1 -i 65536 /dev/fd0</userinput></screen>
<note>
<para>Use <literal>fd0.1200</literal> and
<literal>floppy5</literal> for 5.25" 1.2MB disks.</para>
</note>
<para>Then you can mount and write to them like any other
filesystem.</para>
<para>After you have formatted the floppies, you will need to copy
the files to them. The distribution files are split into chunks
conveniently sized so that 5 of them will fit on a conventional
1.44MB floppy. Go through all your floppies, packing as many
files as will fit on each one, until you have all of the
distributions you want packed up in this fashion. Each
distribution should go into a subdirectory on the floppy, e.g.:
<filename>a:\bin\bin.aa</filename>,
<filename>a:\bin\bin.ab</filename>, and so on.</para>
<para>Once you come to the Media screen during the install
process, select <quote>Floppy</quote> and you will be prompted
for the rest.</para>
</sect3>
<sect3 id="install-msdos">
<title>Before Installing from MS-DOS</title>
<indexterm>
<primary>installation</primary>
<secondary>from MS-DOS</secondary>
</indexterm>
<para>To prepare for an installation from an MS-DOS partition,
copy the files from the distribution into a directory named,
for example, <filename>c:\FreeBSD</filename>. The directory
structure of the CDROM or FTP site must be partially reproduced
within this directory, so we suggest using the DOS
<command>xcopy</command> command if you are copying it from a
CD. For example, to prepare for a minimal installation of
FreeBSD:</para>
<screen><prompt>C:\&gt;</prompt> <userinput>md c:\FreeBSD</userinput>
<prompt>C:\&gt;</prompt> <userinput>xcopy e:\bin c:\FreeBSD\bin\ /s</userinput>
<prompt>C:\&gt;</prompt> <userinput>xcopy e:\manpages c:\FreeBSD\manpages\ /s</userinput></screen>
<para>Assuming that <devicename>C:</devicename> is where you have
free space and <devicename>E:</devicename> is where your CDROM
is mounted.</para>
<para>If you do not have a CDROM drive, you can download the
distribution from <ulink
url="ftp://ftp.FreeBSD.org/pub/FreeBSD/releases/i386/&rel.current;-RELEASE/">
ftp.FreeBSD.org</ulink>. Each distribution is in its own directory;
for example, the <emphasis>bin</emphasis> distribution can be
found in the <ulink
url="ftp://ftp.FreeBSD.org/pub/FreeBSD/releases/i386/&rel.current;-RELEASE/bin">&rel.current;/bin</ulink> directory.</para>
<para>For as many distributions you wish to install from an MS-DOS
partition (and you have the free space for), install each one
under <filename>c:\FreeBSD</filename> &mdash; the
<literal>BIN</literal> distribution is the only one required for
a minimum installation.</para>
</sect3>
<sect3>
<title>Before Installing from QIC/SCSI Tape</title>
<indexterm>
<primary>installation</primary>
<secondary>from QIC/SCSI Tape</secondary>
</indexterm>
<para>Installing from tape is probably the easiest method, short
of an online FTP install or CDROM install. The installation
program expects the files to be simply tarred onto the tape, so
after getting all of the distribution files you are interested
in, simply tar them onto the tape like so:</para>
<screen>&prompt.root; <userinput>cd /freebsd/distdir</userinput>
&prompt.root; <userinput>tar cvf /dev/rwt0 dist1 ... dist2</userinput></screen>
<para>When you go to do the installation, you should also make
sure that you leave enough room in some temporary directory
(which you will be allowed to choose) to accommodate the
<emphasis>full</emphasis> contents of the tape you have created.
Due to the non-random access nature of tapes, this method of
installation requires quite a bit of temporary storage. You
should expect to require as much temporary storage as you have
stuff written on tape.</para>
<note>
<para>When starting the installation, the tape must be in the
drive <emphasis>before</emphasis> booting from the boot
floppy. The installation probe may otherwise fail to find
it.</para>
</note>
</sect3>
<sect3>
<title>Before Installing over a Network</title>
<indexterm>
<primary>installation</primary>
<secondary>network</secondary>
<tertiary>serial (SLIP or PPP)</tertiary>
</indexterm>
<indexterm>
<primary>installation</primary>
<secondary>network</secondary>
<tertiary>parallel (PLIP)</tertiary>
</indexterm>
<indexterm>
<primary>installation</primary>
<secondary>network</secondary>
<tertiary>Ethernet</tertiary>
</indexterm>
<para>There are three types of network installations you can do.
Serial port (SLIP or PPP), Parallel port (PLIP (laplink cable)),
or Ethernet (a standard Ethernet controller (includes some
PCMCIA)).</para>
<para>The SLIP support is rather primitive, and limited primarily
to hard-wired links, such as a serial cable running between a
laptop computer and another computer. The link should be
hard-wired as the SLIP installation does not currently offer a
dialing capability; that facility is provided with the PPP
utility, which should be used in preference to SLIP whenever
possible.</para>
<para>If you are using a modem, then PPP is almost certainly
your only choice. Make sure that you have your service
provider's information handy as you will need to know it fairly
early in the installation process.</para>
<para>If you use PAP or CHAP to connect your ISP (in other
words, if you can connect to the ISP in Windows without
using a script), then all you will need to do is type in
<command>dial</command> at the
<application>ppp</application> prompt. Otherwise,
you will need to know
how to dial your ISP using the <quote>AT commands</quote>
specific to your modem, as the PPP dialer provides only a very
simple terminal emulator. Please refer
to the user-ppp <link linkend="userppp">handbook</link> and <ulink
url="../FAQ/ppp.html">FAQ</ulink> entries for further
information. If you have problems, logging can be directed to
the screen using the command <command>set log local
...</command>.</para>
<para>If a hard-wired connection to another FreeBSD (2.0-R or
later) machine is available, you might also consider installing
over a <quote>laplink</quote> parallel port cable. The data rate
over the parallel port is much higher than what is typically
possible over a serial line (up to 50kbytes/sec), thus resulting
in a quicker installation.</para>
<para>Finally, for the fastest possible network installation, an
Ethernet adapter is always a good choice! FreeBSD supports most
common PC Ethernet cards; a table of supported cards (and their
required settings) is provided in the Hardware Notes
for each release of FreeBSD. If you are
using one of the supported PCMCIA Ethernet cards, also be sure
that it is plugged in <emphasis>before</emphasis> the laptop is
powered on! FreeBSD does not, unfortunately, currently support
hot insertion of PCMCIA cards during installation.</para>
<para>You will also need to know your IP address on the network,
the netmask value for your address class, and the name of your
machine. If you are installing over a PPP connection and do not
have a static IP, fear not, the IP address can be dynamically
assigned by your ISP. Your system administrator can tell you
which values to use for your particular network setup. If you
will be referring to other hosts by name rather than IP address,
you will also need a name server and possibly the address of a
gateway (if you are using PPP, it is your provider's IP address)
to use in talking to it. If you want to install by FTP via a
HTTP proxy (see below), you will also need the proxy's address.
If you do not know the answers to all or most of these questions,
then you should really probably talk to your system administrator
or ISP <emphasis>before</emphasis> trying this type of
installation.</para>
<sect4>
<title>Before Installing via NFS</title>
<indexterm>
<primary>installation</primary>
<secondary>network</secondary>
<tertiary>NFS</tertiary>
</indexterm>
<para>The NFS installation is fairly straight-forward. Simply
copy the FreeBSD distribution files you want onto a server
somewhere and then point the NFS media selection at it.</para>
<para>If this server supports only <quote>privileged port</quote>
(as is generally the default for Sun workstations), you will
need to set this option in the Options menu before
installation can proceed.</para>
<para>If you have a poor quality Ethernet card which suffers
from very slow transfer rates, you may also wish to toggle the
appropriate Options flag.</para>
<para>In order for NFS installation to work, the server must
support subdir mounts, e.g., if your FreeBSD 3.4 distribution
directory lives
on:<filename>ziggy:/usr/archive/stuff/FreeBSD</filename>, then
<hostid>ziggy</hostid> will have to allow the direct mounting
of <filename>/usr/archive/stuff/FreeBSD</filename>, not just
<filename>/usr</filename> or
<filename>/usr/archive/stuff</filename>.</para>
<para>In FreeBSD's <filename>/etc/exports</filename> file, this
is controlled by the <option>-alldirs</option>. Other NFS
servers may have different conventions. If you are getting
<quote>permission denied</quote> messages from the server, then
it is likely that you do not have this enabled
properly.</para>
</sect4>
<sect4>
<title>Before Installing via FTP</title>
<indexterm>
<primary>installation</primary>
<secondary>network</secondary>
<tertiary>FTP</tertiary>
</indexterm>
<para>FTP installation may be done from any FreeBSD mirror site
containing a reasonably up-to-date version of FreeBSD. A full
list of FTP mirrors located all over the world is provided
during the install process.</para>
<para>If you are installing from an FTP site not listed in this
menu, or are having trouble getting your name server
configured properly, you can also specify a URL to use by
selecting the choice labeled <quote>Other</quote> in that menu.
You can also use the IP address of a machine you wish to
install from, so the following would work in the absence of a
name server:</para>
<screen><userinput>ftp://209.55.82.20/pub/FreeBSD/&rel.current;-RELEASE</userinput></screen>
<para>There are three FTP installation modes you can choose from:
active or passive FTP or via a HTTP proxy.</para>
<variablelist>
<varlistentry>
<term>FTP Active</term>
<listitem>
<para>This option will make all FTP transfers
use <quote>Active</quote>
mode. This will not work through firewalls, but will
often work with older FTP servers that do not support
passive mode. If your connection hangs with passive
mode (the default), try active!</para>
</listitem>
</varlistentry>
<varlistentry>
<term>FTP Passive</term>
<listitem>
<indexterm>
<primary>FTP</primary>
<secondary>Passive mode</secondary>
</indexterm>
<para>This option instructs FreeBSD to use
<quote>Passive</quote> mode for all FTP operations.
This allows the user to pass through firewalls
that do not allow incoming connections on random port
addresses.</para>
</listitem>
</varlistentry>
<varlistentry>
<term>FTP via a HTTP proxy</term>
<listitem>
<indexterm>
<primary>FTP</primary>
<secondary>via a HTTP proxy</secondary>
</indexterm>
<para>This option instructs FreeBSD to use the HTTP
protocol (like a web browser) to connect to a proxy
for all FTP operations. The proxy will translate
the requests and send them to the FTP server.
This allows the user to pass through firewalls
that do not allow FTP at all, but offer a HTTP
proxy.
In this case, you have to specify the proxy in
addition to the FTP server.</para>
</listitem>
</varlistentry>
</variablelist>
<note>
<para>There is another type of FTP proxy other tha HTTP
proxies. This type is very uncommon, though. If you
are not absolutely certain, you can assume that you
have a HTTP proxy as described above.</para>
</note>
<para>For a proxy FTP server, you should usually give the name
of the server you really want as a part of the username, after
an <quote>@</quote> sign. The proxy server then
<quote>fakes</quote> the real server. For example, assuming
you want to install from <hostid
role="fqdn">ftp.FreeBSD.org</hostid>, using the proxy FTP
server <hostid role="fqdn">foo.bar.com</hostid>, listening on
port 1024.</para>
<para>In this case, you go to the options menu, set the FTP
username to ftp@ftp.FreeBSD.org, and the password to your
email address. As your installation media, you specify FTP
(or passive FTP, if the proxy supports it), and the URL
<literal>ftp://foo.bar.com:1234/pub/FreeBSD</literal>.</para>
<para>Since <filename>/pub/FreeBSD</filename> from <hostid
role="fqdn">ftp.FreeBSD.org</hostid> is proxied under <hostid
role="fqdn">foo.bar.com</hostid>, you are able to install from
<emphasis>that</emphasis> machine (which will fetch the files
from <hostid role="fqdn">ftp.FreeBSD.org</hostid> as your
installation requests them.</para>
</sect4>
</sect3>
<sect3>
<title>Check Your BIOS Drive Numbering</title>
<para>If you have used features in your BIOS to renumber your disk
drives without re-cabling them then you should read <xref
linkend="disks-bios-numbering"> first to avoid confusion.</para>
</sect3>
</sect2>
<sect2 id="install-freebsd">
<title>Installing FreeBSD</title>
<para>Once you have completed the pre-installation step relevant to
your situation, you are ready to install FreeBSD!</para>
<para>Although you should not experience any difficulty, there is
always the chance that you may, no matter how slight it is. If this
is the case in your situation, then you may wish to go back and
re-read the relevant preparation section or sections. Perhaps you
will come across something you missed the first time. If you are
having hardware problems, or FreeBSD refuses to boot at all, read
the <ulink url="../FAQ/hardware.html">Hardware Guide</ulink> for a
list of possible solutions.</para>
<indexterm>
<primary><application>sysinstall</application></primary>
</indexterm>
<para>The FreeBSD boot floppies contain all of the online
documentation you should need to be able to navigate through an
installation. If it does not, please let us know what you found
to be the most confusing or most lacking. Send your comments to
the &a.doc;. It is the objective of the installation program
(sysinstall) to be self-documenting enough that painful
<quote>step-by-step</quote> guides are no longer necessary. It may
take us a little while to reach that objective, but nonetheless,
it is still our objective.</para>
<para>Meanwhile, you may also find the following <quote>typical
installation sequence</quote> to be helpful:</para>
<orderedlist>
<listitem>
<para>Boot the <filename>kern.flp</filename> floppy and when
asked, remove it and insert the
<filename>mfsroot.flp</filename> and hit return. After a
boot sequence which can take anywhere from 30 seconds to 3
minutes, depending on your hardware, you should be presented
with a menu of initial choices. If the
<filename>kern.flp</filename> floppy does not boot at all or
the boot hangs at some stage, read the Q&amp;A section of the
<ulink url="../FAQ/hardware.html">Hardware Guide</ulink> for
possible causes.</para>
</listitem>
<listitem>
<para>Press F1. You should see some basic usage instructions on
the menu screen and general navigation. If you have not used
this menu system before then <emphasis>please</emphasis> read
this thoroughly.</para>
</listitem>
<listitem>
<para>Select the Options item and set any special preferences
you may have.</para>
</listitem>
<indexterm>
<primary>installation</primary>
<secondary>standard</secondary>
</indexterm>
<indexterm>
<primary>installation</primary>
<secondary>express</secondary>
</indexterm>
<indexterm>
<primary>installation</primary>
<secondary>custom</secondary>
</indexterm>
<listitem>
<para>Select a Standard, Express, or Custom install, depending on
whether or not you would like the installation to help you
through a typical installation, give you a high degree of
control over each step, or simply whiz through it (using
reasonable defaults when possible) as fast as possible. If
you have never used FreeBSD before, the Standard installation
method is most recommended.</para>
</listitem>
<listitem>
<para>The final configuration menu choice allows you to further
configure your FreeBSD installation by giving you menu-driven
access to various system defaults. Some items, like
networking, may be especially important if you did a CDROM,
tape, or floppy install and have not yet configured your
network interfaces (assuming you have any). Properly
configuring such interfaces here will allow FreeBSD to come up
on the network when you first reboot from the hard
disk.</para>
</listitem>
</orderedlist>
</sect2>
</sect1>
+ <sect1 id="install-pre">
+ <title>Pre-Installation</title>
+
+ <para>Starting the installation will not make any changes
+ to the system until this warning message appears :</para>
+
+ <screen>Last Chance: Are you SURE your want continue the installation?
+
+If you're running this on a disk with data you wish to save then WE
+STRONGLY ENCOURAGE YOU TO MAKE PROPER BACKUPS before proceeding!
+
+We can take no responsibility for lost disk contents!</screen>
+
+ <para>The install can be exited at any time prior to the final
+ warning without changing the contents of the hard drive.</para>
+
+ <sect2 id="install-starting">
+ <title>Starting The Installation Process</title>
+
+ <para>If booting from floppies, put the <filename>kern.flp</filename>
+ disk in the floppy drive before booting the system.</para>
+
+ <para>If the CDROM drive is a bootable type, it is not necessary to
+ make the boot floppies. The CD must be in the drive
+ <emphasis>before</emphasis> you boot in order to be sure it is found
+ by the hardware probe.</para>
+
+ <important>
+ <para>BIOS settings may need to be adjusted.</para>
+
+ <para>It may be necessary to enter the BIOS setup and set it to use
+ the CDROM or the floppy drive as the appropriate boot option. Be
+ sure to change it back after installation to boot from the
+ appropriate drive.</para>
+
+ <para>It might also be necessary to turn off the BIOS Plug and Play
+ (PnP) option so that some hardware will be detected
+ correctly.</para>
+ </important>
+
+ <para>Power down and restart the system. The normal BIOS startup
+ screens display until it starts booting from the floppy or
+ CDROM. If you are booting from floppies, it will ask for the
+ <filename>mfsroot.flp</filename> floppy disk next, after which the
+ installation will proceed.</para>
+
+ <para>The "twirling baton" that is seen indicates that the installation
+ program is loading.</para>
+
+ <para>Typical booting from CDROM</para>
+
+ <screen>Verifying DMI Pool Data ........
+Boot from ATAPI CD-ROM :
+ 1. FD 2.88MB System Type-(00)
+/boot.config: -P
+Keyboard: yes
+BTX loader 1.00& BTX version is 1.01
+Console: internal video/keyboard
+BIOS drive A: is disk0
+BIOS drive B: is disk1
+BIOS drive C: is disk2
+BIOS drive C: is disk3
+BIOS 639kB/64512kB available memory
+FreeBSD/i386 bootstrap loader, Revision 0.8
+(jkh@bento.freebsd.org, Mon Nov 20 11:41:23 GMT 2000)
+|
+Hit [Enter] to boot immediately, or any other key for command prompt.
+Booting [kernel] in 9 seconds... _</screen>
+
+ <para>Typical booting from floppies</para>
+
+ <screen>Verifying DMI Pool Data ........
+
+BTX loader 1.00 BTX version is 1.01
+Console: internal video/keyboard
+BIOS drive A: is disk0
+BIOS drive C: is disk1
+BIOS 639kB/261120kB available memory
+
+FreeBSD/i386 bootstrap loader, Revision 0.8
+ (jkh@narf.osd.bsdi.com, Sat Apr 21 08:46:19 GMT 2001)
+/kernel text=0x24f1bb data=0x307ac+0x2062c |
+
+Please insert MFS root floppy and press enter:</screen>
+
+ <para>A beep will sound and a screen message will say to remove
+ the <filename>kern.flp</filename> disk, insert the
+ <filename>mfsroot.flp</filename> disk and press <keycap>ENTER</keycap>.
+ The loading of the installation program will then continue.</para>
+
+ <screen>Hit [Enter] to boot immediately, or any other key for command prompt.
+Booting [kernel] in 9 seconds... _</screen>
+
+ <para>Regardless of how the installation program is started, the boot
+ prompt will appear with a countdown to boot. Do nothing and in
+ about 10 seconds, it will continue to boot or press
+ <keycap>ENTER</keycap> to continue immediately.</para>
+ </sect2>
+
+ <sect2 id="start-userconfig">
+ <title>Starting UserConfig</title>
+
+ <para>This starts the <command>UserConfig</command> program which
+ is used to tell the system what hardware to probe and where
+ to look. The best way to learn the <command>UserConfig</command>
+ is to practice a few times.</para>
+
+ <para>The method recommended for new users is "Start kernel
+ configuration in full screen Visual mode". Press the
+ down arrow key to highlight the item and then press
+ <keycap>ENTER</keycap>.</para>
+
+ <figure id="kernel-config">
+ <title>Start Kernel Configuration Menu</title>
+
+ <mediaobject>
+ <imageobject>
+ <imagedata fileref="install/userconfig" format="PNG">
+ </imageobject>
+ </mediaobject>
+ </figure>
+ </sect2
+
+ <sect2 id="layout">
+ <title>Layout of UserConfig</title>
+
+ <para>The first screen shows the layout of <command>UserConfig</command>
+ and indicates the number of hardware conflicts present. The
+ categories of device drivers (Storage, Network, etc.) are initially
+ shown as a collapsed lists and can be expanded.</para>
+
+ <figure id="fig-userconfig">
+ <title>UserConfig</title>
+
+ <mediaobject>
+ <imageobject>
+ <imagedata fileref="install/userconfig2" format="PNG">
+ </imageobject>
+ </mediaobject>
+ </figure>
+
+ <para>As the menu at the bottom indicates, pressing <keycap>?</keycap>
+ will display information about screen layout, moving
+ around, altering the list/parameters, and saving changes.</para>
+
+ <para>When finished reviewing the instructions, press <keycap>Q</keycap>
+ to return to the UserConfig kernel settings editor.</para>
+ </sect2>
+
+ <sect2 id="hardwareconflicts">
+ <title>Resolve Hardware Conflicts</title>
+
+ <para>The first operating system kernel installed is a "GENERIC"
+ kernel. It includes a wide variety of hardware probes for
+ different system hardware configurations. Probing is the
+ name used for the process of detecting the presence of
+ particular hardware.</para>
+
+ <para>The drivers included in the GENERIC kernel often have the
+ same IRQ/Port information and will be indicated as
+ "Conflicts". The <command>UserConfig</command> utility is used
+ to disable the unnecessary hardware probes and eliminate the
+ conflicts.</para>
+
+ <para>The objective is to specify the hardware probes to be
+ "Active" in the system and have no conflicts between
+ them. Certain situations will have "permitted conflicts" and
+ will be indicated at the bottom of the Editor screen.</para>
+
+ <para>Pressing <keycap>X</keycap> will expand all of the collapsed
+ fields so the conflicts can be examined in detail.</para>
+
+ <figure id="hardware-conflicts">
+ <title>Typical Hardware Conflicts</title>
+
+ <mediaobject>
+ <imageobject>
+ <imagedata fileref="install/hdwrconf" format="PNG">
+ </imageobject>
+ </mediaobject>
+ </figure>
+
+ <para>Most of the conflicts are generated by hardware that is not
+ present and should be eliminated first.</para>
+
+ <para>In general, do <emphasis>not</emphasis> disable the Keyboard
+ (<hardware>atkbd0</hardware>) or the Syscons console driver
+ (<hardware>sc0</hardware>).
+ <emphasis>You need these</emphasis>. If a USB keyboard is being
+ used, it may be necessary to disable the <hardware>atkbd0</hardware>
+ keyboard driver.</para>
+
+ <para>Disable unused drivers by highlighting and pressing
+ <keycap>DELETE</keycap>. This will move the driver to the Inactive
+ Driver list and reduce the total number of conflicts if one had
+ existed. Eliminate all the unused drivers first.</para>
+
+ <para>The conflicts that are left need to be examined. If they do
+ not have the indication of an "allowed conflict" in the message
+ area, then either the IRQ/address for device probe will need to
+ be changed - or - the IRQ/address on the hardware will need to
+ be changed.</para>
+ </sect2>
+
+ <sect2 id="probestart">
+ <title>Start Hardware Probe</title>
+
+ <para>When the hardware conflicts have been resolved, the probe is
+ started. In this example, moving all the unused device probes to
+ the "Inactive" list left no conflicts.</para>
+
+ <figure id="userconfig-done">
+ <title>User Config Completed</title>
+
+ <mediaobject>
+ <imageobject>
+ <imagedata fileref="install/probstart" format="PNG">
+ </imageobject>
+ </mediaobject>
+ </figure>
+
+ <para>The actual probing can now be started by pressing
+ <keycap>Q</keycap> to quit. A message will appear : </para>
+
+ <screen>Save these parameters before exiting? ([Y]es/[N]o/[C]ancel)</screen>
+
+ <para>Answer <keycap>Y</keycap> to save the parameters and the
+ probing will start. The results will scroll off the screen and the
+ Main Installation screen will display.</para>
+ </sect2>
+
+ <sect2 id="view-probe">
+ <title>Viewing Probe Results</title>
+
+ <figure id="sysinstall-main">
+ <title>Sysinstall Main Menu</title>
+
+ <mediaobject>
+ <imageobject>
+ <imagedata fileref="install/main1" format="PNG">
+ </imageobject>
+ </mediaobject>
+ </figure>
+
+ <para>The results of the probing can be viewed by pressing the
+ <keycap>SCROLL LOCK</keycap> and using <keycap>PageUp</keycap> and
+ <keycap>PageDown</keycap> to view the results.</para>
+
+ <para>Pressing <keycap>SCROLL LOCK</keycap> again will return to the
+ Main Installation screen.</para>
+
+ <para>Typical hardware probe results:</para>
+
+ <screen>avail memory = 58880000 (57500K bytes)
+Preloaded elf kernel "kernel" at 0xc065d000.
+md1: Malloc disk
+npx0: &lt;math processor> on motherboard
+npx0: INT 16 interface
+pcib0: &lt;Host to PCI bridge> on motherboard
+pci0: &lt;PCI bus> on pcib0
+pcib1: &lt;VIA 82C598MVP (Apollo MVP3) PCI-PCI (AGP bridge> at device 1.0 on pci0
+pci1: &lt;PCI bus> on pcib1
+pci1: &lt;Matrox MGA G200 AGP graphics accelerator> at 0.0 irq 11
+isab0: &lt;VIA 82C586 PCI-ISA bridge> at device 7.0 on pci0
+isa0: &lt;ISA bus> on isab0
+atapci0: &lt;VIA 82C586 ATA33 controller> port 0xe000-0xe00f at device 7.1 on pci0
+ata0: at 0x1f0 irq 14 on atapci0
+uhci0: &lt;VIA 83C572 USB controller> port 0xe400-0xe41f irq 10 at device 7.2 on pci0
+usb0: &lt;VIA 83C572 USB controller> on uhci0
+usb0: USB revision 1.0
+uhub0: VIA UHCI root hub, class 9/0, rev 1.00/1.00, addr 1
+uhub0: 2 ports with 2 removable, self powered
+chip1: &lt;VIA 82C586B ACPI interface> at device 7.3 on pci0
+isa0: too many dependant configs (8)
+isa0: unexpected small tag 14
+fdc0: &lt;NEC 72065B or clone> at port 0x3f0-0x3f5,0x3f7 irq6 drq2 on isa0
+fdc0: FIFO enabled, 8 bytes threshold
+fd0: &lt;1440-KB 3.5" drive> on fdc0 drive 0
+atkbdc0: &lt;keyboard controller (i8042)> at port 0x60-0x6f on isa0
+atkbd0: &lt;AT Keyboard> flags 0x1 irq 1 on atkbdc0
+kbd0 at atkbd0
+psm0: &lt;PS/2 Mouse> irq 12 on atkbdc0
+psm0: model Generic PS/2 mouse, device ID 0
+vga0: &lt;Generic ISA VGA> at port 0x3c0-0c3df iomem 0xa0000-0xbffff on isa0
+sc0: &lt;System console> at flags 0x100 on isa0
+sc0: VGA &lt;16 virtual consoles, flags-0x300>
+sio0 at port 0x3f8-0x3ff irq 4 flags 0x10 on isa0
+sio0: type 16550A
+sio1: at port 0x2f8-0x2ff irq3 on isa0
+sio1: type 16550A
+ppc0: &lt;Parallel port> at port 0x378-0x37f irq 7 on isa0
+ppc0: SMC-like chipset (ECP/EPP/PS2/NIBBLE) in COMPATIBLE mode
+ppc0: FIFO with 16/16/15 bytes threshold
+ppi0: &lt;Parallel I/O> on ppbus0
+plip0: &lt;PLIP network interface> on ppbus0
+ad0: 8063MB &lt;IBM-DHEA-38451> [16383/16/63] at ata0-master using UDMA33
+acd0: CDROM &lt;DELTA OTC-H101/ST3 F/W by OIPD> at ata0-slave using PIO4
+Mounting root from ufs:/dev/md0c
+/stand/sysinstall running as init on vty0</screen>
+
+ <para>The results of the hardware probing will depend on the
+ system hardware. Check it carefully to confirm it found the
+ hardware. Hardware problems should be corrected before
+ continuing with the installation.</para>
+
+ <para>It might be useful to record the probe results until the
+ system is up and running. This installation produced messages
+ which needed checking. Information regarding these messages
+ were found by <ulink
+ url="http://www.freebsd.org/search/search.html#mailinglists">searching
+ the mailing lists</ulink> (questions and bugs).</para>
+
+ <para>The "unexpected tag 14" or "unexpected small tag 14"
+ indication can be ignored. This should disappear in future
+ releases.</para>
+
+ <para>An ISA-device (AWE64 sound card) gave too many proposals for
+ possible PnP-Configurations and produced "isa0: too many
+ dependant configs (8)". This should be harmless. Support for
+ the sound card can be added after installation by building a new
+ kernel with the sound driver or by loading the sound modules
+ dynamically.</para>
+ </sect2>
+
+ <sect2 id="probechange">
+ <title>Changing UserConfig Device Probing</title>
+
+ <para>If you need to make changes to the UserConfig device probing,
+ its easy to exit the <command>sysinstall</command> program
+ and start over again. Its also a good way to become more familar
+ with the process.</para>
+
+ <figure id="sysinstall-exit">
+ <title>Select Sysinstall Exit</title>
+
+ <mediaobject>
+ <imageobject>
+ <imagedata fileref="install/sysinstall-exit" format="PNG">
+ </imageobject>
+ </mediaobject>
+ </figure>
+
+ <para>Use the arrow keys to select "Exit Install" from the Main
+ Install Screen menu. The following message will display:</para>
+
+
+ <screen> User Confirmation Requested
+ Are you sure you wish to exit? The system will reboot
+ (be sure to remove any floppies from the drives).
+
+ [ Yes ] No</screen>
+
+ <para>The install program will start again if the CDROM is left
+ in the drive and [Yes] is selected.</para>
+
+ <para>If booting from floppies, to restart the installation it will be
+ necessary to remove the <filename>mfs.root</filename> floppy and
+ replace it with <filename>kern.flp</filename> before rebooting.</para>
+
+ <para>This will allow trying the device probing a few times and
+ fine-tune it before continuing with the installation process.</para>
+ </sect2>
+
+ <sect2 id="using-sysinstall">
+ <title>How To Use Sysinstall</title>
+
+ <figure id="sysinstall-main3">
+ <title>Select Usage From Main Menu</title>
+
+ <mediaobject>
+ <imageobject>
+ <imagedata fileref="install/main1" format="PNG">
+ </imageobject>
+ </mediaobject>
+ </figure>
+
+ <para>To learn how to use the menu system, use the arrow keys to
+ select "Usage" and press <keycap>ENTER</keycap>.</para>
+
+ <para>The instructions for using the menu system will
+ display. After reviewing, pressing <keycap>ENTER</keycap> will
+ return to the Main Menu.</para>
+
+ </sect2>
+
+ <sect2 id="select-doc">
+ <title>Selecting The Documentation Menu</title>
+
+ <para>From the Main Menu, select "Doc" with the arrow keys and
+ press <keycap>ENTER</keycap>.</para>
+
+ <figure id="main-doc">
+ <title>Selecting Documentation Menu</title>
+
+ <mediaobject>
+ <imageobject>
+ <imagedata fileref="install/main-doc" format="PNG">
+ </imageobject>
+ </mediaobject>
+ </figure>
+
+ <para>This will display the Documentation Menu.</para>
+
+ <figure id="docmenu1">
+ <title>Sysinstall Documentation Menu</title>
+
+ <mediaobject>
+ <imageobject>
+ <imagedata fileref="install/docmenu1" format="PNG">
+ </imageobject>
+ </mediaobject>
+ </figure>
+
+ <para>It is important to read the documents provided.</para>
+
+ <para>To view a document, select it with the arrow keys and
+ press <keycap>ENTER</keycap>. When finished reading a document,
+ pressing <keycap>ENTER</keycap> will return to the Documentation
+ Menu.</para>
+
+ <para>To return to the Main Installation Menu, select "Exit" with the
+ arrow keys and press <keycap>ENTER</keycap>.</para>
+ </sect2>
+
+ <sect2 id="keymap">
+ <title>Selecting The Keymap Menu</title>
+
+ <para>To change the keyboard mapping, use the arrow keys to select
+ "Keymap" from the menu and press <keycap>ENTER</keycap></para>
+
+ <figure id="sysinstall-keymap">
+ <title>Sysinstall Main Menu</title>
+
+ <mediaobject>
+ <imageobject>
+ <imagedata fileref="install/main-keymap" format="PNG">
+ </imageobject>
+ </mediaobject>
+ </figure>
+
+ <para>A different keyboard mapping may be chosen by selecting the
+ menu item using up/down arrow keys and pressing <keycap>SPACE</keycap>.
+ Pressing <keycap>SPACE</keycap> again will unselect the item. When
+ finished, choose the [OK] item using the arrow keys and press
+ <keycap>ENTER</keycap>.</para>
+
+ <para>Only a partial list is shown in this screen representation.
+ Selecting [CANCEL] will use the default keymap and return to the
+ Main Install Menu.</para>
+
+ <figure id="sysinstall-keymap-menu">
+ <title>Sysinstall Keymap Menu</title>
+
+ <mediaobject>
+ <imageobject>
+ <imagedata fileref="install/keymap" format="PNG">
+ </imageobject>
+ </mediaobject>
+ </figure>
+
+ </sect2>
+
+ <sect2 id="viewsetoptions">
+ <title>Installation Options Screen</title>
+
+ <para>Select "Options" and press <keycap>ENTER</keycap></para>
+
+ <figure id="sysinstall-options">
+ <title>Sysinstall Main Menu</title>
+
+ <mediaobject>
+ <imageobject>
+ <imagedata fileref="install/main-options" format="PNG">
+ </imageobject>
+ </mediaobject>
+ </figure>
+
+ <figure id="options">
+ <title>Sysinstall Options</title>
+
+ <mediaobject>
+ <imageobject>
+ <imagedata fileref="install/options" format="PNG">
+ </imageobject>
+ </mediaobject>
+ </figure>
+
+ <para>The default values are usually fine for most users and do
+ not need to be changed.</para>
+
+ <para>The description of the selected item will appear at the
+ bottom of the screen highlighted in blue. Notice that one of the
+ options is "Use Defaults" to reset all values to startup
+ defaults.</para>
+
+ <para>Press <keycap>F1</keycap> to read the help screen about the
+ various options.</para>
+
+ <para>Pressing <keycap>Q</keycap> will return to the Main Install
+ menu.</para>
+ </sect2>
+ </sect1>
+
+ <sect1 id="install-steps">
+ <title>Installation</title>
+
+ <para></para>
+
+ <sect2 id="start-install">
+ <title>Begin A Standard Installation</title>
+
+ <para>The "Standard" installation is the option recommended for those
+ new to unix or FreeBSD. Use the arrow keys to select "Standard" and
+ then press <keycap>ENTER</keycap> to start the installation.</para>
+
+ <figure id="sysinstall-standard">
+ <title>Begin Standard Installation</title>
+
+ <mediaobject>
+ <imageobject>
+ <imagedata fileref="install/main-std" format="PNG">
+ </imageobject>
+ </mediaobject>
+ </figure>
+ </sect2>
+
+ <sect2 id="main-fdisk">
+ <title>FDISK Partition Editor</title>
+
+
+ <screen> Message
+ In the next menu, you will need to set up a DOS-style ("fdisk")
+ partitioning scheme for your hard disk. If you simply wish to devote
+ all disk space to FreeBSD (overwriting anything else that might be on
+ the disk(s) selected) then use the (A)ll command to select the default
+ partitioning scheme followed by a (Quit. If you wish to allocate only
+ free space to FreeBSD, move to a partition marked "unused" and use the
+ (C)reate command.
+ [ OK ]
+
+ [ Press enter to continue ]</screen>
+
+ <figure id="sysinstall-fdisk-drive1">
+ <title>Select Drive for FDISK</title>
+
+ <mediaobject>
+ <imageobject>
+ <imagedata fileref="install/fdisk-drive1" format="PNG">
+ </imageobject>
+ </mediaobject>
+ </figure>
+
+ <note><para>The following instructions for FDISK are for using the
+ entire hard disk for the FreeBSD installation. If you want to
+ use multiple operating systems, please refer to the tutorials at
+ <ulink url="http://www.freebsd.org/tutorials">http://www.freebsd.org/tutorials</ulink></para></note>
+ </sect2>
+
+ <sect2 id="fdisk-editor">
+ <title>FDISK Partition Editor</title>
+
+ <para>The FDISK Partition Editor will display the
+ <emphasis>current</emphasis> hard disk settings. The appearance
+ of the screen will vary depending on the size of the hard disk
+ installed and how it was set up previously.</para>
+
+ <para>The following screen representation would be similar to a
+ system which had DOS/Windows installed. Pressing <keycap>F1</keycap>
+ will display important information about using the FDISK Partition
+ Editor.</para>
+
+ <figure id="sysinstall-fdisk1">
+ <title>Typical Fdisk Partitions Before Editing</title>
+
+ <mediaobject>
+ <imageobject>
+ <imagedata fileref="install/fdisk-edit1" format="PNG">
+ </imageobject>
+ </mediaobject>
+ </figure>
+ </sect2>
+
+ <sect2 id="fdiskall">
+ <title>Creating a FreeBSD Slice using the Entire Disk</title>
+
+ <para>The tutorial <ulink
+ url="http://www.freebsd.org/tutorials/multi-os/">Installing and
+ Using FreeBSD With Other Operating Systems</ulink> provides
+ information on multi-os installations.</para>
+
+ <para>For this particular system, <keycap>A</keycap> was selected to
+ use the entire disk for the FreeBSD installation. Remember,
+ <emphasis>all</emphasis> data currently on the hard disk
+ <emphasis>will</emphasis> be lost using this method.</para>
+
+ <para>The following illustrates how a FDISK Partition Editor
+ screen will appear after choosing to use the entire hard disk
+ and to remain compatible with future operating systems.</para>
+
+ <para>The first line indicates the space allocated for the master
+ boot record.</para>
+
+ <para>The FreeBSD slice was created as shown on the second
+ line. The next step is to set the freebsd slice as
+ bootable.</para>
+
+ <figure id="sysinstall-fdisk2">
+ <title>Fdisk Partition Using Entire Disk</title>
+
+ <mediaobject>
+ <imageobject>
+ <imagedata fileref="install/fdisk-edit2" format="PNG">
+ </imageobject>
+ </mediaobject>
+ </figure>
+
+ <para>Use the arrow keys to highlight the FreeBSD slice and press
+ <keycap>S</keycap> to set the slice as bootable. The illustration
+ below shows the FreeBSD Slice as set as bootable. The flags should
+ indicate "CA" before you leave this screen.</para>
+
+ <para>When finished, press <keycap>Q</keycap> to save the changes and
+ quit and continue with the installation.</para>
+ </sect2>
+
+ <sect2 id="bootmgr">
+ <title>Install a Boot Manager</title>
+
+ <para>First, highlight the boot manager option desired using the
+ arrow keys, then press <keycap>SPACE</keycap>. An asterik "*" will
+ indicate the selection chosen. This installation was solely FreeBSD
+ so a boot manager was not needed.</para>
+
+ <para>When finished, select [OK] and press <keycap>ENTER</keycap>.</para>
+
+ <figure id="sysinstall-bootmgr">
+ <title>Sysinstall Boot Manager Menu</title>
+
+ <mediaobject>
+ <imageobject>
+ <imagedata fileref="install/boot-mgr" format="PNG">
+ </imageobject>
+ </mediaobject>
+ </figure>
+
+ <para>The help screen discusses the problems that can be
+ encountered when trying to share the hard disk between operating
+ systems.</para>
+
+ <para>If there is more than one drive, it will return to the
+ Select Drives screen after the boot manager selection.</para>
+
+ <figure id="sysinstall-fdisk-drive2">
+ <title>Exit Select Drive</title>
+
+ <mediaobject>
+ <imageobject>
+ <imagedata fileref="install/fdisk-drive2" format="PNG">
+ </imageobject>
+ </mediaobject>
+ </figure>
+
+ <para>Make sure [OK] is highlighted, then press <keycap>ENTER</keycap>
+ to continue with the installation.</para>
+ </sect2>
+
+ <sect2 id="disklabeleditor">
+ <title>Initial Disklabel Screen</title>
+
+ <screen> Message
+ Now, you need to create BSD partitions inside of the fdisk
+ partition(s) just created. If you have a reasonable amount of disk
+ space (200MB or more) and don't have any special requirements, simply
+ use the (A)uto command to allocate space automatically. If you have
+ more specific needs or just don't care for the layout chosen by
+ (A)uto, press F1 for more information on manual layout.
+
+ [ OK ]
+
+ [ Press enter to continue ]</screen>
+
+ <para>There are no partitions shown when you first enter the
+ editor.</para>
+
+ <figure id="sysinstall-label">
+ <title>Sysinstall Disklabel Editor</title>
+
+ <mediaobject>
+ <imageobject>
+ <imagedata fileref="install/disklabel-ed1" format="PNG">
+ </imageobject>
+ </mediaobject>
+ </figure>
+
+ <para>Pressing <keycap>F1</keycap> will give instructions for using
+ the DiskLabel Editor. Press <keycap>Q</keycap> to continue.</para>
+ </sect2>
+
+ <sect2 id="partitionauto">
+ <title>Auto Defaults for Partitions</title>
+
+ <para>Pressing <keycap>A</keycap> displayed the suggested disklabels
+ for this particular disk size. If a small hard disk is being used,
+ the default values may be appropriate.</para>
+
+ <figure id="sysinstall-label2">
+ <title>Sysinstall Disklabel Editor With Auto Defaults</title>
+
+ <mediaobject>
+ <imageobject>
+ <imagedata fileref="install/disklabel-auto" format="PNG">
+ </imageobject>
+ </mediaobject>
+ </figure>
+ </sect2>
+
+ <sect2 id="partitionchange">
+ <title>Creating Custom Partitions</title>
+
+ <para>Write down the auto defaults for all the file systems (/,
+ swap, /var, /usr). Using the arrow keys, select the first
+ partition ( / ) and press <keycap>D</keycap> to delete the
+ partition. Delete all the partitions in the same manner.</para>
+
+ <para>It is easiest to create the partitions in the same order
+ shown by the auto default.</para>
+
+ <sect3>
+ <title>Example Custom Partition</title>
+
+ <para>To create the root partition, first press <keycap>C</keycap>
+ and a dialog box will appear showing the total
+ space available in blocks :</para>
+
+ <figure id="sysinstall-label-add">
+ <title>Free Space For Root Partition</title>
+
+ <mediaobject>
+ <imageobject>
+ <imagedata fileref="install/disklabel-root1" format="PNG">
+ </imageobject>
+ </mediaobject>
+ </figure>
+
+ <para>This example will set the root partition to 100M. First, delete
+ the entry using the <keycap>BACKSPACE</keycap> and enter the desired
+ value :</para>
+
+ <figure id="sysinstall-label-add2">
+ <title>Edit Root Partition Size</title>
+
+ <mediaobject>
+ <imageobject>
+ <imagedata fileref="install/disklabel-root2" format="PNG">
+ </imageobject>
+ </mediaobject>
+ </figure>
+
+ <para>With [OK] highlighted, then press <keycap>ENTER</keycap>. The
+ following dialog box will display :</para>
+
+ <figure id="sysinstall-label-type">
+ <title>Choose The Root Partition Type</title>
+
+ <mediaobject>
+ <imageobject>
+ <imagedata fileref="install/disklabel-fs" format="PNG">
+ </imageobject>
+ </mediaobject>
+ </figure>
+
+ <para>The root partition needs to be a file system. With "FS"
+ and [OK] highlighted, press <keycap>ENTER</keycap>.</para>
+
+ <para>The next dialog box to appear is to enter the mount
+ point for the root partition. Enter "/" for the root partition
+ mount point. With the [OK] highlighted, press
+ <keycap>ENTER</keycap>.</para>
+
+ <figure id="sysinstall-label-mount">
+ <title>Choose The Root Mount Point</title>
+
+ <mediaobject>
+ <imageobject>
+ <imagedata fileref="install/disklabel-root3" format="PNG">
+ </imageobject>
+ </mediaobject>
+ </figure>
+
+ <para>The swap, /var and /usr partitions are created in the
+ same way. Be sure to choose "swap" as the filesystem type
+ for the swap partition.</para>
+
+ <para>Generally the swap
+ value is twice the amount of RAM in the system. For this
+ system, the "swap" partition will be set to 516M.</para>
+
+ <para>The "/var" partition will be set to 100M and the "/usr"
+ partition will get the remaining amount of disk space.</para>
+
+ <para>Your final FreeBSD DiskLabel Editor screen will appear similar
+ although your values chosen may be different. Press
+ <keycap>Q</keycap> to finish.</para>
+
+ <figure id="sysinstall-label4">
+ <title>Sysinstall Disklabel Editor</title>
+
+ <mediaobject>
+ <imageobject>
+ <imagedata fileref="install/disklabel-ed2" format="PNG">
+ </imageobject>
+ </mediaobject>
+ </figure>
+ </sect3>
+ </sect2>
+
+ <sect2 id="distset">
+ <title>Select The Distribution Set</title>
+
+ <para>I chose to install everything using the "All" option since I
+ had the hard drive space. If you're concerned about space,
+ consider the other distribution options.</para>
+
+ <para>Select "All" using the arrow keys to highlight the item and
+ press the <emphasis>SPACEBAR</emphasis>. Notice that the
+ instructions below give pressing [ENTER] as a means to
+ exit.</para>
+
+ <figure id="distribution-set1">
+ <title>Choose Distributions</title>
+
+ <mediaobject>
+ <imageobject>
+ <imagedata fileref="install/dist-set" format="PNG">
+ </imageobject>
+ </mediaobject>
+ </figure>
+ </sect2>
+
+ <sect2 id="portscol"
+ <title>Installing The Ports Collection</title>
+
+<screen> User Confirmation Requested
+ Would you like to install the FreeBSD ports collection?
+
+ This will give you ready access to over 5000 ported software packages,
+ at a cost of around 70MB of disk space when "clean" and possibly much
+ more than that if a lot of the distribution tarballs are loaded
+ (unless you have the extra CDs from a FreeBSD CDROM distribution
+ available and can mount it on /cdrom, in which case this is far less
+ of a problem).
+
+ The ports collection is a very valuable resource and well worth having
+ on your /usr partition, so it is advisable to say Yes to this option.
+
+ For more information on the ports collection & the latest ports,
+ visit:
+ http://www.freebsd.org/ports
+
+ [ Yes ] No</screen>
+
+ <para>The installation program does not check to see if you have
+ adequate space. Select this option only if you have
+ adequate hard disk space. The ports can be added as needed
+ later.</para>
+
+ <para>The install program <emphasis>returns</emphasis> to the
+ Choose Distributions screen.</para>
+
+ <para>Select "EXIT" with the arrow keys and press <keycap>ENTER</keycap>
+ to continue with the installation.</para>
+
+ <figure id="distribution-set2">
+ <title>Confirm Distributions</title>
+
+ <mediaobject>
+ <imageobject>
+ <imagedata fileref="install/dist-set2" format="PNG">
+ </imageobject>
+ </mediaobject>
+ </figure>
+ </sect2>
+
+ <sect2 id="install-media">
+ <title>Installation Media</title>
+
+ <para>If Installing from a CDROM, use the arrow keys to highlight
+ the "Install from a FreeBSD CDROM" option. Make sure [OK] is
+ highlighted, then press <keycap>ENTER</keycap> to proceed with
+ installation.
+
+ <figure id="choose-media">
+ <title>Choose Installation Media</title>
+
+ <mediaobject>
+ <imageobject>
+ <imagedata fileref="install/media" format="PNG">
+ </imageobject>
+ </mediaobject>
+ </figure>
+
+ <para>Press <keycap>F1</keycap> to display the Online Help for
+ installation media. Press <keycap>ENTER</keycap> to return
+ to the media selection menu.</para>
+ </sect2>
+
+ <sect2 id="install-final-warning">
+ <title>Final Warning</title>
+
+ <para>The installation can now proceed if desired. This is also
+ the last chance for aborting the installation to prevent changes
+ to the hard drive.</para>
+
+ <warning><para>This is the point of no return.</para></warning>
+
+ <screen> User Confirmation Requested
+ Last Chance! Are you SURE you want to continue the installation?
+
+ If you're running this on a disk with data you wish to save then WE
+ STRONGLY ENCOURAGE YOU TO MAKE PROPER BACKUPS before proceeding!
+
+ We can take no responsibility for lost disk contents!
+
+ [ Yes ] No</screen>
+
+ <sect3 id="continue">
+ <title>Continuing The Installation</title>
+
+ <para>Select "Yes" and Press <keycap>ENTER</keycap> to proceed.</para>
+
+ <para>The installation time will vary according to the distribution
+ chosen and installation media used. There will be a series of
+ messages displayed indicating the status.</para>
+
+ <para>When the installation is complete when the following message
+ is displayed :</para>
+
+ <screen> Message
+
+Congratulations! You now have FreeBSD installed on your system.
+
+We will now move on to the final configuration questions.
+For any option you do not wish to configure, simply select No.
+
+If you wish to re-enter this utility after the system is up, you may
+do so by typing: /stand/sysinstall .
+
+ [ OK ]
+
+ [ Press enter to continue ]</screen>
+
+ <para>Press <keycap>ENTER</keycap> to proceed with post-installation
+ configurations.</para>
+ </sect3>
+
+ <sect3 id="abort">
+ <title>Aborting The Installation</title>
+
+ <para>Selecting [No] and pressing <keycap>ENTER</keycap> will abort
+ the installation so no changes will be made to your system. The
+ following message will appear :</para>
+
+ <screen> Message
+Installation complete with some errors. You may wish to scroll
+through the debugging messages on VTY1 with the scroll-lock feature.
+You can also choose "No" at the next prompt and go back into the
+installation menus to try and retry whichever operations have failed.
+
+ [ OK ]</screen>
+
+ <para>Pressing <keycap>ENTER</keycap> will return to the
+ Main Installation Menu to exit the installation.</para>
+ </sect3>
+ </sect2>
+ </sect1>
+
+ <sect1 id="install-post">
+ <title>Post-installation</title>
+
+ <para>Configuration of various options follows the successful
+ installation. A option can be configured by re-entering the
+ configuration options before booting the new FreeBSD
+ system or after installation using
+ <command>/stand/sysinstall</command>.</para>
+
+ <sect2 id="inst-network-dev">
+ <title>Network Device Configuration</title>
+
+ <para>If you previously configured PPP for an FTP install, this screen
+ will not re-appear.</para>
+
+ <para>For detailed information on Local Area Networks and
+ configuring FreeBSD as a gateway/router refer to the tutorial
+ <ulink url="http://www.freebsd.org/tutorials/ppp/index.html">
+ PPP- Pendantic PPP Primer</ulink>.</para>
+
+ <screen> User Confirmation Requested
+ Would you like to configure Ethernet or SLIP/PPP network devices?
+
+ [ Yes ] No</screen>
+
+ <para>This option allows configuration of network devices by selecting
+ [Yes] and pressing <keycap>ENTER</keycap></para>
+
+ <figure id="ed-config1">
+ <title>Selecting An Ethernet Device</title>
+
+ <mediaobject>
+ <imageobject>
+ <imagedata fileref="install/ed0-conf" format="PNG">
+ </imageobject>
+ </mediaobject>
+ </figure>
+
+ <para>Select the appropriate interface and press
+ <keycap>ENTER</keycap>.</para>
+
+ <screen> User Confirmation Requested
+ Do you want to try IPv6 configuration of the interface?
+
+ Yes [ No ]</screen>
+
+ <para>In this private local area network the current Internet
+ type protocol (IPv4) was sufficient and "No" was selected with
+ the arrow keys and <keycap>ENTER</keycap> pressed.</para>
+
+ <para>If you want to try the new Internet protocol (IPv6), choose
+ [Yes] and press <keycap>ENTER</keycap>. If yes is chosen, it will
+ take several seconds for scanning RA servers.</para>
+
+ <screen> User Confirmation Requested
+ Do you want to try DHCP configuration of the interface?
+
+ Yes [ No ]</screen>
+
+ <para>There is no DHCP (Dynamic Host Configuration Protocol) so
+ "No" was selected with the arrow keys and <keycap>ENTER</keycap>
+ pressed.</para>
+
+ <para>Answering [Yes] will execute dhclient, and if successful,
+ will fill in the network configuration information
+ automatically. Refer to the <ulink
+ url="http://www.freebsd.org/handbook/dhcp.html">FreeBSD
+ Handbook</ulink> for more information.</para>
+
+ <para>The following Network Configuration screen shows the
+ configuration of the ethernet device for a system that will act
+ as the gateway for a Local Area Network.</para>
+
+ <figure id="ed-config2">
+ <title>Set Network Configuration For ed0</title>
+
+ <mediaobject>
+ <imageobject>
+ <imagedata fileref="install/ed0-conf2" format="PNG">
+ </imageobject>
+ </mediaobject>
+ </figure>
+
+ <para>Use <keycap>TAB</keycap> to select the information fields and
+ fill in appropriate information:</para>
+
+ <variablelist>
+ <varlistentry>
+ <term>Host</term>
+
+ <listitem>
+ <para>The fully-qualified hostname, e.g. k6-2.weeble.com in
+ this case.</para>
+ </listitem>
+ </varlistentry>
+
+ <varlistentry>
+ <term>Domain</term>
+
+ <listitem>
+ <para>The name of the domain that your machine is
+ in, e.g. weeble.com for this case.</para>
+ </listitem>
+ </varlistentry>
+
+ <varlistentry>
+ <term>IPv4 Gateway</term>
+
+ <listitem>
+ <para>IP address of host forwarding packets to non-local
+ destinations. Fill this in only if the machine is a node
+ on the network. <emphasis>Leave this field blank</emphasis>
+ if the machine is the gateway to the Internet for the
+ network.</para>
+ </listitem>
+ </varlistentry>
+
+ <varlistentry>
+ <term>Name server</term>
+
+ <listitem>
+ <para>IP address of your local DNS server. There is no local
+ DNS server on this private local area network so the IP
+ address of the provider's DNS server (208.163.10.2) was
+ used.</para>
+ </listitem>
+ </varlistentry>
+
+ <varlistentry>
+ <term>IPv4 address</term>
+
+ <listitem>
+ <para>The IP address to be used for this interface was
+ (192.168.0.1).</para>
+ </listitem>
+ </varlistentry>
+
+ <varlistentry>
+ <term>Netmask</term>
+
+ <listitem>
+ <para>The address block being used for this local area
+ network is a Class C block (192.168.0.0 -
+ 192.168.255.255). The default netmask is for a Class C
+ network (255.255.255.0).</para>
+ </listitem>
+ </varlistentry>
+
+ <varlistentry>
+ <term>Extra options to ifconfig</term>
+
+ <listitem>
+ <para>Any interface-specific options to ifconfig you would
+ like to add. There were none in this case.</para>
+ </listitem>
+ </varlistentry>
+
+ </variablelist>
+
+ <para>Use <keycap>TAB</keycap> to select [OK] when finished and press
+ <keycap>ENTER</keycap>.</para>
+
+
+ <screen> User Confirmation Requested
+ Would you like to Bring Up the ed0 interface right now?
+
+ [ Yes ] No</screen>
+
+ <para>Choosing [Yes] and pressing <keycap>ENTER</keycap> will bring
+ the machine up on the network and be ready for use after leaving
+ leaving the installation.</para>
+ </sect2>
+
+ <sect2 id="gateway">
+ <title>Configure Gateway</title>
+
+ <screen> User Confirmation Requested
+ Do you want this machine to function as a network gateway?
+
+ [ Yes ] No</screen>
+
+ <para>[Yes] was selected and <keycap>ENTER</keycap> pressed since this
+ machine will be acting as the gateway for a local area network and
+ forwarding packets between other machines.</para>
+ </sect2>
+
+ <sect2 id="ftpanon">
+ <title>Anonymous FTP</title>
+
+ <sect3 id="deny-anon">
+ <title>Deny Anonymous FTP</title>
+
+ <para>Selecting [No] and pressing <keycap>ENTER</keycap> will still
+ allow users who have accounts with passwords to use ftp.</para>
+
+ <screen> User Confirmation Requested
+ Do you want to have anonymous FTP access to this machine?
+
+ Yes [ No ]</screen>
+
+ <para>With [No] highlighted, press <keycap>ENTER</keycap> to
+ continue with post-installation configuration.</para>
+ </sect3>
+
+ <sect3 id="ftpallow">
+ <title>Allow Anonymous FTP</title>
+
+ <screen> User Confirmation Requested
+ Do you want to have anonymous FTP access to this machine?
+
+ [ Yes ] No </screen>
+
+ <para>If you select [Yes] and press <keycap>ENTER</keycap> you would
+ be allowing anonymous ftp connections. Be aware of the security
+ considerations if you elect to allow this.</para>
+
+ <para>To allow anonymous FTP, use the arrow keys to select [Yes] and
+ press <keycap>ENTER</keycap>. The following screens (or similar)
+ will appear :</para>
+
+ <figure id="anon-ftp2">
+ <title>Default Anonymous FTP Configuration</title>
+
+ <mediaobject>
+ <imageobject>
+ <imagedata fileref="install/ftp-anon1" format="PNG">
+ </imageobject>
+ </mediaobject>
+ </figure>
+
+ <para>Pressing <keycap>F1</keycap> will display the help :</para>
+
+ <screen>This screen allows you to configure the anonymous FTP user.
+
+The following configuration values are editable:
+
+UID: The user ID you wish to assign to the anonymous FTP user.
+ All files uploaded will be owned by this ID.
+
+Group: Which group you wish the anonymous FTP user to be in.
+
+Comment: String describing this user in /etc/passwd
+
+
+FTP Root Directory:
+
+ Where files available for anonymous FTP will be kept.
+
+Upload subdirectory:
+
+ Where files uploaded by anonymous FTP users will go.</screen>
+
+ <para>The ftp root directory will be put in <filename>/var</filename>
+ by default. If you do not have enough room there for the
+ anticipated FTP needs, the <filename>/usr</filename> directory
+ could be used by setting the FTP Root Directory to
+ <filename>/usr/ftp</filename>.</para>
+
+ <para>When you are satisfied with the values, press
+ <keycap>ENTER</keycap> to continue.</para>
+
+ <screen> User Confirmation Requested
+ Create a welcome message file for anonymous FTP users?
+
+ [ Yes ] No</screen>
+
+ <para>If you select [Yes] and press <keycap>ENTER</keycap>, an editor
+ will automatically start allowing you to edit the message.</para>
+
+ <figure id="anon-ftp4">
+ <title>Edit The FTP Welcome Message</title>
+
+ <mediaobject>
+ <imageobject>
+ <imagedata fileref="install/ftp-anon2" format="PNG">
+ </imageobject>
+ </mediaobject>
+ </figure>
+
+ <para>This is a text editor called <command>ee</command>. Use the
+ instructions to change the message or change the message later
+ using a text editor of your choice. Note the file name/location
+ at the bottom.</para>
+
+ <para>Press <keycap>ESC</keycap> and a pop-up menu will default
+ to "a) leave editor". Press <keycap>ENTER</keycap> to exit and
+ continue.</para>
+ </sect3>
+ </sect2>
+
+ <sect2 id="nfsconf">
+ <title>Configure Network File Services</title>
+
+ <sect3 id="nsf-server-options">
+ <title>NFS Server</title>
+
+ <screen> User Confirmation Requested
+ Do you want to configure this machine as an NFS server?
+
+ Yes [ No ]</screen>
+
+ <para>If there is no need for a Network File System server or
+ client, select [No] and press <keycap>ENTER</keycap>.</para>
+
+ <para>If [Yes] is chosen, a message will pop-up indicating that the
+ the exports file must be created. Press <keycap>Enter</keycap> to
+ continue.</para>
+
+ <screen> Message
+Operating as an NFS server means that you must first configure an
+/etc/exports file to indicate which hosts are allowed certain kinds of
+access to your local file systems.
+Press [ENTER] now to invoke an editor on /etc/exports
+ [ OK ]</screen>
+
+ <para>A text editor will start allowing the exports file to be created
+ and edited.</para>
+
+ <figure id="nfs-server-edit">
+ <title>Editing the Exports File</title>
+
+ <mediaobject>
+ <imageobject>
+ <imagedata fileref="install/nfs-server-edit" format="PNG">
+ </imageobject>
+ </mediaobject>
+ </figure>
+
+ <para>Use the instructions to add the actual exported filesystems
+ now or later using a text editor of your choice. Note the
+ filename/location at the bottom.</para>
+
+ <para>Press <keycap>ESC</keycap> and a pop-up menu will default to
+ "a) leave editor". Press <keycap>ENTER</keycap> to exit and
+ continue.</para>
+ </sect3>
+
+ <sect3 id="nfs-client-options">
+ <title>NFS Client</title>
+
+ <para>With the arrow keys, select [Yes] or [No] as appropriate and
+ press <keycap>ENTER</keycap>. This example shows the NFS client
+ option as [No].</para>
+
+ <screen> User Confirmation Requested
+ Do you want to configure this machine as an NFS client?
+
+ Yes [ No ]</screen>
+ </sect3>
+ </sect2>
+
+ <sect2 id="securityprofile">
+ <title>Security Profile</title>
+
+ <para>A "security profile" is a set of configuration options that
+ attempts to achieve the desired ratio of security to convenience by
+ enabling and disabling certain programs and other settings. Refer
+ to the <ulink url="http://www.freebsd.org/doc/en_US.ISO_8859-1/books/faq/install.html#SECURITY-PROFILES">FAQ</ulink> for more information.</para>
+
+ <para>Selecting [No] and pressing <keycap>ENTER</keycap> will set the
+ security profile to "medium" (recommended for new users) and continue
+ the installation.</para>
+
+ <screen> User Confirmation Requested
+ Do you want to select a default security profile for this host (select
+ No for "medium" security)?
+
+ [ Yes ] No</screen>
+
+ <para>Selecting [Yes] and pressing <keycap>ENTER</keycap> will allow
+ selecting a different security profile.</para>
+
+ <figure id="security-profile">
+ <title>Security Profile Options</title>
+
+ <mediaobject>
+ <imageobject>
+ <imagedata fileref="install/security" format="PNG">
+ </imageobject>
+ </mediaobject>
+ </figure>
+
+ <para>Press <keycap>F1</keycap> to display the help. Press
+ <keycap>ENTER</keycap> to return to selection menu.</para>
+
+ <para>Use the arrow keys to choose the medium level [DEFAULT] unless
+ your are sure that another level is required for your needs. With
+ [OK] highlighted, press <keycap>ENTER</keycap>.</para>
+
+ <screen> Message
+ Moderate security settings have been selected.
+
+ This means that most "popular" network services and mechanisms like
+ inetd(8) have been enabled by default for a comfortable user
+ experience but with possible trade-offs in system security. If this
+ bothers you and you know exactly what your are doing, select the high
+ high security profile instead.
+
+ To change any of these settings later, edit /etc/rc.conf.
+
+ [ OK ]
+
+ [ Press enter to continue ]</screen>
+
+ <para>Press <keycap>ENTER</keycap> to continue with the
+ post-installation configuration.</para>
+ </sect2>
+
+ <sect2 id="console">
+ <title>System Console Settings</title>
+
+ <para>There are several options available to customize the system
+ console. To view and configure the options, select [Yes] and press
+ <keycap>ENTER</keycap>.</para>
+
+ <screen> User Confirmation Requested
+ Would you like to customize your system console settings?
+
+ [ Yes ] No</screen>
+
+ <para>A commonly used option is the screensaver. Use the arrow keys
+ to select "Saver" and then press <keycap>ENTER</keycap>.</para>
+
+ <figure id="saver-options">
+ <title>Screensaver Options</title>
+
+ <mediaobject>
+ <imageobject>
+ <imagedata fileref="install/console-saver1" format="PNG">
+ </imageobject>
+ </mediaobject>
+ </figure>
+
+ <para>First, select the desired screen saver using the arrow keys
+ and then press <keycap>SPACE</keycap>. The "X" will indicate the
+ selected screensaver.</para>
+
+ <figure id="saver-select">
+ <title>Screensaver Options</title>
+
+ <mediaobject>
+ <imageobject>
+ <imagedata fileref="install/console-saver2" format="PNG">
+ </imageobject>
+ </mediaobject>
+ </figure>
+
+ <para>The default time interval is 300 seconds. To change the time
+ interval, select "Timeout" using the arrow keys and press
+ <keycap>SPACE</keycap>. A pop-up menu will appear :</para>
+
+ <figure id="saver-timeout">
+ <title>Screensaver Timeout</title>
+
+ <mediaobject>
+ <imageobject>
+ <imagedata fileref="install/console-saver3" format="PNG">
+ </imageobject>
+ </mediaobject>
+ </figure>
+
+ <para>The value can be changed, then select [OK] and press
+ <keycap>ENTER</keycap> to return to the System Screensaver
+ options menu.</para>
+
+ <para>At the Screensaver Menu, select [OK] and press
+ <keycap>ENTER</keycap> again to return to the System Console
+ options menu.</para>
+
+ <figure id="saver-exit">
+ <title>System Console Configuration Exit</title>
+
+ <mediaobject>
+ <imageobject>
+ <imagedata fileref="install/console-saver4" format="PNG">
+ </imageobject>
+ </mediaobject>
+ </figure>
+
+ <para>Selecting [EXIT] and pressing <keycap>ENTER</keycap> will
+ continue with the post-installation configurations.</para>
+ </sect2>
+
+ <sect2 id="timezone">
+ <title>Setting The Time Zone</title>
+
+ <para>Setting the timezone for your machine will allow it to
+ automatically correct for any regional time changes and perform
+ other timezone related functions properly.</para>
+
+ <para>The selection menus will vary according to your geographical
+ selections.</para>
+
+ <screen> User Confirmation Requested
+ Would you like to set this machine's time zone now?
+
+ [ Yes ] No</screen>
+
+ <para>Select [Yes] and press <keycap>ENTER</keycap> to set the
+ time zone.</para>
+
+ <screen> User Confirmation Requested
+ Is this machine's CMOS clock set to UTC? If it is set to local time
+ please choose NO here!
+
+ Yes [ No ]</screen>
+
+ <para>If the machine's CMOS clock is set to local time select [No]
+ with the arrow keys and then press <keycap>ENTER</keycap>.</para>
+
+ <para>If the CMOS clock is set to GMT or UTC, select [Yes] and
+ press <keycap>ENTER</keycap>.</para>
+
+ <figure id="set-timezone-region">
+ <title>Select Your Region</title>
+
+ <mediaobject>
+ <imageobject>
+ <imagedata fileref="install/timezone1" format="PNG">
+ </imageobject>
+ </mediaobject>
+ </figure>
+
+ <para>The appropriate region is selected using the arrow keys
+ and then press <keycap>ENTER</keycap>.</para>
+
+ <figure id="set-timezone-country">
+ <title>Select Your Country</title>
+
+ <mediaobject>
+ <imageobject>
+ <imagedata fileref="install/timezone2" format="PNG">
+ </imageobject>
+ </mediaobject>
+ </figure>
+
+ <para>Select the appropriate country using the arrow keys
+ and press <keycap>ENTER</keycap>. This is a partial
+ chart of the country selection menu.</para>
+
+ <figure id="set-timezone-locality">
+ <title>Select Your Timezone</title>
+
+ <mediaobject>
+ <imageobject>
+ <imagedata fileref="install/timezone3" format="PNG">
+ </imageobject>
+ </mediaobject>
+ </figure>
+
+ <para>The appropriate time zone is selected using the arrow
+ keys and pressing <keycap>ENTER</keycap>. Again, this is a partial
+ chart.</para>
+
+ <screen> Confirmation
+ Does the abbreviation 'EDT' look reasonable?
+
+ [ Yes ] No</screen>
+
+ <para>Confirm the abbreviation for the time zone is correct.
+ If it looks okay, press <keycap>ENTER</keycap> to continue with
+ the post-installation configuration.</para>
+ </sect2>
+
+ <sect2 id="linuxcomp">
+ <title>Linux Compatibility</title>
+
+ <screen> User Confirmation Requested
+ Would you like to enable Linux binary compatibility?
+
+ [ Yes ] No</screen>
+
+ <para>Selecting [Yes] and pressing <keycap>ENTER</keycap> will allow
+ running Linux software on FreeBSD. The install will proceed to add
+ the appropriate packages for Linux compatibility.</para>
+
+ <para>If installing by FTP, the machine will need to be connected to
+ the internet. Sometimes a remote ftp site will not have all the
+ distributions like the Linux binary compatibility. This can
+ be installed later if necessary.</para>
+ </sect2>
+
+ <sect2 id="mouse">
+ <title>Mouse Settings</title>
+
+ <para>This option will allow you to cut and past text in the
+ console and user programs with a 3-button mouse. If using a 2-button
+ mouse, refer to manual page, &man.moused.8;, after installation for
+ details on emulating the 3-button style. This example depicts a
+ non-USB mouse.</para>
+
+ <screen> User Confirmation Requested
+ Does this system have a non-USB mouse attached to it?
+
+ [ Yes ] No</screen>
+
+ <para>Select [Yes] for a non-USB mouse or [No] for a USB mouse and press
+ <keycap>ENTER</keycap>.</para>
+
+ <figure id="mouse-protocol">
+ <title>Select Mouse Protocol Type</title>
+
+ <mediaobject>
+ <imageobject>
+ <imagedata fileref="install/mouse1" format="PNG">
+ </imageobject>
+ </mediaobject>
+ </figure>
+
+ <para>Use the arrow keys to select "Type" and press
+ <keycap>ENTER</keycap></para>
+
+ <figure id="set-mouse-protocol">
+ <title>Set Mouse Protocol</title>
+
+ <mediaobject>
+ <imageobject>
+ <imagedata fileref="install/mouse2" format="PNG">
+ </imageobject>
+ </mediaobject>
+ </figure>
+
+ <para>The mouse in this example is a PS/2 type, so the default "Auto" was
+ appropriate. To change protocol, use the arrow keys and then
+ press <keycap>SPACE</keycap>. Select [OK] and press
+ <keycap>ENTER</keycap> to exit this menu.</para>
+
+ <figure id="config-mouse-port">
+ <title>Configure Mouse Port</title>
+
+ <mediaobject>
+ <imageobject>
+ <imagedata fileref="install/mouse3" format="PNG">
+ </imageobject>
+ </mediaobject>
+ </figure>
+
+ <para>Use the arrow keys to select "Port" and press
+ <keycap>ENTER</keycap>.</para>
+
+ <figure id="set-mouse-port">
+ <title>Setting The Mouse Port</title>
+
+ <mediaobject>
+ <imageobject>
+ <imagedata fileref="install/mouse4" format="PNG">
+ </imageobject>
+ </mediaobject>
+ </figure>
+
+ <para>This system had a PS/2 mouse, so the default "PS/2" was
+ appropriate. To change the port, use the arrow keys and then
+ press the space bar. Select [OK] and press <keycap>ENTER</keycap>
+ to exit this menu.</para>
+
+ <figure id="test-daemon">
+ <title>Enable The Mouse Daemon</title>
+
+ <mediaobject>
+ <imageobject>
+ <imagedata fileref="install/mouse5" format="PNG">
+ </imageobject>
+ </mediaobject>
+ </figure>
+
+ <para>Last, the mouse daemon is enabled and tested.</para>
+
+ <figure id="test-mouse-daemon">
+ <title>Test The Mouse Daemon</title>
+
+ <mediaobject>
+ <imageobject>
+ <imagedata fileref="install/mouse6" format="PNG">
+ </imageobject>
+ </mediaobject>
+ </figure>
+
+ <para>The cursor moved around the screen so the mouse daemon is
+ running:</para>
+
+ <para>Select [YES] to return to the previous menu then select "Exit"
+ with the arrow keys and press <keycap>ENTER</keycap> to return to
+ continue with the post-installation configuration.</para>
+ </sect2>
+
+ <sect2 id="x-server">
+ <title>Configure X-Server</title>
+
+ <screen> User Confirmation Requested
+ Would you like to configure your X server at this time?
+
+ [ Yes ] No</screen>
+
+ <para>This can be done later using /stand/sysinstall if you don't
+ have graphics card and monitor information handy. Equipment
+ damage can occur if settings are incorrect. Select [Yes] and
+ press <keycap>ENTER</keycap> to proceed with configuring the
+ X server.</para>
+
+ <sect3 id="x-server-config-method">
+ <title>Select Configuration Method</title>
+ <figure id="xserver2">
+ <title>Select Configuration Method Menu</title>
+
+ <mediaobject>
+ <imageobject>
+ <imagedata fileref="install/xf86setup" format="PNG">
+ </imageobject>
+ </mediaobject>
+ </figure>
+
+ <para>There are several ways to configure the X
+ server. <command>XF86Setup</command> is fully graphical and
+ probably the easiest. Use the arrow keys to select the
+ "XF86Setup" option and press <keycap>ENTER</keycap>.</para>
+
+ <screen> Message
+ You have configured and been running the mouse daemon.
+ Choose "/dev/sysmouse" as the mouse port and "SysMouse" or
+ "MouseSystems" as the mouse protocol in the X configuration utility.
+
+ [ OK ]
+
+ [ Press enter to continue ]</screen>
+
+ <para>The mouse daemon previously configured has been
+ detected. Press <keycap>ENTER</keycap> to continue.</para>
+
+ <screen> Press [Enter] to switch to graphics mode.
+
+ This may take a while...
+
+ [ OK ]</screen>
+
+ <para>Press <keycap>ENTER</keycap> to switch to the graphics mode and
+ continue. It will <emphasis>not</emphasis> try to switch to the
+ graphics mode until <keycap>ENTER</keycap> is pressed. The screen
+ will go black and then shortly a screen with a large "X" in the
+ center will appear. Be patient and wait.</para>
+
+ <para>After a few more moments, the XF86 Setup Introduction will
+ appear. Read all instructions <emphasis>carefully</emphasis>.
+ Press <keycap>ENTER</keycap> to continue.</para>
+ </sect3>
+
+ <sect3 id="x-mouse">
+ <title>X-Mouse</title>
+
+ <para>The mouse is the first item to be configured. The mouse daemon
+ was already running and "Emulate3Buttons" was added for my mouse
+ type. Click on "Apply" and check the mouse actions are working
+ properly.</para>
+ </sect3>
+
+ <sect3 id="x-keyboard">
+ <title>X-Keyboard</title>
+
+ <para>Click on the "Keyboard" menu item.</para>
+
+ <para>The default settings were fine for my keyboard. Select the
+ options appropriate for your situation then click on "Apply".</para>
+ </sect3>
+
+ <sect3 id="x-card">
+ <title>Video Card</title>
+
+ <para>Click on the "Card" menu item.</para>
+
+ <para>Select the appropriate video card from the list using the
+ scrollbar. Clicking on your card will show as "Card selected:"
+ above the list box.</para>
+
+ <para>Next, the "Detailed Setup" was selected just to check any
+ details.</para>
+ </sect3>
+
+ <sect3 id="x-monitor">
+ <title>Monitor</title>
+
+ <para>Click on the "Monitor" menu item.</para>
+
+ <para>There are two ways to proceed. One method requires that you
+ enter the horizontal and vertical sweep capabilities of your
+ monitor. Choosing one of the options listed that the monitor is
+ the method used in the illustration.</para>
+
+ <para>Do not exceed the ratings of your monitor. Damage could
+ occur. If you have doubts select "ABORT" and get the
+ information. The remainder of the installation process will be
+ unaffected and configuring the X-Server can be done later using
+ <filename>/stand/sysinstall</filename>.</para>
+
+ <para>After selecting a listed option, the screen will display the
+ horizontal and vertical sweep rates that will be used. Compare
+ those to the monitor specifications. The monitor must be capable
+ of using those ranges.</para>
+ </sect3>
+
+ <sect3 id="x-modes">
+ <title>Video Mode Selection</title>
+
+ <para>Click on the "Modeselection" menu item.</para>
+
+ <para>Selected the modes and color depth appropriate for the
+ system.</para>
+ </sect3>
+
+ <sect3 id="x-other">
+ <title>Other</title>
+
+ <para>These are generally reasonable values.</para>
+
+ <para>Verify all the settings once again and select "Done".</para>
+
+ <para>It will then attempt to switch to x-mode to verify the
+ settings. If nothing appears or appears wrong, kill the x-server
+ using
+ <keycombo action='simul'>
+ <keycap>CTRL</keycap><keycap>ALT</keycap><keycap>BACKSPACE</keycap>
+ </keycombo>
+ and adjust the settings or revisit them after installation.</para>
+ </sect3>
+
+ <sect3 id="x-save">
+ <title>Saving Configuration</title>
+
+ <para>After selecting [DONE] the following message will display:</para>
+
+ <screen>If you've finished configuring everything press the
+Okay button to start the X server using the configuration
+you've selected. If you still wish to configure some things,
+press one of the buttons at the top and then press "Done" again,
+when you've finished.</screen>
+
+ <para>After selecting [OKAY], some messages will briefly appear
+ advising to wait and attempting to start the x-server. This
+ process takes a few moments, so be patient. The screen will go
+ blank for a short period of time and then the following should
+ appear: "Congratulations, you've got a running server!</para>
+
+ <para>The configuration can now be saved in the location indicated
+ and continue with the installation.</para>
+
+ <para>If the monitor display needs adjusted, xvidtune can be ran
+ to adjust them. There are warnings that improper settings can
+ damage your equipment. Heed them. If in doubt, don't do
+ it. Instead, use the monitor controls to adjust the display for
+ x-windows. There may be some display differences when switching
+ back to text mode, but it's better than damaging equipment. The
+ xvidtune can be ran later using /stand/sysinstall.</para>
+
+ <para>If it doesn't appear or is distorted, kill the server with
+ <keycombo action='simul'>
+ <keycap>CTRL</keycap><keycap>ALT</keycap><keycap>BACKSPACE</keycap>
+ </keycombo>
+ to continue and configure the x-server after installation using
+ <command>/stand/sysinstall</command>.</para>
+
+ <para>The installation program will create the 'X' link to the
+ server by selecting [Yes]:</para>
+
+ <screen> Do you want to create an 'X' link to the SVGA server?
+
+ (the link will be created in the directory:
+ /usr/X11R6/bin) Okay?
+
+ [ Yes ] No</screen>
+
+ <screen> Link created successfully.
+
+ [ OK ]</screen>
+
+ <para>Press [ENTER] to continue configuration.</para>
+ </sect3>
+ </sect2>
+
+ <sect2 id="default-desktop">
+ <title>Select Default X Desktop</title>
+
+ <para>I selected the K Desktop Environment with the arrow keys and
+ then pressed <keycap>ENTER</keycap> to set it as my default window
+ manager.</para>
+
+ <figure id="x-desktop">
+ <title>Select Default Desktop</title>
+
+ <mediaobject>
+ <imageobject>
+ <imagedata fileref="install/desktop" format="PNG">
+ </imageobject>
+ </mediaobject>
+ </figure>
+
+ <para>The selected desktop package will then be loaded on they
+ system.</para>
+ </sect2>
+
+ <sect2 id="packages">
+ <title>Install Packages</title>
+
+ <para>Only one package is shown being added for purposes of
+ illustration. Additional packages can also be added at this
+ time if desired. After installation
+ <command>/stand/sysinstall</command> can be used to add additional
+ packages.</para>
+
+ <screen> User Confirmation Requested
+ The FreeBSD package collection is a collection of hundreds of
+ ready-to-run applications, from text editors to games to WEB servers
+ and more. Would you like to browse the collection now?
+
+ [ Yes ] No</screen>
+
+ <para>Selecting [Yes] and pressing <keycap>ENTER</keycap> will be
+ followed by the Package Selection screens:</para>
+
+ <figure id="package-category">
+ <title>Select Package Category</title>
+
+ <mediaobject>
+ <imageobject>
+ <imagedata fileref="install/pkg-cat" format="PNG">
+ </imageobject>
+ </mediaobject>
+ </figure>
+
+ <para>All packages available will be displayed if "All" is
+ chosen. Additional packages may be on other CDs. These can also
+ be added later using
+ <filename>/stand/sysinstall</filename>.</para>
+
+ <para>The bash shell is shown selected. Select as many as desired
+ by highlighting the item and pressing the <keycap>SPACE</keycap>.
+ A short description of each package will appear in the lower left
+ corner of the screen.</para>
+
+ <figure id="package-select">
+ <title>Select Packages</title>
+
+ <mediaobject>
+ <imageobject>
+ <imagedata fileref="install/pkg-sel" format="PNG">
+ </imageobject>
+ </mediaobject>
+ </figure>
+
+ <para>When the package(s) are selected, select [OK] and then press
+ <keycap>ENTER</keycap> to return to the Package Selection menu.</para>
+
+ <figure id="package-install">
+ <title>Install Packages</title>
+
+ <mediaobject>
+ <imageobject>
+ <imagedata fileref="install/pkg-install" format="PNG">
+ </imageobject>
+ </mediaobject>
+ </figure>
+
+ <para>Use the arrow keys to select [INSTALL] and pressing
+ <keycap>ENTER</keycap> will ask for confirmation.</para>
+
+ <figure id="package-install-confirm">
+ <title>Confirm Package Installation</title>
+
+ <mediaobject>
+ <imageobject>
+ <imagedata fileref="install/pkg-confirm" format="PNG">
+ </imageobject>
+ </mediaobject>
+ </figure>
+
+ <para>Selecting [OK] and pressing <keycap>ENTER</keycap> will start
+ the package installation. Installing messages will appear until
+ completed. Make note if there are any error messages.</para>
+
+ <para>The final configuration continues after packages are
+ installed.</para>
+ </sect2>
+
+ <sect2 id="addusers">
+ <title>Add User/Groups</title>
+
+ <screen> User Confirmation Requested
+ Would you like to add any initial user accounts to the system? Adding
+ at least one account for yourself at this stage is suggested since
+ working as the "root" user is dangerous (it is easy to do things which
+ adversely affect the entire system).
+
+ [ Yes ] No</screen>
+
+ <para>Select "Add User" with the arrow keys then and press
+ <keycap>ENTER</keycap>.</para>
+
+ <figure id="add-user2">
+ <title>Select Add User</title>
+
+ <mediaobject>
+ <imageobject>
+ <imagedata fileref="install/adduser1" format="PNG">
+ </imageobject>
+ </mediaobject>
+ </figure>
+
+ <figure id="add-user3">
+ <title>Add User Information</title>
+
+ <mediaobject>
+ <imageobject>
+ <imagedata fileref="install/adduser2" format="PNG">
+ </imageobject>
+ </mediaobject>
+ </figure>
+
+ <para>The following descriptions will appear in the lower part of
+ the screen as the items are selected with <keycap>TAB</keycap></para>
+
+ <variablelist>
+ <varlistentry>
+ <term>Login ID</term>
+
+ <listitem>
+ <para>The login name of the new user (mandatory)</para>
+ </listitem>
+ </varlistentry>
+
+ <varlistentry>
+ <term>UID</term>
+
+ <listitem>
+ <para>The numerical ID for this user (leave blank for
+ automatic choice)</para>
+ </listitem>
+ </varlistentry>
+
+ <varlistentry>
+ <term>Group</term>
+
+ <listitem>
+ <para>The login group name for this user (leave blank for
+ automatic choice)</para>
+ </listitem>
+ </varlistentry>
+
+ <varlistentry>
+ <term>Password</term>
+
+ <listitem>
+ <para>The password for this user (enter this field with
+ care!)</para>
+ </listitem>
+ </varlistentry>
+
+ <varlistentry>
+ <term>Full name</term>
+
+ <listitem>
+ <para>The user's full name (comment)</para>
+ </listitem>
+ </varlistentry>
+
+ <varlistentry>
+ <term>Member groups</term>
+
+ <listitem>
+ <para>The groups this user belongs to (i.e. gets access
+ rights for)</para>
+ </listitem>
+ </varlistentry>
+
+ <varlistentry>
+ <term>Home directory</term>
+
+ <listitem>
+ <para>The user's home directory (leave blank for
+ default)</para>
+ </listitem>
+ </varlistentry>
+
+ <varlistentry>
+ <term>Login shell</term>
+ <listitem>
+ <para>The user's login shell (leave blank for
+ default). (<filename>/bin/sh</filename>)</para>
+ </listitem>
+ </varlistentry>
+ </variablelist>
+
+ <para>The login shell was changed from
+ <filename>/bin/sh</filename> to
+ <filename>/usr/local/bin/bash</filename> to use the bash shell
+ that was previously installed as a package.</para>
+
+ <para>The user was also added to the group "wheel" to be able to
+ become a superuser with root privileges.</para>
+
+ <para>Groups could also be added at this time if specific needs
+ are known. Otherwise, this may be accessed through using
+ <filename>/stand/sysinstall</filename> after installation is
+ completed.</para>
+
+ <figure id="add-user4">
+ <title>Exit User and Group Management</title>
+
+ <mediaobject>
+ <imageobject>
+ <imagedata fileref="install/adduser3" format="PNG">
+ </imageobject>
+ </mediaobject>
+ </figure>
+
+ <para>I selected [Exit] with the arrow keys then [OK] and pressed
+ <keycap>ENTER</keycap> to continue the installation.</para>
+ </sect2>
+
+ <sect2 id="rootpass">
+ <title>Set Root Password</title>
+
+ <screen> Message
+ Now you must set the system manager's password.
+ This is the password you'll use to log in as "root".
+
+ [ OK ]
+
+ [ Press enter to continue ]</screen>
+
+ <para>The password will need to be typed in twice
+ correctly. Needless to say, make sure you have a way of finding
+ the password if you forget.</para>
+
+ <screen>Changing local password for root.
+ New password :
+ Retype new password :</screen>
+
+ <para>The installation will continue after the password is
+ successfully entered.</para>
+ </sect2>
+
+ <sect2 id="exit-inst">
+ <title>Exiting Install</title>
+
+ <screen> User Confirmation Requested
+ Visit the general configuration menu for a chance to set any last
+ options?
+
+ Yes [ No ]</screen>
+
+ <para>Selecting [No] with the arrow keys and pressing
+ <keycap>ENTER</keycap> returns to the Main Installallation Menu</para>
+
+ <figure id="final-main">
+ <title>Exit Install</title>
+
+ <mediaobject>
+ <imageobject>
+ <imagedata fileref="install/mainexit" format="PNG">
+ </imageobject>
+ </mediaobject>
+ </figure>
+
+ <para>Select [EXIT INSTALL] with the arrow keys and press
+ <keycap>ENTER</keycap>.</para>
+
+ <screen> User Confirmation Requested
+ Are you sure you wish to exit? The system will reboot (be sure to
+ remove any floppies from the drives).
+
+ [ Yes ] No</screen>
+
+ <para>Select [Yes] and remove floppy if booting from floppy. The
+ CDROM drive is locked until you select yes to exit and press
+ <keycap>ENTER</keycap>. The CDROM drive is then unlocked and can
+ be removed from drive (quickly).</para>
+
+ <para>The system will reboot so watch for any error messages that
+ may appear.</para>
+ </sect2>
+
+ <sect2 id="freebsdboot">
+ <title>FreeBSD Bootup</title>
+
+ <para>If everything goes well, you will see similar messages scroll
+ off the screen and you'll arrive at a login prompt. You can view
+ the content of the messages by pressing <keycap>SCROLL-LOCK</keycap>
+ and using <keycap>PgUp</keycap> and <keycap>PgDn</keycap>.
+ Pressing <keycap>SCROLL-LOCK</keycap> again will return
+ to the prompt.</para>
+
+ <para>The entire message may not display (buffer limitation) but
+ can be viewed from the command line after logging in by typing
+ <command>dmesg</command> at the prompt will get similar
+ information.</para>
+
+ <para>Login using the user/password you set during installation
+ (rpratt, in this example). Avoid logging in as root except when
+ necessary.</para>
+
+ <para>Typical boot messages :</para>
+
+<screen>Copyright (c) 1992-2001 The FreeBSD Project.
+Copyright (c) 1982, 1986, 1989, 1991, 1993, 1994
+ The Regents of the University of California. All rights reserved.
+FreeBSD 4.3-RELEASE #0: Sat Apr 21 10:54:49 GMT 2001
+ jkh@narf.osd.bsdi.com:/usr/src/sys/compile/GENERIC
+Timecounter "i8254" frequency 1193182 Hz
+CPU: AMD-K6(tm) 3D processor (300.68-MHz 586-class CPU)
+ Origin = "AuthenticAMD" Id = 0x580 Stepping = 0
+ Features=0x8001bf&lt;FPU,VME,DE,PSE,TSC,MSR,MCE,CX8,MMX&gt;
+ AMD Features=0x80000800&lt;SYSCALL,3DNow!&gt;
+real memory = 268435456 (262144K bytes)
+config&gt; di sn0
+config&gt; di lnc0
+config&gt; di le0
+config&gt; di ie0
+config&gt; di fe0
+config&gt; di cs0
+config&gt; di bt0
+config&gt; di ata1
+config&gt; di aic0
+config&gt; di aha0
+config&gt; di adv0
+config&gt; q
+avail memory = 256983040 (250960K bytes)
+Preloaded elf kernel "kernel" at 0xc044d000.
+Preloaded userconfig_script "/boot/kernel.conf" at 0xc044d09c.
+md0: Malloc disk
+npx0: &lt;math processor&gt; on motherboard
+npx0: INT 16 interface
+pcib0: &lt;Host to PCI bridge&gt; on motherboard
+pci0: &lt;PCI bus&gt; on pcib0
+pcib1: &lt;VIA 82C598MVP (Apollo MVP3) PCI-PCI (AGP) bridge&gt; at device 1.0 on pci0
+pci1: &lt;PCI bus&gt; on pcib1
+pci1: &lt;Matrox MGA G200 AGP graphics accelerator&gt; at 0.0 irq 11
+isab0: &lt;VIA 82C586 PCI-ISA bridge&gt; at device 7.0 on pci0
+isa0: &lt;ISA bus&gt; on isab0
+atapci0: &lt;VIA 82C586 ATA33 controller&gt; port 0xe000-0xe00f at device 7.1 on pci0
+ata0: at 0x1f0 irq 14 on atapci0
+ata1: at 0x170 irq 15 on atapci0
+uhci0: &lt;VIA 83C572 USB controller&gt; port 0xe400-0xe41f irq 10 at device 7.2 on pci0
+usb0: &lt;VIA 83C572 USB controller&gt; on uhci0
+usb0: USB revision 1.0
+uhub0: VIA UHCI root hub, class 9/0, rev 1.00/1.00, addr 1
+uhub0: 2 ports with 2 removable, self powered
+chip1: &lt;VIA 82C586B ACPI interface&gt; at device 7.3 on pci0
+ed0: &lt;NE2000 PCI Ethernet (RealTek 8029)&gt; port 0xe800-0xe81f irq 9 at
+device 10.0 on pci0
+ed0: address 52:54:05:de:73:1b, type NE2000 (16 bit)
+isa0: too many dependant configs (8)
+isa0: unexpected small tag 14
+fdc0: &lt;NEC 72065B or clone&gt; at port 0x3f0-0x3f5,0x3f7 irq 6 drq 2 on isa0
+fdc0: FIFO enabled, 8 bytes threshold
+fd0: &lt;1440-KB 3.5" drive&gt; on fdc0 drive 0
+atkbdc0: &lt;keyboard controller (i8042)&gt; at port 0x60-0x6f on isa0
+atkbd0: &lt;AT Keyboard&gt; flags 0x1 irq 1 on atkbdc0
+kbd0 at atkbd0
+psm0: &lt;PS/2 Mouse&gt; irq 12 on atkbdc0
+psm0: model Generic PS/2 mouse, device ID 0
+vga0: &lt;Generic ISA VGA&gt; at port 0x3c0-0x3df iomem 0xa0000-0xbffff on isa0
+sc0: &lt;System console&gt; at flags 0x1 on isa0
+sc0: VGA &lt;16 virtual consoles, flags=0x300&gt;
+sio0 at port 0x3f8-0x3ff irq 4 flags 0x10 on isa0
+sio0: type 16550A
+sio1 at port 0x2f8-0x2ff irq 3 on isa0
+sio1: type 16550A
+ppc0: &lt;Parallel port&gt; at port 0x378-0x37f irq 7 on isa0
+ppc0: SMC-like chipset (ECP/EPP/PS2/NIBBLE) in COMPATIBLE mode
+ppc0: FIFO with 16/16/15 bytes threshold
+ppi0: &lt;Parallel I/O&gt; on ppbus0
+lpt0: &lt;Printer&gt; on ppbus0
+lpt0: Interrupt-driven port
+plip0: &lt;PLIP network interface&gt; on ppbus0
+ad0: 8063MB &lt;IBM-DHEA-38451&gt; [16383/16/63] at ata0-master using UDMA33
+ad2: 8063MB &lt;IBM-DHEA-38451&gt; [16383/16/63] at ata1-master using UDMA33
+acd0: CDROM &lt;DELTA OTC-H101/ST3 F/W by OIPD&gt; at ata0-slave using PIO4
+Mounting root from ufs:/dev/ad0s1a
+swapon: adding /dev/ad0s1b as swap device
+Automatic boot in progress...
+/dev/ad0s1a: FILESYSTEM CLEAN; SKIPPING CHECKS
+/dev/ad0s1a: clean, 70119 free (655 frags, 8683 blocks, 0.7% fragmentation)
+/dev/ad0s1f: FILESYSTEM CLEAN; SKIPPING CHECKS
+/dev/ad0s1f: clean, 6976313 free (51774 frags, 829297 blocks, 0.7% fragmentation)
+/dev/ad0s1e: filesystem CLEAN; SKIPPING CHECKS
+/dev/ad0s1e: clean, 97952 free (9 frags, 12381 blocks, 0.0% fragmentation)
+Doing initial network setup: hostname.
+lo0: flags=8049&lt;UP,LOOPBACK,RUNNING,MULTICAST&gt; mtu 16384
+ inet6 fe80::1%lo0 prefixlen 64 scopeid 0x8
+ inet6 ::1 prefixlen 128
+ inet 127.0.0.1 netmask 0xff000000
+Additional routing options: tcp extensions=NO IP gateway=YES TCP
+keepalive=YES
+routing daemons:.
+additional daemons: syslogd.
+Doing additional network setup: portmap.
+Starting final network daemons: creating ssh RSA host key
+Generating RSA keys: Key generation complete.
+Your identification has been saved in /etc/ssh/ssh_host_key.
+Your public key has been saved in /etc/ssh/ssh_host_key.pub.
+The key fingerprint is:
+2d:02:37:d2:0e:68:93:8f:9c:46:de:92:f4:be:60:0a root@k6-2.weeble.com
+ creating ssh DSA host key
+Generating DSA parameter and key.
+Your identification has been saved in /etc/ssh/ssh_host_dsa_key.
+Your public key has been saved in /etc/ssh/ssh_host_dsa_key.pub.
+The key fingerprint is:
+38:af:d2:1f:63:14:00:d8:83:fd:dd:4b:97:1c:43:6d root@k6-2.weeble.com.
+setting ELF ldconfig path: /usr/lib /usr/lib/compat /usr/X11R6/lib
+/usr/local/lib
+setting a.out ldconfig path: /usr/lib/aout /usr/lib/compat/aout
+/usr/X11R6/lib/aout
+starting standard daemons: inetd cron sendmail sshd usbd.
+Initial rc.i386 initialization: linux.
+rc.i386 configuring syscons: blank_time screensaver moused.
+Additional ABI support: linux.
+Local package initilization:.
+Additional TCP options:.
+
+login: rpratt
+Password:</screen>
+
+ <para>Generating the RSA and DSA keys may take some time on slower
+ machines. This happens only on the initial boot-up of a new
+ installation. Subsequent boots will be faster.</para>
+
+ <para>If the X server has been configured and a Default Desktop
+ chosen, it can be started by typing <command>startx</command> at
+ the command line.</para>
+ </sect2>
+
+ <sect2 id="shutdown">
+ <title>FreeBSD Shutdown</title>
+
+ <para>It is important to properly shutdown the operating
+ system. Do not just turn off power. First, become a superuser by
+ typing <command>su</command> at the command line and entering the
+ root password. This will work only if the user is a member of the
+ group wheel. Otherwise, login as root and use
+ <command>shutdown -h now</command>.</para>
+
+ <screen>The operating system has halted.
+Please press any key to reboot.</screen>
+
+ <para>It is safe to turn off the power after the shutdown command
+ has been issued and the message "Please press any key to reboot"
+ appears. If any key is pressed instead of turning off the power
+ switch, the system will reboot.</para>
+ </sect2>
+ </sect1>
+
<sect1>
<title>Supported Hardware</title>
<indexterm><primary>hardware</primary></indexterm>
<para>FreeBSD currently runs on a wide variety of ISA, VLB, EISA, and
PCI bus-based PCs with Intel, AMD, Cyrix, or NexGen
<quote>x86</quote> processors, as well as a number of
machines based on the Compaq Alpha processor.
Support for generic IDE or
ESDI drive configurations, various SCSI controllers, PCMCIA
cards, USB devices, and network and
serial cards is also provided. FreeBSD also supports IBM's
microchannel (MCA) bus.</para>
<para>A list of supported hardware is provided with each FreeBSD
release in the FreeBSD Hardware Notes. This document can
usually be found in a file named
<filename>HARDWARE.TXT</filename>, in the top-level directory of
a CDROM or FTP distribution or in sysinstall's documentation
menu. It lists, for a given architecture, what hardware devices
are known to be supported by each release of FreeBSD.</para>
</sect1>
<sect1 id="install-trouble">
<title>Troubleshooting</title>
<indexterm>
<primary>installation</primary>
<secondary>troubleshooting</secondary>
</indexterm>
<para>The following section covers basic installation troubleshooting,
such as common problems people have reported. There are also a few
questions and answers for people wishing to dual-boot FreeBSD with
MS-DOS.</para>
<sect2>
<title>What to Do If Something Goes Wrong...</title>
<para>Due to various limitations of the PC architecture, it is
impossible for probing to be 100% reliable, however, there are a
few things you can do if it fails.</para>
<para>Check the Hardware Notes document for your version of
FreeBSD to make sure your hardware is
supported.</para>
<para>If your hardware is supported and you still experience
lock-ups or other problems, reset your computer, and when the
visual kernel configuration option is given, choose it. This will
allow you to go through your hardware and supply information to the
system about it. The kernel on the boot disks is configured
assuming that most hardware devices are in their factory default
configuration in terms of IRQs, IO addresses, and DMA channels. If
your hardware has been reconfigured, you will most likely need to
use the configuration editor to tell FreeBSD where to find
things.</para>
<para>It is also possible that a probe for a device not present will
cause a later probe for another device that is present to fail. In
that case, the probes for the conflicting driver(s) should be
disabled.</para>
<warning>
<para>Do not disable any drivers you will need during the
installation, such as your screen (<devicename>sc0</devicename>).
If the installation wedges or fails mysteriously after leaving
the configuration editor, you have probably removed or changed
something you should not have. Reboot and try again.</para>
</warning>
<para>In configuration mode, you can:</para>
<itemizedlist>
<listitem>
<para>List the device drivers installed in the kernel.</para>
</listitem>
<listitem>
<para>Change device drivers for hardware that is not present in
your system.</para>
</listitem>
<listitem>
<para>Change IRQs, DRQs, and IO port addresses used by a device
driver.</para>
</listitem>
</itemizedlist>
<para>After adjusting the kernel to match your hardware
configuration, type <command>Q</command> to boot with the new
settings. Once the installation has completed, any changes you
made in the configuration mode will be permanent so you do not have
to reconfigure every time you boot. It is still highly likely that
you will eventually want to build a <link
linkend="kernelconfig">custom kernel</link>.</para>
</sect2>
<sect2>
<title>MS-DOS User's Questions and Answers</title>
<indexterm><primary>DOS</primary></indexterm>
<para>Many users wish to install FreeBSD on PCs inhabited by MS-DOS.
Here are some commonly asked questions about installing FreeBSD on
such systems.</para>
<qandaset>
<qandaentry>
<question>
<para>Help, I have no space! Do I need to delete everything
first?</para>
</question>
<answer>
<para>If your machine is already running MS-DOS and has little
or no free space available for the FreeBSD installation, all
hope is not lost! You may find the FIPS utility, provided
in the <filename>tools</filename> directory on the FreeBSD
CDROM or various FreeBSD FTP sites to be quite
useful.</para>
<indexterm>
<primary><command>FIPS</command></primary>
</indexterm>
<para>FIPS allows you to split an existing MS-DOS partition
into two pieces, preserving the original partition and
allowing you to install onto the second free piece. You
first defragment your MS-DOS partition using the Windows
DEFRAG utility (go into Explorer, right-click on the
hard drive, and choose to defrag your
hard drive), or Norton Disk Tools. You then must run FIPS. It
will prompt you for the rest of the information it needs.
Afterwards, you can reboot and install FreeBSD on the new
free slice. See the <emphasis>Distributions</emphasis> menu
for an estimate of how much free space you will need for the
kind of installation you want.</para>
<indexterm>
<primary><application>Partition Magic</application></primary>
</indexterm>
<para>There is also a <emphasis>very</emphasis> useful
product from <ulink
url="http://www.powerquest.com/">PowerQuest</ulink>
called <application>Partition Magic</application>. This
application has far more functionality than FIPS, and is
highly recommended if you plan to often add/remove
operating systems (like me). However, it does cost
money, and if you plan to install FreeBSD once and then
leave it there, FIPS will probably be fine for you.</para>
</answer>
</qandaentry>
<qandaentry>
<question>
<para>Can I use compressed MS-DOS filesystems from
FreeBSD?</para>
</question>
<answer>
<para>No. If you are using a utility such as Stacker(tm) or
DoubleSpace(tm), FreeBSD will only be able to use whatever
portion of the filesystem you leave uncompressed. The rest
of the filesystem will show up as one large file (the
stacked/double spaced file!). <emphasis>Do not remove that
file or you will probably regret it
greatly!</emphasis></para>
<para>It is probably better to create another uncompressed
primary MS-DOS partition and use this for communications
between MS-DOS and FreeBSD.</para>
</answer>
</qandaentry>
<qandaentry>
<question>
<para>Can I mount my extended MS-DOS partition?</para>
</question>
<answer>
<indexterm><primary>partitions</primary></indexterm>
<indexterm><primary>slices</primary></indexterm>
<para>Yes. DOS extended partitions are mapped in at the end
of the other <quote>slices</quote> in FreeBSD, e.g., your
<devicename>D:</devicename> drive might be
<filename>/dev/da0s5</filename>, your
<devicename>E:</devicename> drive,
<filename>/dev/da0s6</filename>, and so on. This example
assumes, of course, that your extended partition is on SCSI
drive 0. For IDE drives, substitute <filename>ad</filename>
for <filename>da</filename> appropriately if installing
4.0-RELEASE or later, and substitute
<filename>wd</filename> for <filename>da</filename> if you
are installing a version of FreeBSD prior to 4.0. You otherwise
mount extended partitions exactly like you would any other
DOS drive, for example:</para>
<screen>&prompt.root; <userinput>mount -t msdos /dev/ad0s5 /dos_d</userinput></screen>
</answer>
</qandaentry>
</qandaset>
</sect2>
</sect1>
<sect1 id="install-advanced">
<sect1info>
<authorgroup>
<author>
<firstname>Valentino</firstname>
<surname>Vaschetto</surname>
<contrib>Contributed by </contrib>
</author>
<!-- May 2001 -->
</authorgroup>
</sect1info>
<title>Advanced Installation Guide</title>
<para>This section describes how to install FreeBSD in exceptional
cases.</para>
<sect2 id="headless-install">
<title>Installing FreeBSD on a System without a Monitor or
Keyboard</title>
<indexterm>
<primary>installation</primary>
<secondary>headless (serial console)</secondary>
</indexterm>
<indexterm><primary>serial console</primary></indexterm>
<para>This type of installation is called a "headless install",
because the machine that you are trying to install FreeBSD on
either doesnt have a monitor attached to it, or doesnt even
have a VGA output. How is this possible you ask? Using a
serial console. A serial console is basically using another
machine to act as the main display and keyboard for a
system. To do this, just follow these steps:</para>
<procedure>
<step>
<title>Fetch the Right Boot Floppy Images</title>
<para>First you will need to get the right disk images so
that you can boot into the install program. The secret
with using a serial console is that you tell the boot
loader to send I/O through a serial port instead of
displaying console output to the VGA device and trying to
read input from a local keyboard. Enough of that now,
let's get back to getting these disk images.</para>
<para>You will need to get <ulink url="ftp://ftp.freebsd.org/pub/FreeBSD/releases/i386/&rel.current;-RELEASE/floppies/kern.flp">kern.flp</ulink> and
<ulink url="ftp://ftp.freebsd.org/pub/FreeBSD/releases/i386/&rel.current;-RELEASE/floppies/mfsroot.flp">
mfsroot.flp</ulink> from the
<ulink url="ftp://ftp.FreeBSD.org/pub/FreeBSD/releases/i386/&rel.current;-RELEASE/floppies/">
floppies directory</ulink>.</para>
</step>
<step>
<title>Write the Image Files to the Floppy Disks.</title>
<para>The image files, such as
<filename>kern.flp</filename>, are
<emphasis>not</emphasis> regular files that you copy to
the disk. Instead, they are images of the complete
contents of the disk.</para>
<para>This means that you can <emphasis>not</emphasis> use
commands like DOS' <command>copy</command> to write the
files. Instead, you must use specific tools to write the
images directly to the disk.</para>
<indexterm>
<primary><command>fdimage</command></primary>
</indexterm>
<para>If you are creating the floppies on a computer running
DOS then we provide a tool to do this called
<command>fdimage</command>.</para>
<para>If you are using the floppies from the CDROM, and
your CDROM is the <devicename>E:</devicename> drive then
you would run this:</para>
<screen><prompt>E:\&gt;</prompt> <userinput>tools\fdimage floppies\kern.flp A:</userinput></screen>
<para>Repeat this command for each <filename>.flp</filename>
file, replacing the floppy disk each time. Adjust the
command line as necessary, depending on where you have
placed the <filename>.flp</filename> files. If you do not
have the CDROM then <command>fdimage</command> can be
downloaded from the <ulink
url="ftp://ftp.FreeBSD.org/pub/FreeBSD/tools/"><filename>tools</filename>
directory</ulink> on the FreeBSD FTP site.</para>
<para>If you are writing the floppies on a Unix system (such
as another FreeBSD system) you can use the &man.dd.1;
command to write the image files directly to disk. On
FreeBSD you would run:</para>
<screen>&prompt.root; <userinput>dd if=kern.flp of=/dev/fd0</userinput></screen>
<para>On FreeBSD <filename>/dev/fd0</filename> refers to
the first floppy disk (the <devicename>A:</devicename>
drive). <filename>/dev/fd1</filename> would be the
<devicename>B:</devicename> drive, and so on. Other Unix
variants might have different names for the floppy disk
devices, and you will need to check the documentation for
the system as necessary.</para>
</step>
<step>
<title>Enabling the Boot Floppies to Boot into a Serial
Console</title>
<warning>
<para>Do not try to mount the floppy if it is write-protected</para>
</warning>
<indexterm>
<primary><command>mount</command></primary>
</indexterm>
<para>If you were to boot into the floppies that you just
made, FreeBSD would boot into its normal install mode. We
want FreeBSD to boot into a serial console for our
install. To do this, you have to mount the
<filename>kern.flp</filename> floppy onto your FreeBSD
system using the &man.mount.8; command.</para>
<screen>&prompt.root; <userinput>mount /dev/fd0 /mnt</userinput></screen>
<para>Now that you have the floppy mounted, you must
change into the floppy directory</para>
<screen>&prompt.root; <userinput>cd /mnt</userinput></screen>
<para>Here is where you must set the floppy to boot into a
serial console. You have to make a file called
<filename>boot.config</filename> containing "/boot/loader
-h". All this does is pass a flag to the bootloader to
boot into a serial console.</para>
<screen>&prompt.root; <userinput>echo "/boot/loader -h" > boot.config</userinput></screen>
<para>Now that you have your floppy configured correctly,
you must unmount the floppy using the &man.umount.8;
command</para>
<screen>&prompt.root; <userinput>cd /</userinput>
&prompt.root; <userinput>umount /mnt</userinput></screen>
<para>Now you can remove the floppy from the floppy
drive</para>
</step>
<step>
<title>Connecting Your Null Modem Cable</title>
<indexterm><primary>null-modem cable</primary></indexterm>
<para>You now need to connect a null modem cable between
the two machines. Just connect the cable to the serial
ports of the 2 machines. <emphasis>A normal serial cable
will not work here</emphasis>, you need a null modem
cable because it has some of the wires inside crossed
over.</para>
</step>
<step>
<title>Booting Up for the Install</title>
<para>It's now time to go ahead and start the install. Put
the <filename>kern.flp</filename> floppy in the floppy
drive of the machine you're doing the headless install
on, and power on the machine.</para>
</step>
<step>
<title>Connecting to Your Headless Machine</title>
<indexterm>
<primary><command>cu</command></primary>
</indexterm>
<para>Now you have to connect to that machine with
&man.cu.1;:</para>
<screen>&prompt.root; <userinput>cu -l /dev/cuaa0</userinput></screen>
</step>
</procedure>
<para>That's it! You should be able to control the headless
machine through your cu session now. It will ask you to put
in the <filename>mfsroot.flp</filename>, and then it will come
up with a selection of what kind of terminal to use. Just
select the FreeBSD color console and proceed with your
install!</para>
</sect2>
</sect1>
</chapter>
<!--
Local Variables:
mode: sgml
sgml-declaration: "../chapter.decl"
sgml-indent-data: t
sgml-omittag: nil
sgml-always-quote-attributes: t
sgml-parent-document: ("../book.sgml" "part" "chapter")
End:
-->
diff --git a/en_US.ISO8859-1/books/handbook/install/console-saver1.scr b/en_US.ISO8859-1/books/handbook/install/console-saver1.scr
new file mode 100644
index 0000000000..77eb7123ac
--- /dev/null
+++ b/en_US.ISO8859-1/books/handbook/install/console-saver1.scr
@@ -0,0 +1 @@
+SCRSHOT_P                                                                                                                                                                                                                                                                                                                                      ﾚﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄ ~S~y~s~t~e~m~ ~C~o~n~s~o~l~e~ ~C~o~n~f~i~g~u~r~a~t~i~o~n~ ~ﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｿp             ｳ pTphpep pdpepfpapuplptp pspypsptpepmp pcpopnpspoplpep pdprpipvpeprp pfpoprp pFprpepepBpSpDp p(pspypspcpopnpsp)p phpapsp pap p p pｳp             ｳ pnpupmpbpeprp popfp pcpopnpfpipgpuprpaptpipopnp poppptpipopnpsp pwphpipcphp pmpapyp pbpep pspeptp papcpcpoprpdpipnpgp ptpop p p pｳp             ｳ pypopuprp ppprpepfpeprpepnpcpep.p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳp             ｳ p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳp             ｳ pWphpepnp pypopup paprpep pdpopnpep pspeptptpipnpgp pcpopnpfpipgpuprpaptpipopnp poppptpipopnpsp,p pspeplpepcptp pCpapnpcpeplp.p pｳp             ｳ pﾚpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpｿ pｳp             ｳ pｳp p p p p pX| ~E~x~i~t~ p p p p p p pEpxpiptp ptphpipsp pmpepnpup p(prpeptpuprpnpipnpgp ptpop ppprpepvpipopupsp)p p p p p pｳ pｳp             ｳ pｳp p p p p p2| ~F~o~n~t~ p p p p p p pCphpopopspep papnp paplptpeprpnpaptpep pspcprpepepnp pfpopnptp p p p p p p p p p p p pｳ pｳp             ｳ pｳp p p p p p3| ~K~e~y~m~a~p~ p p p p pCphpopopspep papnp paplptpeprpnpaptpep pkpepypbpopaprpdp pmpappp p p p p p p p p p p pｳ pｳp             ｳ pｳp p p p p p4| ~R~e~p~e~a~t~ p p p p pSpeptp ptphpep prpaptpep paptp pwphpipcphp pkpepypsp prpepppepaptp p p p p p p p p p pｳ pｳp             ｳ pｳp p p p p p5 Saver p p p p p pConfigure the screen saver p p p p p p p p p p p p p p p p pｳ pｳp             ｳ pｳp p p p p p6| ~S~c~r~e~e~n~m~a~p~ p pCphpopopspep papnp paplptpeprpnpaptpep pspcprpepepnpmpappp p p p p p p p p p p p p p pｳ pｳp             ｳ pﾀpﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾙ pｳp             ﾃﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｴp             ｳ p p p p p p p p p p p p p p p p p p p p p[  OK  ] p p p p p p pCtapnpcpeplp p p p p p p p p p p p p p p p p p p p p p p pｳp             ﾀﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄp[~ ~C~o~n~f~i~g~u~r~e~ ~y~o~u~r~ ~s~y~s~t~e~m~ ~c~o~n~s~o~l~e~ ~s~e~t~t~i~n~g~s~ ~]~ﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾙp                                                                                                                                                                                                                                                                                                                                       
\ No newline at end of file
diff --git a/en_US.ISO8859-1/books/handbook/install/console-saver2.scr b/en_US.ISO8859-1/books/handbook/install/console-saver2.scr
new file mode 100644
index 0000000000..b12568acc9
--- /dev/null
+++ b/en_US.ISO8859-1/books/handbook/install/console-saver2.scr
@@ -0,0 +1 @@
+SCRSHOT_P                                                                                                                                                                  ﾚﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄ ~S~y~s~t~e~m~ ~C~o~n~s~o~l~e~ ~S~c~r~e~e~n~ ~S~a~v~e~r~ ~ﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｿp     ｳ pBpyp pdpepfpapuplptp,p ptphpep pcpopnpspoplpep pdprpipvpeprp pwpiplplp pnpoptp paptptpepmppptp ptpop pdpop papnpyptphpipnpgp p p p p p p p p p pｳp     ｳ pspppepcpipaplp pwpiptphp pypopuprp pspcprpepepnp pwphpepnp piptp'psp pipdplpep.p p pIpfp pypopup pepxpppepcptp ptpop plpepapvpep pypopuprp p p pｳp     ｳ pmpopnpiptpoprp pspwpiptpcphpepdp popnp papnpdp pipdplpep pfpoprp plpopnpgp pppeprpipopdpsp popfp ptpipmpep ptphpepnp pypopup psphpopuplpdp p p pｳp     ｳ ppprpopbpapbplpyp pepnpapbplpep popnpep popfp ptphpepspep pspcprpepepnp pspapvpeprpsp ptpop ppprpepvpepnptp ppphpopsppphpoprp pbpuprpnp-pipnp.p pｳp     ｳ pﾚpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpｿ pｳp     ｳ pｳp p p(p p)p p1| ~B~l~a~n~k~ p p pSpipmppplpyp pbplpapnpkp ptphpep pspcprpepepnp p p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳ pｳp     ｳ pｳp p p(p p)p p2| ~D~a~e~m~o~n~ p p"pBpSpDp pDpapepmpopnp"p papnpipmpaptpepdp pspcprpepepnp pspapvpeprp p(ptpepxptp)p p p p p p p p p p p p pｳ pｳp     ｳ pｳp p p(p p)p p3| ~F~a~d~e~ p p p pFpapdpep popuptp pepfpfpepcptp pspcprpepepnp pspapvpeprp p p p p p p p p p p p p p p p p p p p p p p p p pｳ pｳp     ｳ pｳp p p(*) p4 Fire p p p pFlames effect screen saver p p p p p p p p p p p p p p p p p p p p p p p p p p pｳ pｳp     ｳ pｳp p p(p p)p p5| ~G~r~e~e~n~ p p p"pGprpepepnp"p pppopwpeprp pspapvpipnpgp pmpopdpep p(pipfp pspupppppoprptpepdp pbpyp pmpopnpiptpoprp)p p pｳ pｳp     ｳ pｳp p p(p p)p p6| ~L~o~g~o~ p p p p"pBpSpDp pDpapepmpopnp"p papnpipmpaptpepdp pspcprpepepnp pspapvpeprp p(pgprpappphpipcpsp)p p p p p p p p pｳ pｳp     ｳ pｳp p p(p p)p p7| ~R~a~i~n~ p p p pRpapipnp pdprpopppsp pspcprpepepnp pspapvpeprp p p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳ pｳp     ｳ pｳp p p(p p)p p8| ~S~n~a~k~e~ p p pDprpapwp pap pFprpepepBpSpDp p"pspnpapkpep"p popnp pypopuprp pspcprpepepnp p p p p p p p p p p p p p p p pｳ pｳp     ｳ pｳp p p(p p)p p9| ~S~t~a~r~ p p p pAp p"ptpwpipnpkplpipnpgp psptpaprpsp"p pepfpfpepcptp p p p p p p p p p p p p p p p p p p p p p p p p p p pｳ pｳp     ｳ pｳp p p(p p)p pW|a~r~p~ p p p p p pAp p"psptpaprpsp pwpaprpppipnpgp"p pepfpfpepcptp p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳ pｳp     ｳ pｳp p p p p p pT|i~m~e~o~u~t~ p p pSpeptp ptphpep pspcprpepepnp pspapvpeprp ptpipmpepopuptp pipnptpeprpvpaplp p p p p p p p p p p p p p p p pｳ pｳp     ｳ pﾀpﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾙ pｳp     ﾃﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｴp     ｳ p p p p p p p p p p p p p p p p p p p p p p p p p[  OK  ] p p p p p p pCtapnpcpeplp p p p p p p p p p p p p p p p p p p p p p p p p p p pｳp     ﾀﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄp[~ ~C~h~o~o~s~e~ ~a~ ~n~i~f~t~y~-~l~o~o~k~i~n~g~ ~s~c~r~e~e~n~ ~s~a~v~e~r~ ~]~ﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾙp                                                                                                                                                                   
\ No newline at end of file
diff --git a/en_US.ISO8859-1/books/handbook/install/console-saver3.scr b/en_US.ISO8859-1/books/handbook/install/console-saver3.scr
new file mode 100644
index 0000000000..d2b663a41a
--- /dev/null
+++ b/en_US.ISO8859-1/books/handbook/install/console-saver3.scr
@@ -0,0 +1 @@
+SCRSHOT_P                                                                                                                                                                  ﾚﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄ ~S~y~s~t~e~m~ ~C~o~n~s~o~l~e~ ~S~c~r~e~e~n~ ~S~a~v~e~r~ ~ﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｿp     ｳ pBpyp pdpepfpapuplptp,p ptphpep pcpopnpspoplpep pdprpipvpeprp pwpiplplp pnpoptp paptptpepmppptp ptpop pdpop papnpyptphpipnpgp p p p p p p p p p pｳp     ｳ pspppepcpipaplp pwpiptphp pypopuprp pspcprpepepnp pwphpepnp piptp'psp pipdplpep.p p pIpfp pypopup pepxpppepcptp ptpop plpepapvpep pypopuprp p p pｳp     ｳ pmpopnpiptpoprp pspwpiptpcphpepdp popnp papnpdp pipdplpep pfpoprp plpopnpgp pppeprpipopdpsp popfp ptpipmpep ptphpepnp pypopup psphpopuplpdp p p pｳp     ｳ ppprpopbpapbplpyp pepnpapbplpep popnpep popfp ptphpepspep pspcprpepepnp pspapvpeprpsp ptpop ppprpepvpepnptp ppphpopsppphpoprp pbpuprpnp-pipnp.p pｳp     ｳ pﾚpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpｿ pｳp     ｳ pｳp p p(p p)p p1| ~B~l~a~n~k~ p p pSpipmppplpyp pbplpapnpkp ptphpep pspcprpepepnp p p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳ pｳp     ｳ pｳp p p(p p)p p2| ~ﾚﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄ ~V~a~l~u~e~ ~R~e~q~u~i~r~e~d~ ~ﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｿp p p p p p p p pｳ pｳp     ｳ pｳp p p(p p)p p3| ~ｳ pEpnptpeprp ptpipmpep-popuptp pppeprpipopdp pipnp pspepcpopnpdpsp pfpoprp pspcprpepepnp pspapvpeprp pｳp   p p p p p pｳ pｳp     ｳ pｳp p p(p*p)p p4| ~ｳ pﾚpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpｿ pｳp   p p p p p pｳ pｳp     ｳ pｳp p p(p p)p p5| ~ｳ pｳp3p0p0p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳ pｳpnitpoprp)p p pｳ pｳp     ｳ pｳp p p(p p)p p6| ~ﾃﾄﾀpﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾙﾄｴp   p p p p p pｳ pｳp     ｳ pｳp p p(p p)p p7| ~ｳ p p p p p p p p p p p p p p[  OK  ] p p p p p p pCtapnpcpeplp p p p p p p p p p p p p p p p pｳp   p p p p p pｳ pｳp     ｳ pｳp p p(p p)p p8| ~ﾀﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾙp   p p p p p pｳ pｳp     ｳ pｳp p p(p p)p p9| ~S~t~ar    A "twinkling stars" effect                      p p p p p pｳ pｳp     ｳ pｳp p p(p p)p pW|a~r~p~ p p p p p pAp p"psptpaprpsp pwpaprpppipnpgp"p pepfpfpepcptp p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳ pｳp     ｳ pｳp p p    pTimeout p p pSet the screen saver timeout interval p p p p p p p p p p p p p p p pｳ pｳp     ｳ pﾀpﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾙ pｳp     ﾃﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｴp     ｳ p p p p p p p p p p p p p p p p p p p p p p p p p[  OK  ] p p p p p p pCtapnpcpeplp p p p p p p p p p p p p p p p p p p p p p p p p p p pｳp     ﾀﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄp[~ ~C~h~o~o~s~e~ ~a~ ~n~i~f~t~y~-~l~o~o~k~i~n~g~ ~s~c~r~e~e~n~ ~s~a~v~e~r~ ~]~ﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾙp                                                                                                                                                                   
\ No newline at end of file
diff --git a/en_US.ISO8859-1/books/handbook/install/console-saver4.scr b/en_US.ISO8859-1/books/handbook/install/console-saver4.scr
new file mode 100644
index 0000000000..d498327ca7
--- /dev/null
+++ b/en_US.ISO8859-1/books/handbook/install/console-saver4.scr
@@ -0,0 +1 @@
+SCRSHOT_P                                                                                                                                                                                                                                                                                                                                      ﾚﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄ ~S~y~s~t~e~m~ ~C~o~n~s~o~l~e~ ~C~o~n~f~i~g~u~r~a~t~i~o~n~ ~ﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｿp             ｳ pTphpep pdpepfpapuplptp pspypsptpepmp pcpopnpspoplpep pdprpipvpeprp pfpoprp pFprpepepBpSpDp p(pspypspcpopnpsp)p phpapsp pap p p pｳp             ｳ pnpupmpbpeprp popfp pcpopnpfpipgpuprpaptpipopnp poppptpipopnpsp pwphpipcphp pmpapyp pbpep pspeptp papcpcpoprpdpipnpgp ptpop p p pｳp             ｳ pypopuprp ppprpepfpeprpepnpcpep.p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳp             ｳ p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳp             ｳ pWphpepnp pypopup paprpep pdpopnpep pspeptptpipnpgp pcpopnpfpipgpuprpaptpipopnp poppptpipopnpsp,p pspeplpepcptp pCpapnpcpeplp.p pｳp             ｳ pﾚpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpｿ pｳp             ｳ pｳp p p p p pX Exit p p p p p p pExit this menu (returning to previous) p p p p pｳ pｳp             ｳ pｳp p p p p p2| ~F~o~n~t~ p p p p p p pCphpopopspep papnp paplptpeprpnpaptpep pspcprpepepnp pfpopnptp p p p p p p p p p p p pｳ pｳp             ｳ pｳp p p p p p3| ~K~e~y~m~a~p~ p p p p pCphpopopspep papnp paplptpeprpnpaptpep pkpepypbpopaprpdp pmpappp p p p p p p p p p p pｳ pｳp             ｳ pｳp p p p p p4| ~R~e~p~e~a~t~ p p p p pSpeptp ptphpep prpaptpep paptp pwphpipcphp pkpepypsp prpepppepaptp p p p p p p p p p pｳ pｳp             ｳ pｳp p p p p p5| ~S~a~v~e~r~ p p p p p pCpopnpfpipgpuprpep ptphpep pspcprpepepnp pspapvpeprp p p p p p p p p p p p p p p p p pｳ pｳp             ｳ pｳp p p p p p6| ~S~c~r~e~e~n~m~a~p~ p pCphpopopspep papnp paplptpeprpnpaptpep pspcprpepepnpmpappp p p p p p p p p p p p p p pｳ pｳp             ｳ pﾀpﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾙ pｳp             ﾃﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｴp             ｳ p p p p p p p p p p p p p p p p p p p p p[  OK  ] p p p p p p pCtapnpcpeplp p p p p p p p p p p p p p p p p p p p p p p pｳp             ﾀﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄp[~ ~C~o~n~f~i~g~u~r~e~ ~y~o~u~r~ ~s~y~s~t~e~m~ ~c~o~n~s~o~l~e~ ~s~e~t~t~i~n~g~s~ ~]~ﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾙp                                                                                                                                                                                                                                                                                                                                       
\ No newline at end of file
diff --git a/en_US.ISO8859-1/books/handbook/install/desktop.scr b/en_US.ISO8859-1/books/handbook/install/desktop.scr
new file mode 100644
index 0000000000..1b2fdfc3ad
--- /dev/null
+++ b/en_US.ISO8859-1/books/handbook/install/desktop.scr
@@ -0,0 +1 @@
+SCRSHOT_P                                                                                                                                                                    ﾚﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄ ~P~l~e~a~s~e~ ~s~e~l~e~c~t~ ~t~h~e~ ~d~e~f~a~u~l~t~ ~X~ ~d~e~s~k~t~o~p~ ~t~o~ ~u~s~e~.~ ~ﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｿp         ｳ pBpyp pdpepfpapuplptp,p pXpFprpepep8p6p pcpopmpepsp pwpiptphp pap pfpapiprplpyp pvpapnpiplplpap pdpepspkptpoppp pwphpipcphp p p p p p p pｳp         ｳ pipsp pbpapspepdp paprpopupnpdp ptphpep ptpwpmp(p1p)p pwpipnpdpopwp pmpapnpapgpeprp papnpdp pdpopepsp pnpoptp popfpfpeprp p p p p p p p pｳp         ｳ pmpupcphp pipnp ptphpep pwpapyp popfp pfpepaptpuprpepsp.p p pIptp pdpopepsp phpapvpep ptphpep papdpvpapnptpapgpep popfp p p p p p p p p pｳp         ｳ pbpepipnpgp pap psptpapnpdpaprpdp pppaprptp popfp pXp pspop pypopup pdpopnp'ptp pnpepepdp ptpop plpopapdp papnpyptphpipnpgp p p p p p p pｳp         ｳ pepxptprpap pipnp poprpdpeprp ptpop pupspep piptp.p p pIpfp,p phpopwpepvpeprp,p pypopup phpapvpep papcpcpepspsp ptpop pap p p p p p p p pｳp         ｳ prpepapspopnpapbplpyp pfpuplplp pppapcpkpapgpepsp pcpoplplpepcptpipopnp popnp pypopuprp pipnpsptpaplplpaptpipopnp pmpepdpipap,p p p p p pｳp         ｳ pypopup pcpapnp pcphpopopspep papnpyp popnpep popfp ptphpep pfpoplplpopwpipnpgp pdpepspkptpopppsp papsp paplptpeprpnpaptpipvpepsp.p p p pｳp         ｳ pﾚpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpｿ pｳp         ｳ pｳp pX| ~E~x~i~t~ p p p p p p p p p p p p p p p p p p pEpxpiptp ptphpipsp pmpepnpup p(prpeptpuprpnpipnpgp ptpop ppprpepvpipopupsp)p pｳ pｳp         ｳ pｳp p2 KDE p p p p p p p p p p p p p p p p p p p pThe K Desktop Environment. p p p p p p p p p p p p pｳ pｳp         ｳ pｳp p3| ~G~N~O~M~E~ ~+~ ~S~a~w~f~i~s~h~ p p p p p p p pGpNpOpMpEp p+p pSpapwpfpipsphp pwpipnpdpopwp pmpapnpapgpeprp.p p p p p p p p pｳ pｳp         ｳ pｳp p4| ~G~N~O~M~E~ ~+~ ~E~n~l~i~g~h~t~e~n~m~e~n~t~ p pGpNpOpMpEp p+p pTphpep pEp pwpipnpdpopwp pmpapnpapgpeprp p p p p p p p p p p pｳ pｳp         ｳ pｳp p5| ~A~f~t~e~r~s~t~e~p~ p p p p p p p p p p p p p pTphpep pApfptpeprpsptpeppp pwpipnpdpopwp pmpapnpapgpeprp p p p p p p p p p p pｳ pｳp         ｳ pｳp p6| ~W~i~n~d~o~w~m~a~k~e~r~ p p p p p p p p p p p pTphpep pWpipnpdpopwpmpapkpeprp pwpipnpdpopwp pmpapnpapgpeprp p p p p p p p p pｳ pｳp         ｳ pｳp p7| ~f~v~w~m~ p p p p p p p p p p p p p p p p p p pTphpep pfpvpwpmp pwpipnpdpopwp pmpapnpapgpeprp p p p p p p p p p p p p p p p pｳ pｳp         ｳ pﾀpﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾙ pｳp         ﾃﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｴp         ｳ p p p p p p p p p p p p p p p p p p p p p p p[  OK  ] p p p p p p pCtapnpcpeplp p p p p p p p p p p p p p p p p p p p p p p p p pｳp         ﾀﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾙp                                                                                                                                                                                                                                                     
\ No newline at end of file
diff --git a/en_US.ISO8859-1/books/handbook/install/disklabel-auto.scr b/en_US.ISO8859-1/books/handbook/install/disklabel-auto.scr
new file mode 100644
index 0000000000..08c9e161d1
--- /dev/null
+++ b/en_US.ISO8859-1/books/handbook/install/disklabel-auto.scr
@@ -0,0 +1 @@
+SCRSHOT_P                         FprpepepBpSpDp pDpipspkplpapbpeplp pEpdpiptpoprp                                                                                                               Disk: ad0       Partition name: ad0s1   Free: 0 blocks (0MB)                                                                                                    Part      Mount           Size Newfs   Part      Mount           Size Newfs     ----      -----           ---- -----   ----      -----           ---- -----     ad0s1a    /              100MB UFS Y                                            ad0s1b    swap           522MB SWAP                                             ad0s1e    /var            20MB UFS Y                                            ad0s1f    /usr          7420MB UFS Y                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                            The following commands are valid here (upper or lower case):                    C = Create        D = Delete   M = Mount pt.                                    N = Newfs Opts    Q = Finish   S = Toggle SoftUpdates                           T = Toggle Newfs  U = Undo     A = Auto Defaults                                                                                                                Use F1 or ? to get more help, arrow keys to select.                                                                                                                                                                                             
\ No newline at end of file
diff --git a/en_US.ISO8859-1/books/handbook/install/disklabel-ed1.scr b/en_US.ISO8859-1/books/handbook/install/disklabel-ed1.scr
new file mode 100644
index 0000000000..7841f6945b
--- /dev/null
+++ b/en_US.ISO8859-1/books/handbook/install/disklabel-ed1.scr
@@ -0,0 +1 @@
+SCRSHOT_P                         FprpepepBpSpDp pDpipspkplpapbpeplp pEpdpiptpoprp                                                                                                               Disk: ad0       Partition name: ad0s1   Free: 16514001 blocks (8063MB)                                                                                          Part      Mount           Size Newfs   Part      Mount           Size Newfs     ----      -----           ---- -----   ----      -----           ---- -----                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                     The following commands are valid here (upper or lower case):                    C = Create        D = Delete   M = Mount pt.                                    N = Newfs Opts    Q = Finish   S = Toggle SoftUpdates                           T = Toggle Newfs  U = Undo     A = Auto Defaults                                                                                                                Use F1 or ? to get more help, arrow keys to select.                                                                                                                                                                                             
\ No newline at end of file
diff --git a/en_US.ISO8859-1/books/handbook/install/disklabel-ed2.scr b/en_US.ISO8859-1/books/handbook/install/disklabel-ed2.scr
new file mode 100644
index 0000000000..f4a4ada4ca
--- /dev/null
+++ b/en_US.ISO8859-1/books/handbook/install/disklabel-ed2.scr
@@ -0,0 +1 @@
+SCRSHOT_P                         FprpepepBpSpDp pDpipspkplpapbpeplp pEpdpiptpoprp                                                                                                               Disk: ad0       Partition name: ad0s1   Free: 0 blocks (0MB)                                                                                                    Part      Mount           Size Newfs   Part      Mount           Size Newfs     ----      -----           ---- -----   ----      -----           ---- -----     ad0s1a    /              100MB UFS Y                                            ad0s1b    swap           516MB SWAP                                             ad0s1e    /var           100MB UFS Y                                            ad0s1f    /usr          7347MB UFS Y                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                            The following commands are valid here (upper or lower case):                    C = Create        D = Delete   M = Mount pt.                                    N = Newfs Opts    Q = Finish   S = Toggle SoftUpdates                           T = Toggle Newfs  U = Undo     A = Auto Defaults                                                                                                                Use F1 or ? to get more help, arrow keys to select.                                                                                                                                                                                             
\ No newline at end of file
diff --git a/en_US.ISO8859-1/books/handbook/install/disklabel-fs.scr b/en_US.ISO8859-1/books/handbook/install/disklabel-fs.scr
new file mode 100644
index 0000000000..b565563671
--- /dev/null
+++ b/en_US.ISO8859-1/books/handbook/install/disklabel-fs.scr
@@ -0,0 +1 @@
+SCRSHOT_P                         FprpepepBpSpDp pDpipspkplpapbpeplp pEpdpiptpoprp                                                                                                               Disk: ad0       Partition name: ad0s1   Free: 16514001 blocks (8063MB)                                                                                          Part      Mount           Size Newfs   Part      Mount           Size Newfs     ----      -----           ---- -----   ----      -----           ---- -----                                                                                            ﾚﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄ ~P~l~e~a~s~e~ ~c~h~o~o~s~e~ ~a~ ~p~a~r~t~i~t~i~o~n~ ~t~y~p~e~ ~ﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｿp              ｳ pIpfp pypopup pwpapnptp ptpop pupspep ptphpipsp pppaprptpiptpipopnp pfpoprp pspwpappp pspppapcpep,p pspeplpepcptp pSpwpappp.p pｳp              ｳ pIpfp pypopup pwpapnptp ptpop pppuptp pap pfpiplpepspypsptpepmp popnp piptp,p pcphpopopspep pFpSp.p p p p p p p p p p p p p p pｳp              ｳ pﾚpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpｿ pｳp              ｳ pｳp p p p p p p p p p p p p p p p p p pFS p p p pA file system p p p p p p p p p p p p p p p p p p p p p p pｳ pｳp              ｳ pｳp p p p p p p p p p p p p p p p p p pS|w~a~p~ p pAp pspwpappp pppaprptpiptpipopnp.p p p p p p p p p p p p p p p p p p p pｳ pｳp              ｳ pﾀpﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾙ pｳp              ﾃﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｴp              ｳ p p p p p p p p p p p p p p p p p p p p p[  OK  ] p p p p p p pCtapnpcpeplp p p p p p p p p p p p p p p p p p p p p p pｳp              ﾀﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾙp       The following commands are valid here (upper or lower case):                    C = Create        D = Delete   M = Mount pt.                                    N = Newfs Opts    Q = Finish   S = Toggle SoftUpdates                           T = Toggle Newfs  U = Undo     A = Auto Defaults                                                                                                                Use F1 or ? to get more help, arrow keys to select.                                                                                                                                                                                             
\ No newline at end of file
diff --git a/en_US.ISO8859-1/books/handbook/install/disklabel-root1.scr b/en_US.ISO8859-1/books/handbook/install/disklabel-root1.scr
new file mode 100644
index 0000000000..c6f02c410e
--- /dev/null
+++ b/en_US.ISO8859-1/books/handbook/install/disklabel-root1.scr
@@ -0,0 +1 @@
+SCRSHOT_P                         FprpepepBpSpDp pDpipspkplpapbpeplp pEpdpiptpoprp                                                                                                               Disk: ad0       Partition name: ad0s1   Free: 16514001 blocks (8063MB)                                                                                          Part      Mount           Size Newfs   Part      Mount           Size Newfs     ----      -----           ---- -----   ----      -----           ---- -----                                                                                                                                                                        ﾚﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄ ~V~a~l~u~e~ ~R~e~q~u~i~r~e~d~ ~ﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｿp      ｳ pPplpepapspep pspppepcpipfpyp ptphpep pppaprptpiptpipopnp pspipzpep pipnp pbplpopcpkpsp poprp papppppepnpdp pap ptprpapiplpipnpgp pGp pfpoprp pｳp      ｳ pgpipgpapbpyptpepsp,p pMp pfpoprp pmpepgpapbpyptpepsp,p poprp pCp pfpoprp pcpyplpipnpdpeprpsp.p p p p p p p p p p p p p p p p p p p p p p p p pｳp      ｳ p1p6p5p1p4p0p0p1p pbplpopcpkpsp p(p8p0p6p3pMpBp)p paprpep pfprpepep.p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳp      ｳ pﾚpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpｿ pｳp      ｳ pｳp1p6p5p1p4p0p0p1p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳ pｳp      ﾃﾄﾀpﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾙﾄｴp      ｳ p p p p p p p p p p p p p p p p p p p p p p p p p[  OK  ] p p p p p p pCtapnpcpeplp p p p p p p p p p p p p p p p p p p p p p p p p p pｳp      ﾀﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾙp   The following commands are valid here (upper or lower case):                    C = Create        D = Delete   M = Mount pt.                                    N = Newfs Opts    Q = Finish   S = Toggle SoftUpdates                           T = Toggle Newfs  U = Undo     A = Auto Defaults                                                                                                                Use F1 or ? to get more help, arrow keys to select.                                                                                                                                                                                             
\ No newline at end of file
diff --git a/en_US.ISO8859-1/books/handbook/install/disklabel-root2.scr b/en_US.ISO8859-1/books/handbook/install/disklabel-root2.scr
new file mode 100644
index 0000000000..c52e0d0719
--- /dev/null
+++ b/en_US.ISO8859-1/books/handbook/install/disklabel-root2.scr
@@ -0,0 +1 @@
+SCRSHOT_P                         FprpepepBpSpDp pDpipspkplpapbpeplp pEpdpiptpoprp                                                                                                               Disk: ad0       Partition name: ad0s1   Free: 16514001 blocks (8063MB)                                                                                          Part      Mount           Size Newfs   Part      Mount           Size Newfs     ----      -----           ---- -----   ----      -----           ---- -----                                                                                                                                                                        ﾚﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄ ~V~a~l~u~e~ ~R~e~q~u~i~r~e~d~ ~ﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｿp      ｳ pPplpepapspep pspppepcpipfpyp ptphpep pppaprptpiptpipopnp pspipzpep pipnp pbplpopcpkpsp poprp papppppepnpdp pap ptprpapiplpipnpgp pGp pfpoprp pｳp      ｳ pgpipgpapbpyptpepsp,p pMp pfpoprp pmpepgpapbpyptpepsp,p poprp pCp pfpoprp pcpyplpipnpdpeprpsp.p p p p p p p p p p p p p p p p p p p p p p p p pｳp      ｳ p1p6p5p1p4p0p0p1p pbplpopcpkpsp p(p8p0p6p3pMpBp)p paprpep pfprpepep.p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳp      ｳ pﾚpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpｿ pｳp      ｳ pｳp1p0p0pMp p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳ pｳp      ﾃﾄﾀpﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾙﾄｴp      ｳ p p p p p p p p p p p p p p p p p p p p p p p p p[  OK  ] p p p p p p pCtapnpcpeplp p p p p p p p p p p p p p p p p p p p p p p p p p pｳp      ﾀﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾙp   The following commands are valid here (upper or lower case):                    C = Create        D = Delete   M = Mount pt.                                    N = Newfs Opts    Q = Finish   S = Toggle SoftUpdates                           T = Toggle Newfs  U = Undo     A = Auto Defaults                                                                                                                Use F1 or ? to get more help, arrow keys to select.                                                                                                                                                                                             
\ No newline at end of file
diff --git a/en_US.ISO8859-1/books/handbook/install/disklabel-root3.scr b/en_US.ISO8859-1/books/handbook/install/disklabel-root3.scr
new file mode 100644
index 0000000000..f429e626be
--- /dev/null
+++ b/en_US.ISO8859-1/books/handbook/install/disklabel-root3.scr
@@ -0,0 +1 @@
+SCRSHOT_P                         FprpepepBpSpDp pDpipspkplpapbpeplp pEpdpiptpoprp                                                                                                               Disk: ad0       Partition name: ad0s1   Free: 16514001 blocks (8063MB)                                                                                          Part      Mount           Size Newfs   Part      Mount           Size Newfs     ----      -----           ---- -----   ----      -----           ---- -----                                                                                                                                                                                                                                                                    ﾚﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄ ~V~a~l~u~e~ ~R~e~q~u~i~r~e~d~ ~ﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｿp                              ｳ pPplpepapspep pspppepcpipfpyp pap pmpopupnptp pppopipnptp pfpoprp ptphpep pppaprptpiptpipopnp pｳp                              ｳ pﾚpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpｿ pｳp                              ｳ pｳp/p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳ pｳp                              ﾃﾄﾀpﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾙﾄｴp                              ｳ p p p p p p p p p p p p p[  OK  ] p p p p p p pCtapnpcpeplp p p p p p p p p p p p p p pｳp                              ﾀﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾙp                                                                                               The following commands are valid here (upper or lower case):                    C = Create        D = Delete   M = Mount pt.                                    N = Newfs Opts    Q = Finish   S = Toggle SoftUpdates                           T = Toggle Newfs  U = Undo     A = Auto Defaults                                                                                                                Use F1 or ? to get more help, arrow keys to select.                                                                                                                                                                                             
\ No newline at end of file
diff --git a/en_US.ISO8859-1/books/handbook/install/dist-set.scr b/en_US.ISO8859-1/books/handbook/install/dist-set.scr
new file mode 100644
index 0000000000..05b5ba3b69
--- /dev/null
+++ b/en_US.ISO8859-1/books/handbook/install/dist-set.scr
@@ -0,0 +1 @@
+SCRSHOT_P                                                                                ﾚﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄ ~C~h~o~o~s~e~ ~D~i~s~t~r~i~b~u~t~i~o~n~s~ ~ﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｿpｳ pApsp pap pcpopnpvpepnpipepnpcpep,p pwpep ppprpopvpipdpep pspepvpeprpaplp p"pcpapnpnpepdp"p pdpipsptprpipbpuptpipopnp pspeptpsp.p p p p p p p p p p p p p pｳpｳ pTphpepspep pspeplpepcptp pwphpaptp pwpep pcpopnpspipdpeprp ptpop pbpep ptphpep pmpopsptp prpepapspopnpapbplpep pdpepfpapuplptpsp pfpoprp ptphpep p p p p pｳpｳ ptpypppep popfp pspypsptpepmp pipnp pqpupepsptpipopnp.p p pIpfp pypopup pwpopuplpdp ppprpepfpeprp ptpop pppipcpkp papnpdp pcphpopopspep ptphpep p p p p p pｳpｳ plpipsptp popfp pdpipsptprpipbpuptpipopnpsp pypopuprpspeplpfp,p pspipmppplpyp pspeplpepcptp p"pCpupsptpopmp"p.p p pYpopup pcpapnp paplpspop p p p p p p p pｳpｳ pppipcpkp pap pcpapnpnpepdp pdpipsptprpipbpuptpipopnp pspeptp papnpdp ptphpepnp pfpipnpep-ptpupnpep piptp pwpiptphp ptphpep pCpupsptpopmp piptpepmp.p p p pｳpｳ p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳpｳ pCphpopopspep papnp piptpepmp pbpyp ppprpepspspipnpgp p[pSpPpApCpEp]p.p pWphpepnp pypopup paprpep pfpipnpipsphpepdp,p pcphpopopspep ptphpep pEpxpiptp p p pｳpｳ piptpepmp poprp ppprpepspsp p[pEpNpTpEpRp]p.p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳpｳ pﾚpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpｿ pｳpｳ pｳp<p<p<p pX| ~E~x~i~t~ p p p p p p p p p p p p p pEpxpiptp ptphpipsp pmpepnpup p(prpeptpuprpnpipnpgp ptpop ppprpepvpipopupsp)p p p p p p p p p p p p pｳ pｳpｳ pｳp    pAll p p p p p p p p p p p p p p p p pAll system sources, binaries and X Window System) pｳ pｳpｳ pｳp p p p pR|e~s~e~t~ p p p p p p p p p p p p p p pRpepspeptp pspeplpepcptpepdp pdpipsptprpipbpuptpipopnp plpipsptp ptpop pnpoptphpipnpgp p p p p p p pｳ pｳpｳ pｳp[p p]p p4| ~D~e~v~e~l~o~p~e~r~ p p p p p p p p pFpuplplp pspopuprpcpepsp,p pbpipnpaprpipepsp papnpdp pdpopcp pbpuptp pnpop pgpapmpepsp p p p p p p pｳ pｳpｳ pｳp[p p]p p5| ~X~-~D~e~v~e~l~o~p~e~r~ p p p p p p pSpapmpep papsp papbpopvpep p+p pXp pWpipnpdpopwp pSpypsptpepmp p p p p p p p p p p p p p p p p p p pｳ pｳpｳ pｳp[p p]p p6| ~K~e~r~n~-~D~e~v~e~l~o~p~e~r~ p p p pFpuplplp pbpipnpaprpipepsp papnpdp pdpopcp,p pkpeprpnpeplp pspopuprpcpepsp popnplpyp p p p p p p p pｳ pｳpｳ pｳp[p p]p p7| ~X~-~K~e~r~n~-~D~e~v~e~l~o~p~e~r~ p pSpapmpep papsp papbpopvpep p+p pXp pWpipnpdpopwp pSpypsptpepmp p p p p p p p p p p p p p p p p p p pｳ pｳpｳ pｳp[p p]p p8| ~U~s~e~r~ p p p p p p p p p p p p p pApvpeprpapgpep pupspeprp p-p pbpipnpaprpipepsp papnpdp pdpopcp popnplpyp p p p p p p p p p p p p p pｳ pｳpｳ pﾀpﾄﾄﾄﾄz(z+z)zﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾙ pｳpﾃﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｴpｳ p p p p p p p p p p p p p p p p p p p p p p p p p p p p[  OK  ] p p p p p p pCtapnpcpeplp p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳpﾀﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄp[~ ~P~r~e~s~s~ ~F~1~ ~f~o~r~ ~m~o~r~e~ ~i~n~f~o~r~m~a~t~i~o~n~ ~o~n~ ~t~h~e~s~e~ ~o~p~t~i~o~n~s~.~ ~]~ﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾙp                                                                                                                                                                
\ No newline at end of file
diff --git a/en_US.ISO8859-1/books/handbook/install/dist-set2.scr b/en_US.ISO8859-1/books/handbook/install/dist-set2.scr
new file mode 100644
index 0000000000..48ada5e4b3
--- /dev/null
+++ b/en_US.ISO8859-1/books/handbook/install/dist-set2.scr
@@ -0,0 +1 @@
+SCRSHOT_P                                                                                ﾚﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄ ~C~h~o~o~s~e~ ~D~i~s~t~r~i~b~u~t~i~o~n~s~ ~ﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｿpｳ pApsp pap pcpopnpvpepnpipepnpcpep,p pwpep ppprpopvpipdpep pspepvpeprpaplp p"pcpapnpnpepdp"p pdpipsptprpipbpuptpipopnp pspeptpsp.p p p p p p p p p p p p p pｳpｳ pTphpepspep pspeplpepcptp pwphpaptp pwpep pcpopnpspipdpeprp ptpop pbpep ptphpep pmpopsptp prpepapspopnpapbplpep pdpepfpapuplptpsp pfpoprp ptphpep p p p p pｳpｳ ptpypppep popfp pspypsptpepmp pipnp pqpupepsptpipopnp.p p pIpfp pypopup pwpopuplpdp ppprpepfpeprp ptpop pppipcpkp papnpdp pcphpopopspep ptphpep p p p p p pｳpｳ plpipsptp popfp pdpipsptprpipbpuptpipopnpsp pypopuprpspeplpfp,p pspipmppplpyp pspeplpepcptp p"pCpupsptpopmp"p.p p pYpopup pcpapnp paplpspop p p p p p p p pｳpｳ pppipcpkp pap pcpapnpnpepdp pdpipsptprpipbpuptpipopnp pspeptp papnpdp ptphpepnp pfpipnpep-ptpupnpep piptp pwpiptphp ptphpep pCpupsptpopmp piptpepmp.p p p pｳpｳ p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳpｳ pCphpopopspep papnp piptpepmp pbpyp ppprpepspspipnpgp p[pSpPpApCpEp]p.p pWphpepnp pypopup paprpep pfpipnpipsphpepdp,p pcphpopopspep ptphpep pEpxpiptp p p pｳpｳ piptpepmp poprp ppprpepspsp p[pEpNpTpEpRp]p.p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳpｳ pﾚpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpｿ pｳpｳ pｳp<<< pX Exit p p p p p p p p p p p p p pExit this menu (returning to previous) p p p p p p p p p p p pｳ pｳpｳ pｳp p p p pA|l~l~ p p p p p p p p p p p p p p p p pAplplp pspypsptpepmp pspopuprpcpepsp,p pbpipnpaprpipepsp papnpdp pXp pWpipnpdpopwp pSpypsptpepmp)p pｳ pｳpｳ pｳp p p p pR|e~s~e~t~ p p p p p p p p p p p p p p pRpepspeptp pspeplpepcptpepdp pdpipsptprpipbpuptpipopnp plpipsptp ptpop pnpoptphpipnpgp p p p p p p pｳ pｳpｳ pｳp[pXp]p p4| ~D~e~v~e~l~o~p~e~r~ p p p p p p p p pFpuplplp pspopuprpcpepsp,p pbpipnpaprpipepsp papnpdp pdpopcp pbpuptp pnpop pgpapmpepsp p p p p p p pｳ pｳpｳ pｳp[pXp]p p5| ~X~-~D~e~v~e~l~o~p~e~r~ p p p p p p pSpapmpep papsp papbpopvpep p+p pXp pWpipnpdpopwp pSpypsptpepmp p p p p p p p p p p p p p p p p p p pｳ pｳpｳ pｳp[pXp]p p6| ~K~e~r~n~-~D~e~v~e~l~o~p~e~r~ p p p pFpuplplp pbpipnpaprpipepsp papnpdp pdpopcp,p pkpeprpnpeplp pspopuprpcpepsp popnplpyp p p p p p p p pｳ pｳpｳ pｳp[pXp]p p7| ~X~-~K~e~r~n~-~D~e~v~e~l~o~p~e~r~ p pSpapmpep papsp papbpopvpep p+p pXp pWpipnpdpopwp pSpypsptpepmp p p p p p p p p p p p p p p p p p p pｳ pｳpｳ pｳp[pXp]p p8| ~U~s~e~r~ p p p p p p p p p p p p p pApvpeprpapgpep pupspeprp p-p pbpipnpaprpipepsp papnpdp pdpopcp popnplpyp p p p p p p p p p p p p p pｳ pｳpｳ pﾀpﾄﾄﾄﾄz(z+z)zﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾙ pｳpﾃﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｴpｳ p p p p p p p p p p p p p p p p p p p p p p p p p p p p[  OK  ] p p p p p p pCtapnpcpeplp p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳpﾀﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄp[~ ~P~r~e~s~s~ ~F~1~ ~f~o~r~ ~m~o~r~e~ ~i~n~f~o~r~m~a~t~i~o~n~ ~o~n~ ~t~h~e~s~e~ ~o~p~t~i~o~n~s~.~ ~]~ﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾙp                                                                                                                                                                
\ No newline at end of file
diff --git a/en_US.ISO8859-1/books/handbook/install/docmenu1.scr b/en_US.ISO8859-1/books/handbook/install/docmenu1.scr
new file mode 100644
index 0000000000..9bce1e344d
--- /dev/null
+++ b/en_US.ISO8859-1/books/handbook/install/docmenu1.scr
@@ -0,0 +1 @@
+SCRSHOT_P                                                                                                                                                                                                                                                  ﾚﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄ ~F~r~e~e~B~S~D~ ~D~o~c~u~m~e~n~t~a~t~i~o~n~ ~M~e~n~u~ ~ﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｿp    ｳ pIpfp pypopup paprpep paptp paplplp pupnpspuprpep papbpopuptp ptphpep pcpopnpfpipgpuprpaptpipopnp popfp pypopuprp phpaprpdpwpaprpep p p p p p p p pｳp    ｳ poprp paprpep plpopopkpipnpgp ptpop pbpupiplpdp pap pspypsptpepmp pspppepcpipfpipcpaplplpyp pfpoprp pFprpepepBpSpDp,p prpepapdp ptphpep p p p p p pｳp    ｳ pHpaprpdpwpaprpep pgpupipdpep!p p pNpepwp pupspeprpsp psphpopuplpdp paplpspop prpepapdp ptphpep pIpnpsptpaplplp pdpopcpupmpepnptp pfpoprp p p p p pｳp    ｳ pap psptpeppp-pbpyp-psptpeppp ptpuptpoprpipaplp popnp pipnpsptpaplplpipnpgp pFprpepepBpSpDp.p p pFpoprp pgpepnpeprpaplp pipnpfpoprpmpaptpipopnp,p pｳp    ｳ pcpopnpspuplptp ptphpep pRpEpApDpMpEp pfpiplpep.p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳp    ｳ pﾚpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpｿ pｳp    ｳ pｳp p p p pX Exit p p p p p p pExit this menu (returning to previous) p p p p p p p p p p p p p p pｳ pｳp    ｳ pｳp p p p p2| ~R~E~A~D~M~E~ p p p p pAp pgpepnpeprpaplp pdpepspcprpippptpipopnp popfp pFprpepepBpSpDp.p p pRpepapdp ptphpipsp!p p p p p p p p pｳ pｳp    ｳ pｳp p p p p3| ~H~a~r~d~w~a~r~e~ p p pTphpep pFprpepepBpSpDp pspuprpvpipvpaplp pgpupipdpep pfpoprp pPpCp phpaprpdpwpaprpep.p p p p p p p p p p pｳ pｳp    ｳ pｳp p p p p4| ~I~n~s~t~a~l~l~ p p p pAp psptpeppp-pbpyp-psptpeppp pgpupipdpep ptpop pipnpsptpaplplpipnpgp pFprpepepBpSpDp.p p p p p p p p p p pｳ pｳp    ｳ pｳp p p p p5| ~C~o~p~y~r~i~g~h~t~ p pTphpep pFprpepepBpSpDp pCpopppyprpipgphptp pnpoptpipcpepsp.p p p p p p p p p p p p p p p p p p p p p p p pｳ pｳp    ｳ pｳp p p p p6| ~R~e~l~e~a~s~e~ p p p pTphpep prpeplpepapspep pnpoptpepsp pfpoprp ptphpipsp pvpeprpspipopnp popfp pFprpepepBpSpDp.p p p p p p p pｳ pｳp    ｳ pｳp p p p p7| ~S~h~o~r~t~c~u~t~s~ p pCprpepaptpipnpgp psphpoprptpcpuptpsp ptpop pspypspipnpsptpaplplp.p p p p p p p p p p p p p p p p p p p p pｳ pｳp    ｳ pｳp p p p p8| ~H~T~M~L~ ~D~o~c~s~ p pGpop ptpop ptphpep pHpTpMpLp pdpopcpupmpepnptpaptpipopnp pmpepnpup p(pppopsptp-pipnpsptpaplplp)p.p p p p pｳ pｳp    ｳ pﾀpﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾙ pｳp    ﾃﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｴp    ｳ p p p p p p p p p p p p p p p p p p p p p p p p p p[  OK  ] p p p p p p pCtapnpcpeplp p p p p p p p p p p p p p p p p p p p p p p p p p p pｳp    ﾀﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄp[~ ~C~o~n~f~u~s~e~d~?~ ~ ~P~r~e~s~s~ ~F~1~ ~f~o~r~ ~h~e~l~p~.~ ~]~ﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾙp                                                                                                                                                                                                                                                  
\ No newline at end of file
diff --git a/en_US.ISO8859-1/books/handbook/install/ed0-conf.scr b/en_US.ISO8859-1/books/handbook/install/ed0-conf.scr
new file mode 100644
index 0000000000..ac5431faa4
--- /dev/null
+++ b/en_US.ISO8859-1/books/handbook/install/ed0-conf.scr
@@ -0,0 +1 @@
+SCRSHOT_P                                                                                                                                                                    ﾚﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄ ~N~e~t~w~o~r~k~ ~i~n~t~e~r~f~a~c~e~ ~i~n~f~o~r~m~a~t~i~o~n~ ~r~e~q~u~i~r~e~d~ ~ﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｿp         ｳ pIpfp pypopup paprpep pupspipnpgp pPpPpPp popvpeprp pap pspeprpipaplp pdpepvpipcpep,p papsp popppppopspepdp ptpop pap pdpiprpepcptp p p pｳp         ｳ peptphpeprpnpeptp pcpopnpnpepcptpipopnp,p ptphpepnp pypopup pmpapyp pfpiprpsptp pnpepepdp ptpop pdpipaplp pypopuprp pIpnptpeprpnpeptp p pｳp         ｳ pSpeprpvpipcpep pPprpopvpipdpeprp pupspipnpgp ptphpep ppppppp puptpiplpiptpyp pwpep ppprpopvpipdpep pfpoprp ptphpaptp pppuprpppopspep.p pｳp         ｳ pIpfp pypopup'prpep pupspipnpgp pSpLpIpPp popvpeprp pap pspeprpipaplp pdpepvpipcpep ptphpepnp ptphpep pepxpppepcptpaptpipopnp pipsp p p pｳp         ｳ ptphpaptp pypopup phpapvpep pap pHpApRpDpWpIpRpEpDp pcpopnpnpepcptpipopnp.p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳp         ｳ p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳp         ｳ pYpopup pcpapnp paplpspop pipnpsptpaplplp popvpeprp pap pppaprpaplplpeplp pppoprptp pupspipnpgp pap pspppepcpipaplp p"plpappplpipnpkp"p pｳp         ｳ pcpapbplpep ptpop papnpoptphpeprp pmpapcphpipnpep prpupnpnpipnpgp pap pfpapiprplpyp prpepcpepnptp p(p2p.p0pRp poprp plpaptpeprp)p p p p pｳp         ｳ pvpeprpspipopnp popfp pFprpepepBpSpDp.p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳp         ｳ pﾚpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpｿ pｳp         ｳ pｳp p p ped0 p p p p pNovell NE1000/2000; 3C503; NE2000-compatible PCMCIA p p pｳ pｳp         ｳ pｳp p p ps|l~0~ p p p p pSpLpIpPp pipnptpeprpfpapcpep popnp pdpepvpipcpep p/pdpepvp/pcpupapap0p p(pCpOpMp1p)p p p p p p p p p p p p pｳ pｳp         ｳ pｳp p p pp|p~p~0~ p p p pPpPpPp pipnptpeprpfpapcpep popnp pdpepvpipcpep p/pdpepvp/pcpupapap0p p(pCpOpMp1p)p p p p p p p p p p p p p pｳ pｳp         ｳ pｳp p p ps|l~0~ p p p p pSpLpIpPp pipnptpeprpfpapcpep popnp pdpepvpipcpep p/pdpepvp/pcpupapap1p p(pCpOpMp2p)p p p p p p p p p p p p pｳ pｳp         ｳ pｳp p p pp|p~p~0~ p p p pPpPpPp pipnptpeprpfpapcpep popnp pdpepvpipcpep p/pdpepvp/pcpupapap1p p(pCpOpMp2p)p p p p p p p p p p p p p pｳ pｳp         ｳ pﾀpﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾙ pｳp         ﾃﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｴp         ｳ p p p p p p p p p p p p p p p p p p p p p p p[  OK  ] p p p p p p pCtapnpcpeplp p p p p p p p p p p p p p p p p p p p p p p p p pｳp         ﾀﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄp[~ ~P~r~e~s~s~ ~F~1~ ~t~o~ ~r~e~a~d~ ~n~e~t~w~o~r~k~ ~c~o~n~f~i~g~u~r~a~t~i~o~n~ ~m~a~n~u~a~l~ ~]~ﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾙp                                                                                                                                                                                                                                                     
\ No newline at end of file
diff --git a/en_US.ISO8859-1/books/handbook/install/ed0-conf2.scr b/en_US.ISO8859-1/books/handbook/install/ed0-conf2.scr
new file mode 100644
index 0000000000..299bf33e72
--- /dev/null
+++ b/en_US.ISO8859-1/books/handbook/install/ed0-conf2.scr
@@ -0,0 +1 @@
+SCRSHOT_P        ﾚﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄ pNpeptpwpoprpkp pCpopnpfpipgpuprpaptpipopnp pﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｿp                ｳ p pHpopsptp:p p p p p p p p p p p p p p p p p p p p p p p p p p p p pDpopmpapipnp:p p p p p p p p p p p p p p p p p p p p pｳp                ｳ pﾚﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｿp p p p p p p p pﾚﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｿp p p p p p p p pｳp                ｳ pｳkp6p-p2p.pwpepepbplpep.pcpopmp p p p p p p p pｳp p p p p p p p pｳwpepepbplpep.pcpopmp p p p p p p p pｳp p p p p p p p pｳp                ｳ pﾀﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾙp p p p p p p p pﾀﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾙp p p p p p p p pｳp                ｳ p pIpPpvp4p pGpaptpepwpapyp:p p p p p p p p p p p p p p p p p p p p pNpapmpep pspeprpvpeprp:p p p p p p p p p p p p p p p pｳp                ｳ pﾚﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｿp p p p p p p p p p p p p p p pﾚﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｿp p p p p p p p p p pｳp                ｳ pｳ p p p p p p p p p p p p p p p pｳp p p p p p p p p p p p p p p pｳ2p0p8p.p1p6p3p.p1p0p.p2p p p p pｳp p p p p p p p p p pｳp                ｳ pﾀﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾙp p p p p p p p p p p p p p p pﾀﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾙp p p p p p p p p p pｳp                ｳ p p p p p p pﾚﾄﾄﾄﾄﾄ pCpopnpfpipgpuprpaptpipopnp pfpoprp pIpnptpeprpfpapcpep pepdp0p pﾄﾄﾄﾄﾄﾄﾄｿp p p p p p p p pｳp                ｳ p p p p p p pｳ p pIpPpvp4p pApdpdprpepspsp:p p p p p p p p p p p p pNpeptpmpapspkp:p p p p p p p p p p pｳp p p p p p p p pｳp                ｳ p p p p p p pｳ pﾚﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｿp p p p p p p pﾚﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｿp pｳp p p p p p p p pｳp                ｳ p p p p p p pｳ pｳ1p9p2p.p1p6p8p.p0p.p1p p p p p pｳp p p p p p p pｳ2p5p5p.p2p5p5p.p2p5p5p.p0p p p pｳp pｳp p p p p p p p pｳp                ｳ p p p p p p pｳ pﾀﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾙp p p p p p p pﾀﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾙp pｳp p p p p p p p pｳp                ｳ p p p p p p pｳ p pEpxptprpap poppptpipopnpsp ptpop pipfpcpopnpfpipgp:p p p p p p p p p p p p p p p p p pｳp p p p p p p p pｳp                ｳ p p p p p p pｳ pﾚﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｿp p p p p p p pｳp p p p p p p p pｳp                ｳ p p p p p p pｳ pｳ p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳp p p p p p p pｳp p p p p p p p pｳp                ｳ p p p p p p pｳ pﾀﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾙp p p p p p p pｳp p p p p p p p pｳp                ｳ p p p p p p pﾀﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾙp p p p p p p p pｳp                ｳ p p p p p p p p p p p p p pﾚﾄﾄﾄﾄﾄﾄｿp p p p p p p p p p p p pﾚﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｿp p p p p p p p p p p p p p p p pｳp                ｳ p p p p p p p p p p p p p pｳ p[OK] pｳp p p p p p p p p p p p pｳ p pCtApNpCpEpLp p pｳp p p p p p p p p p p p p p p p pｳp                ｳ p p p p p p p p p p p p p pﾀﾄpﾄpﾄpﾄpﾄpﾄpﾙp p p p p p p p p p p p pﾀﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾙp p p p p p p p p p p p p p p p pｳp                ﾀﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾙp                                                                                         [~ ~S~e~l~e~c~t~ ~t~h~i~s~ ~i~f~ ~y~o~u~ ~a~r~e~ ~h~a~p~p~y~ ~w~i~t~h~ ~t~h~e~s~e~ ~s~e~t~t~i~n~g~s~ ~ ~ ~ ~ ~ ~ ~ ~ ~ ~ ~ ~ ~ ~ ~ ~ ~ ~ ~ ~ ~ ~ ~ ~ ~ ~]~  
\ No newline at end of file
diff --git a/en_US.ISO8859-1/books/handbook/install/fdisk-drive1.scr b/en_US.ISO8859-1/books/handbook/install/fdisk-drive1.scr
new file mode 100644
index 0000000000..3e9c2ea543
--- /dev/null
+++ b/en_US.ISO8859-1/books/handbook/install/fdisk-drive1.scr
@@ -0,0 +1 @@
+SCRSHOT_P                                                                                                                                                                                                                                                                                                                                    ﾚﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄ ~S~e~l~e~c~t~ ~D~r~i~v~e~(~s~)~ ~ﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｿp         ｳ pPplpepapspep pspeplpepcptp ptphpep pdprpipvpep,p poprp pdprpipvpepsp,p popnp pwphpipcphp pypopup pwpipsphp ptpop pppeprpfpoprpmp p p p pｳp         ｳ ptphpipsp popppeprpaptpipopnp.p p pIpfp pypopup paprpep paptptpepmppptpipnpgp ptpop pipnpsptpaplplp pap pbpopoptp pppaprptpiptpipopnp p pｳp         ｳ popnp pap pdprpipvpep poptphpeprp ptphpapnp ptphpep pfpiprpsptp popnpep poprp phpapvpep pmpuplptpippplpep popppeprpaptpipnpgp p p p p p pｳp         ｳ pspypsptpepmpsp popnp pypopuprp pmpapcphpipnpep,p pypopup pwpiplplp phpapvpep ptphpep poppptpipopnp ptpop pipnpsptpaplplp pap pbpopoptp pｳp         ｳ pmpapnpapgpeprp plpaptpeprp.p p pTpop pspeplpepcptp pap pdprpipvpep,p pupspep ptphpep paprprpopwp pkpepypsp ptpop pmpopvpep ptpop piptp pｳp         ｳ papnpdp ppprpepspsp p[pSpPpApCpEp]p.p p pTpop pdpep-pspeplpepcptp piptp,p ppprpepspsp p[pSpPpApCpEp]p papgpapipnp.p p p p p p p p p p p pｳp         ｳ p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳp         ｳ pSpeplpepcptp pOpKp poprp pCpapnpcpeplp ptpop plpepapvpep ptphpipsp pmpepnpup.p p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳp         ｳ pﾚpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpｿ pｳp         ｳ pｳp p p p p p p p p p p p p p p p p p p p p p p p p p p[ ] pad0 p pad0 p p p p p p p p p p p p p p p p p p p p p p p p p p pｳ pｳp         ｳ pｳp p p p p p p p p p p p p p p p p p p p p p p p p p p[p p]p pa|d~2~ p papdp2p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳ pｳp         ｳ pﾀpﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾙ pｳp         ﾃﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｴp         ｳ p p p p p p p p p p p p p p p p p p p p p p p[  OK  ] p p p p p p pCtapnpcpeplp p p p p p p p p p p p p p p p p p p p p p p p p pｳp         ﾀﾄpﾄpﾄp[~ ~P~r~e~s~s~ ~F~1~ ~f~o~r~ ~i~m~p~o~r~t~a~n~t~ ~i~n~f~o~r~m~a~t~i~o~n~ ~r~e~g~a~r~d~i~n~g~ ~d~i~s~k~ ~g~e~o~m~e~t~r~y~!~ ~]~ﾄpﾄpﾄpﾙp                                                                                                                                                                                                                                                                                                                                                                                                                     
\ No newline at end of file
diff --git a/en_US.ISO8859-1/books/handbook/install/fdisk-drive2.scr b/en_US.ISO8859-1/books/handbook/install/fdisk-drive2.scr
new file mode 100644
index 0000000000..a461fc0ca6
--- /dev/null
+++ b/en_US.ISO8859-1/books/handbook/install/fdisk-drive2.scr
@@ -0,0 +1 @@
+SCRSHOT_P                                                                                                                                                                                                                                                                                                                                    ﾚﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄ ~S~e~l~e~c~t~ ~D~r~i~v~e~(~s~)~ ~ﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｿp         ｳ pPplpepapspep pspeplpepcptp ptphpep pdprpipvpep,p poprp pdprpipvpepsp,p popnp pwphpipcphp pypopup pwpipsphp ptpop pppeprpfpoprpmp p p p pｳp         ｳ ptphpipsp popppeprpaptpipopnp.p p pIpfp pypopup paprpep paptptpepmppptpipnpgp ptpop pipnpsptpaplplp pap pbpopoptp pppaprptpiptpipopnp p pｳp         ｳ popnp pap pdprpipvpep poptphpeprp ptphpapnp ptphpep pfpiprpsptp popnpep poprp phpapvpep pmpuplptpippplpep popppeprpaptpipnpgp p p p p p pｳp         ｳ pspypsptpepmpsp popnp pypopuprp pmpapcphpipnpep,p pypopup pwpiplplp phpapvpep ptphpep poppptpipopnp ptpop pipnpsptpaplplp pap pbpopoptp pｳp         ｳ pmpapnpapgpeprp plpaptpeprp.p p pTpop pspeplpepcptp pap pdprpipvpep,p pupspep ptphpep paprprpopwp pkpepypsp ptpop pmpopvpep ptpop piptp pｳp         ｳ papnpdp ppprpepspsp p[pSpPpApCpEp]p.p p pTpop pdpep-pspeplpepcptp piptp,p ppprpepspsp p[pSpPpApCpEp]p papgpapipnp.p p p p p p p p p p p pｳp         ｳ p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳp         ｳ pSpeplpepcptp pOpKp poprp pCpapnpcpeplp ptpop plpepapvpep ptphpipsp pmpepnpup.p p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳp         ｳ pﾚpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpｿ pｳp         ｳ pｳp p p p p p p p p p p p p p p p p p p p p p p p p p p[X] pad0 p pad0 p p p p p p p p p p p p p p p p p p p p p p p p p p pｳ pｳp         ｳ pｳp p p p p p p p p p p p p p p p p p p p p p p p p p p[p p]p pa|d~2~ p papdp2p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳ pｳp         ｳ pﾀpﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾙ pｳp         ﾃﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｴp         ｳ p p p p p p p p p p p p p p p p p p p p p p p[  OK  ] p p p p p p pCtapnpcpeplp p p p p p p p p p p p p p p p p p p p p p p p p pｳp         ﾀﾄpﾄpﾄp[~ ~P~r~e~s~s~ ~F~1~ ~f~o~r~ ~i~m~p~o~r~t~a~n~t~ ~i~n~f~o~r~m~a~t~i~o~n~ ~r~e~g~a~r~d~i~n~g~ ~d~i~s~k~ ~g~e~o~m~e~t~r~y~!~ ~]~ﾄpﾄpﾄpﾙp                                                                                                                                                                                                                                                                                                                                                                                                                     
\ No newline at end of file
diff --git a/en_US.ISO8859-1/books/handbook/install/fdisk-edit1.scr b/en_US.ISO8859-1/books/handbook/install/fdisk-edit1.scr
new file mode 100644
index 0000000000..851d895c33
--- /dev/null
+++ b/en_US.ISO8859-1/books/handbook/install/fdisk-edit1.scr
@@ -0,0 +1 @@
+SCRSHOT_PDisk name:      apdp0p                                    FpDpIpSpKp pPpaprptpiptpipopnp pEpdpiptpoprp   DISK Geometry:  16383 cyls/16 heads/63 sectors = 16514064 sectors (8063MB)                                                                                      Offset       Size(ST)        End     Name  PType       Desc  Subtype    Flags                                                                                            0         63         62        -      6     unused        0                    63    4193217    4193279    ad0s1      2        fat       14    >          4193280       1008    4194287        -      6     unused        0    >          4194288   12319776   16514063    ad0s2      4   extended       15    >                                                                                                                                                                                                                                                                                                                                                                                                                       The following commands are supported (in upper or lower case):                                                                                                  A = Use Entire Disk    G = set Drive Geometry   C = Create Slice                D = Delete Slice       Z = Toggle Size Units    S = Set Bootable                T = Change Type        U = Undo All Changes     Q = Quit                                                                                                                                                                                        Use F1 or ? to get more help, arrow keys to select.                                                                                                                                                                                                                                                                             
\ No newline at end of file
diff --git a/en_US.ISO8859-1/books/handbook/install/fdisk-edit2.scr b/en_US.ISO8859-1/books/handbook/install/fdisk-edit2.scr
new file mode 100644
index 0000000000..a841847954
--- /dev/null
+++ b/en_US.ISO8859-1/books/handbook/install/fdisk-edit2.scr
@@ -0,0 +1 @@
+SCRSHOT_PDisk name:      apdp0p                                    FpDpIpSpKp pPpaprptpiptpipopnp pEpdpiptpoprp   DISK Geometry:  16383 cyls/16 heads/63 sectors = 16514064 sectors (8063MB)                                                                                      Offset       Size(ST)        End     Name  PType       Desc  Subtype    Flags                                                                                            0         63         62        -      6     unused        0                    63   16514001   16514063    ad0s1      3    freebsd      165    CA                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                      The following commands are supported (in upper or lower case):                                                                                                  A = Use Entire Disk    G = set Drive Geometry   C = Create Slice                D = Delete Slice       Z = Toggle Size Units    S = Set Bootable                T = Change Type        U = Undo All Changes     Q = Quit                                                                                                                                                                                        Use F1 or ? to get more help, arrow keys to select.                                                                                                                                                                                                                                                                             
\ No newline at end of file
diff --git a/en_US.ISO8859-1/books/handbook/install/ftp-anon1.scr b/en_US.ISO8859-1/books/handbook/install/ftp-anon1.scr
new file mode 100644
index 0000000000..8cd1fd7132
--- /dev/null
+++ b/en_US.ISO8859-1/books/handbook/install/ftp-anon1.scr
@@ -0,0 +1 @@
+SCRSHOT_P        ﾚﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄ pApnpopnpypmpopupsp pFpTpPp pCpopnpfpipgpuprpaptpipopnp pﾄﾄﾄﾄﾄﾄﾄﾄﾄｿp                ｳ p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳp                ｳ p p pUpIpDp:p p p p p p p p pGprpopuppp:p p p p p p p p p p p p p p pCpopmpmpepnptp:p p p p p p p p p p p p p p p p p p p pｳp                ｳ p pﾚﾄﾄﾄﾄﾄﾄｿp p p p pﾚﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｿp p p p p pﾚﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｿp p p p pｳp                ｳ p pｳ1p4p p p p pｳp p p p pｳopppeprpaptpoprp p p p p pｳp p p p p pｳApnpopnpypmpopupsp pFpTpPp pApdpmpipnp p p pｳp p p p pｳp                ｳ p pﾀﾄpﾄpﾄpﾄpﾄpﾄpﾙp p p p pﾀﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾙp p p p p pﾀﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾙp p p p pｳp                ｳ p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳp                ｳ p p p p p p pﾚﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄ pPpaptphp pCpopnpfpipgpuprpaptpipopnp pﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｿp p p p p p p p pｳp                ｳ p p p p p p pｳ p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳp p p p p p p p pｳp                ｳ p p p p p p pｳ p pFpTpPp pRpopoptp pDpiprpepcptpoprpyp:p p p p p p p p p p p p p p p p p p p p p p p p pｳp p p p p p p p pｳp                ｳ p p p p p p pｳ pﾚﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｿp pｳp p p p p p p p pｳp                ｳ p p p p p p pｳ pｳ/pvpaprp/pfptppp p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳp pｳp p p p p p p p pｳp                ｳ p p p p p p pｳ pﾀﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾙp pｳp p p p p p p p pｳp                ｳ p p p p p p pｳ p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳp p p p p p p p pｳp                ｳ p p p p p p pｳ p p p p p p p p p p p pUppplpopapdp pSpupbpdpiprpepcptpoprpyp:p p p p p p p p p p p p p pｳp p p p p p p p pｳp                ｳ p p p p p p pｳ p p p p p p p p p p pﾚﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｿp p p p p p p p p p p p pｳp p p p p p p p pｳp                ｳ p p p p p p pｳ p p p p p p p p p p pｳipnpcpopmpipnpgp p p p p p p p p p p p pｳp p p p p p p p p p p p pｳp p p p p p p p pｳp                ｳ p p p p p p pｳ p p p p p p p p p p pﾀﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾙp p p p p p p p p p p p pｳp p p p p p p p pｳp                ｳ p p p p p p pﾀﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾙp p p p p p p p pｳp                ｳ p p p p p p p p p p p p p pﾚﾄﾄﾄﾄﾄﾄｿp p p p p p p p p p p p pﾚﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｿp p p p p p p p p p p p p p p p pｳp                ｳ p p p p p p p p p p p p p pｳ p pOtKp p pｳp p p p p p p p p p p p pｳ p pCtApNpCpEpLp p pｳp p p p p p p p p p p p p p p p pｳp                ｳ p p p p p p p p p p p p p pﾀﾄpﾄpﾄpﾄpﾄpﾄpﾙp p p p p p p p p p p p pﾀﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾙp p p p p p p p p p p p p p p p pｳp                ﾀﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾙp                                                                                         [~ ~W~h~a~t~ ~u~s~e~r~ ~I~D~ ~t~o~ ~a~s~s~i~g~n~ ~t~o~ ~F~T~P~ ~A~d~m~i~n~ ~ ~ ~ ~ ~ ~ ~ ~ ~ ~ ~ ~ ~ ~ ~ ~ ~ ~ ~ ~ ~ ~ ~ ~ ~ ~ ~ ~ ~ ~ ~ ~ ~ ~ ~ ~ ~ ~ ~]~  
\ No newline at end of file
diff --git a/en_US.ISO8859-1/books/handbook/install/ftp-anon2.scr b/en_US.ISO8859-1/books/handbook/install/ftp-anon2.scr
new file mode 100644
index 0000000000..9ac2f0c2c8
--- /dev/null
+++ b/en_US.ISO8859-1/books/handbook/install/ftp-anon2.scr
@@ -0,0 +1 @@
+SCRSHOT_P^[ (escape) menu ^y search prompt ^k delete line    ^p prev line  ^g prev page  ^o ascii code    ^x search        ^l undelete line  ^n next line  ^v next page  ^u end of file   ^a begin of line ^w delete word    ^b back char  ^z next word  ^t begin of file ^e end of line   ^r restore word   ^f forward char             ^c command       ^d delete char   ^j undelete char              ESC-Enter: exit =p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p Your welcome message here.                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                      file "/var/ftp/etc/ftpmotd", 1 lines, read only                                 
\ No newline at end of file
diff --git a/en_US.ISO8859-1/books/handbook/install/hdwrconf.scr b/en_US.ISO8859-1/books/handbook/install/hdwrconf.scr
new file mode 100644
index 0000000000..8bf474299c
--- /dev/null
+++ b/en_US.ISO8859-1/books/handbook/install/hdwrconf.scr
@@ -0,0 +1 @@
+SCRSHOT_P---Active-Drivers----------------------------7p pcpopnpfplpipcptpsp-p------Dev---IRQ--Port--  Sptpoprpapgpep p:p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p   AdvanSys SCSI narrow controller                            adv0                 Adaptec 154x SCSI controller                               aha0                 Adaptec 152x SCSI and compatible sound cards               aic0                 ATA/ATAPI compatible disk controller                       ata0     14 0x1f0    ATA/ATAPI compatible disk controller                       ata1     15 0x170    Buslogic SCSI controller                                   bt0                  Floppy disk controller                                     fdc0     6  0x3f0 ---Inactive-Drivers--------------------------------------------Dev--------------  Storage :                                                                       Network :                                                                       Communications :   (Collapsed)                                                  Input :                                                                         Multimedia :                                                                    Miscellaneous :    (Collapsed)                                                                                                                                --------------------------------------------------------------------------------                                                                                                                                                                                                                                                --------------------------------------------------------------------------------  [Enter] Collapse device list    [C]    Collapse all lists                       [TAB]   Change fields           [Q]   Save and Exit             [?] Help                                                                                      
\ No newline at end of file
diff --git a/en_US.ISO8859-1/books/handbook/install/keymap.scr b/en_US.ISO8859-1/books/handbook/install/keymap.scr
new file mode 100644
index 0000000000..059049600b
--- /dev/null
+++ b/en_US.ISO8859-1/books/handbook/install/keymap.scr
@@ -0,0 +1 @@
+SCRSHOT_P                                                                                 ﾚﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄ ~S~y~s~t~e~m~ ~C~o~n~s~o~l~e~ ~K~e~y~m~a~p~ ~ﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｿp   ｳ pTphpep pdpepfpapuplptp pspypsptpepmp pcpopnpspoplpep pdprpipvpeprp pfpoprp pFprpepepBpSpDp p(pspypspcpopnpsp)p pdpepfpapuplptpsp p p p p p p p p p pｳp   ｳ ptpop pap psptpapnpdpaprpdp p"pApmpeprpipcpapnp"p pkpepypbpopaprpdp pmpappp.p p pUpspeprpsp pipnp poptphpeprp pcpopupnptprpipepsp p p p p p p p p p pｳp   ｳ p(poprp pwpiptphp pdpipfpfpeprpepnptp pkpepypbpopaprpdp ppprpepfpeprpepnpcpepsp)p pmpapyp pwpipsphp ptpop pcphpopopspep popnpep popfp p p p p p p p pｳp   ｳ ptphpep poptphpeprp pkpepypmpapppsp pbpeplpopwp.p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳp   ｳ pNpoptpep ptphpaptp pspypspipnpsptpaplplp piptpspeplpfp popnplpyp pupspepsp ptphpep pppaprptp popfp ptphpep pkpepypbpopaprpdp pmpappp p p p p p p p pｳp   ｳ pwphpipcphp pipsp prpepqpupiprpepdp ptpop pgpepnpeprpaptpep ptphpep pApNpSpIp pcphpaprpapcptpeprp pspupbpspeptp,p pbpuptp pypopuprp p p p p p p p p pｳp   ｳ pcphpopipcpep popfp pkpepypmpappp pwpiplplp paplpspop pbpep pspapvpepdp pfpoprp plpaptpeprp p(pfpuplplpeprp)p pupspep.p p p p p p p p p p p p p p p pｳp   ｳ pﾚpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpｿ pｳp   ｳ pｳp p( ) pBelgian p p p p p p p p p p p p p p p p p p p p pBelgian ISO keymap p p p p p p p p p p p p p p p p p p p pｳ pｳp   ｳ pｳp p(p p)p p |B~r~a~z~i~l~ ~C~P~8~5~0~ p p p p p p p p p p p p p p pBprpapzpiplp pCpPp8p5p0p pkpepypmpappp p p p p p p p p p p p p p p p p p p pｳ pｳp   ｳ pｳp p(p p)p p |B~r~a~z~i~l~ ~I~S~O~ ~(~a~c~c~e~n~t~)~ p p p p p p p pBprpapzpiplp pIpSpOp pkpepypmpappp p(papcpcpepnptp pkpepypsp)p p p p p p p pｳ pｳp   ｳ pｳp p(p p)p p |B~r~a~z~i~l~ ~I~S~O~ p p p p p p p p p p p p p p p p pBprpapzpiplp pIpSpOp pkpepypmpappp p p p p p p p p p p p p p p p p p p p p pｳ pｳp   ｳ pｳp p(p p)p p |C~r~o~a~t~i~a~n~ ~I~S~O~ p p p p p p p p p p p p p p pCprpopaptpipapnp pIpSpOp pkpepypmpappp p p p p p p p p p p p p p p p p p p pｳ pｳp   ｳ pｳp p(p p)p pD|a~n~i~s~h~ ~C~P~8~6~5~ p p p p p p p p p p p p p p p pDpapnpipsphp pCpopdpep pPpapgpep p8p6p5p pkpepypmpappp p p p p p p p p p p pｳ pｳp   ｳ pｳp p(p p)p p |D~a~n~i~s~h~ ~I~S~O~ p p p p p p p p p p p p p p p p pDpapnpipsphp pIpSpOp pkpepypmpappp p p p p p p p p p p p p p p p p p p p p pｳ pｳp   ｳ pｳp p(p p)p pE|s~t~o~n~i~a~n~ ~I~S~O~ p p p p p p p p p p p p p p p pEpsptpopnpipapnp pIpSpOp pkpepypmpappp p p p p p p p p p p p p p p p p p p pｳ pｳp   ｳ pｳp p(p p)p p |E~s~t~o~n~i~a~n~ ~I~S~O~ ~1~5~ p p p p p p p p p p p pEpsptpopnpipapnp pIpSpOp p8p8p5p9p-p1p5p pkpepypmpappp p p p p p p p p p p pｳ pｳp   ｳ pﾀpﾄﾄﾄﾄﾄz(z+z)zﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾙ pｳp   ﾃﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｴp   ｳ p p p p p p p p p p p p p p p p p p p p p p p p p p[  OK  ] p p p p p p pCtapnpcpeplp p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳp   ﾀﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄp[~ ~C~h~o~o~s~e~ ~a~ ~k~e~y~b~o~a~r~d~ ~m~a~p~ ~]~ﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾙp                                                                                                                                                                  
\ No newline at end of file
diff --git a/en_US.ISO8859-1/books/handbook/install/main-doc.scr b/en_US.ISO8859-1/books/handbook/install/main-doc.scr
new file mode 100644
index 0000000000..5140d84762
--- /dev/null
+++ b/en_US.ISO8859-1/books/handbook/install/main-doc.scr
@@ -0,0 +1 @@
+SCRSHOT_P                                                                                   ﾚﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄ ~/~s~t~a~n~d~/~s~y~s~i~n~s~t~a~l~l~ ~M~a~i~n~ ~M~e~n~u~ ~ﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｿp       ｳ pWpeplpcpopmpep ptpop ptphpep pFprpepepBpSpDp pipnpsptpaplplpaptpipopnp papnpdp pcpopnpfpipgpuprpaptpipopnp ptpopoplp.p p pPplpepapspep p p pｳp       ｳ pspeplpepcptp popnpep popfp ptphpep poppptpipopnpsp pbpeplpopwp pbpyp pupspipnpgp ptphpep paprprpopwp pkpepypsp poprp ptpypppipnpgp ptphpep pｳp       ｳ pfpiprpsptp pcphpaprpapcptpeprp popfp ptphpep poppptpipopnp pnpapmpep pypopup'prpep pipnptpeprpepsptpepdp pipnp.p p pIpnpvpopkpep papnp p p pｳp       ｳ poppptpipopnp pbpyp ppprpepspspipnpgp p[pEpNpTpEpRp]p poprp p[pTpApBp-pEpNpTpEpRp]p ptpop pepxpiptp ptphpep pipnpsptpaplplpaptpipopnp.p p p pｳp       ｳ pﾚpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpｿ pｳp       ｳ pｳp p p |U~s~a~g~e~ p p p p p p pQpupipcpkp psptpaprptp p-p pHpopwp ptpop pupspep ptphpipsp pmpepnpup pspypsptpepmp p p p p p p p p p p pｳ pｳp       ｳ pｳp p pS|t~a~n~d~a~r~d~ p p p p pBpepgpipnp pap psptpapnpdpaprpdp pipnpsptpaplplpaptpipopnp p(prpepcpopmpmpepnpdpepdp)p p p p p p p p p pｳ pｳp       ｳ pｳp p pE|x~p~r~e~s~s~ p p p p p pBpepgpipnp pap pqpupipcpkp pipnpsptpaplplpaptpipopnp p(pfpoprp ptphpep pipmpppaptpipepnptp)p p p p p p pｳ pｳp       ｳ pｳp p p |C~u~s~t~o~m~ p p p p p pBpepgpipnp pap pcpupsptpopmp pipnpsptpaplplpaptpipopnp p(pfpoprp pepxpppeprptpsp)p p p p p p p p p p p pｳ pｳp       ｳ pｳp p pC|o~n~f~i~g~u~r~e~ p p p pDpop pppopsptp-pipnpsptpaplplp pcpopnpfpipgpuprpaptpipopnp popfp pFprpepepBpSpDp p p p p p p p p p p p pｳ pｳp       ｳ pｳp p pDoc p p p p p p p p p pInstallation instructions, README, etc. p p p p p p p p p p p p pｳ pｳp       ｳ pｳp p pK|e~y~m~a~p~ p p p p p p pSpeplpepcptp pkpepypbpopaprpdp ptpypppep p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳ pｳp       ｳ pｳp p pO|p~t~i~o~n~s~ p p p p p pVpipepwp/pSpeptp pvpaprpipopupsp pipnpsptpaplplpaptpipopnp poppptpipopnpsp p p p p p p p p p p p p p p pｳ pｳp       ｳ pｳp p pF|i~x~i~t~ p p p p p p p pEpnptpeprp prpepppapiprp pmpopdpep pwpiptphp pCpDpRpOpMp/pfplpopppppyp poprp psptpaprptp psphpeplplp p pｳ pｳp       ｳ pｳp p pU|p~g~r~a~d~e~ p p p p p pUpppgprpapdpep papnp pepxpipsptpipnpgp pspypsptpepmp p p p p p p p p p p p p p p p p p p p p p p p p p pｳ pｳp       ｳ pｳp p pL|o~a~d~ ~C~o~n~f~i~g~ p pLpopapdp pdpepfpapuplptp pipnpsptpaplplp pcpopnpfpipgpuprpaptpipopnp p p p p p p p p p p p p p p p p p pｳ pｳp       ｳ pｳp p pI|n~d~e~x~ p p p p p p p pGplpopspspaprpyp popfp pfpupnpcptpipopnpsp p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳ pｳp       ｳ pﾀpﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾙ pｳp       ﾃﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｴp       ｳ p p p p p p p p p p p p p p p p p p p p p p p p[Select] p p p pXt pEpxpiptp pIpnpsptpaplplp p p p p p p p p p p p p p p p p p p p p pｳp       ﾀﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄp[~ ~P~r~e~s~s~ ~F~1~ ~f~o~r~ ~I~n~s~t~a~l~l~a~t~i~o~n~ ~G~u~i~d~e~ ~]~ﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾙp                                                                                                                                                                    
\ No newline at end of file
diff --git a/en_US.ISO8859-1/books/handbook/install/main-keymap.scr b/en_US.ISO8859-1/books/handbook/install/main-keymap.scr
new file mode 100644
index 0000000000..1a9dbeba2e
--- /dev/null
+++ b/en_US.ISO8859-1/books/handbook/install/main-keymap.scr
@@ -0,0 +1 @@
+SCRSHOT_P                                                                                   ﾚﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄ ~/~s~t~a~n~d~/~s~y~s~i~n~s~t~a~l~l~ ~M~a~i~n~ ~M~e~n~u~ ~ﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｿp       ｳ pWpeplpcpopmpep ptpop ptphpep pFprpepepBpSpDp pipnpsptpaplplpaptpipopnp papnpdp pcpopnpfpipgpuprpaptpipopnp ptpopoplp.p p pPplpepapspep p p pｳp       ｳ pspeplpepcptp popnpep popfp ptphpep poppptpipopnpsp pbpeplpopwp pbpyp pupspipnpgp ptphpep paprprpopwp pkpepypsp poprp ptpypppipnpgp ptphpep pｳp       ｳ pfpiprpsptp pcphpaprpapcptpeprp popfp ptphpep poppptpipopnp pnpapmpep pypopup'prpep pipnptpeprpepsptpepdp pipnp.p p pIpnpvpopkpep papnp p p pｳp       ｳ poppptpipopnp pbpyp ppprpepspspipnpgp p[pEpNpTpEpRp]p poprp p[pTpApBp-pEpNpTpEpRp]p ptpop pepxpiptp ptphpep pipnpsptpaplplpaptpipopnp.p p p pｳp       ｳ pﾚpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpｿ pｳp       ｳ pｳp p p |U~s~a~g~e~ p p p p p p pQpupipcpkp psptpaprptp p-p pHpopwp ptpop pupspep ptphpipsp pmpepnpup pspypsptpepmp p p p p p p p p p p pｳ pｳp       ｳ pｳp p pS|t~a~n~d~a~r~d~ p p p p pBpepgpipnp pap psptpapnpdpaprpdp pipnpsptpaplplpaptpipopnp p(prpepcpopmpmpepnpdpepdp)p p p p p p p p p pｳ pｳp       ｳ pｳp p pE|x~p~r~e~s~s~ p p p p p pBpepgpipnp pap pqpupipcpkp pipnpsptpaplplpaptpipopnp p(pfpoprp ptphpep pipmpppaptpipepnptp)p p p p p p pｳ pｳp       ｳ pｳp p p |C~u~s~t~o~m~ p p p p p pBpepgpipnp pap pcpupsptpopmp pipnpsptpaplplpaptpipopnp p(pfpoprp pepxpppeprptpsp)p p p p p p p p p p p pｳ pｳp       ｳ pｳp p pC|o~n~f~i~g~u~r~e~ p p p pDpop pppopsptp-pipnpsptpaplplp pcpopnpfpipgpuprpaptpipopnp popfp pFprpepepBpSpDp p p p p p p p p p p p pｳ pｳp       ｳ pｳp p pD|o~c~ p p p p p p p p p pIpnpsptpaplplpaptpipopnp pipnpsptprpupcptpipopnpsp,p pRpEpApDpMpEp,p peptpcp.p p p p p p p p p p p p p pｳ pｳp       ｳ pｳp p pKeymap p p p p p p pSelect keyboard type p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳ pｳp       ｳ pｳp p pO|p~t~i~o~n~s~ p p p p p pVpipepwp/pSpeptp pvpaprpipopupsp pipnpsptpaplplpaptpipopnp poppptpipopnpsp p p p p p p p p p p p p p p pｳ pｳp       ｳ pｳp p pF|i~x~i~t~ p p p p p p p pEpnptpeprp prpepppapiprp pmpopdpep pwpiptphp pCpDpRpOpMp/pfplpopppppyp poprp psptpaprptp psphpeplplp p pｳ pｳp       ｳ pｳp p pU|p~g~r~a~d~e~ p p p p p pUpppgprpapdpep papnp pepxpipsptpipnpgp pspypsptpepmp p p p p p p p p p p p p p p p p p p p p p p p p p pｳ pｳp       ｳ pｳp p pL|o~a~d~ ~C~o~n~f~i~g~ p pLpopapdp pdpepfpapuplptp pipnpsptpaplplp pcpopnpfpipgpuprpaptpipopnp p p p p p p p p p p p p p p p p p pｳ pｳp       ｳ pｳp p pI|n~d~e~x~ p p p p p p p pGplpopspspaprpyp popfp pfpupnpcptpipopnpsp p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳ pｳp       ｳ pﾀpﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾙ pｳp       ﾃﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｴp       ｳ p p p p p p p p p p p p p p p p p p p p p p p p[Select] p p p pXt pEpxpiptp pIpnpsptpaplplp p p p p p p p p p p p p p p p p p p p p pｳp       ﾀﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄp[~ ~P~r~e~s~s~ ~F~1~ ~f~o~r~ ~I~n~s~t~a~l~l~a~t~i~o~n~ ~G~u~i~d~e~ ~]~ﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾙp                                                                                                                                                                    
\ No newline at end of file
diff --git a/en_US.ISO8859-1/books/handbook/install/main-options.scr b/en_US.ISO8859-1/books/handbook/install/main-options.scr
new file mode 100644
index 0000000000..89bd1b290a
--- /dev/null
+++ b/en_US.ISO8859-1/books/handbook/install/main-options.scr
@@ -0,0 +1 @@
+SCRSHOT_P                                                                                   ﾚﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄ ~/~s~t~a~n~d~/~s~y~s~i~n~s~t~a~l~l~ ~M~a~i~n~ ~M~e~n~u~ ~ﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｿp       ｳ pWpeplpcpopmpep ptpop ptphpep pFprpepepBpSpDp pipnpsptpaplplpaptpipopnp papnpdp pcpopnpfpipgpuprpaptpipopnp ptpopoplp.p p pPplpepapspep p p pｳp       ｳ pspeplpepcptp popnpep popfp ptphpep poppptpipopnpsp pbpeplpopwp pbpyp pupspipnpgp ptphpep paprprpopwp pkpepypsp poprp ptpypppipnpgp ptphpep pｳp       ｳ pfpiprpsptp pcphpaprpapcptpeprp popfp ptphpep poppptpipopnp pnpapmpep pypopup'prpep pipnptpeprpepsptpepdp pipnp.p p pIpnpvpopkpep papnp p p pｳp       ｳ poppptpipopnp pbpyp ppprpepspspipnpgp p[pEpNpTpEpRp]p poprp p[pTpApBp-pEpNpTpEpRp]p ptpop pepxpiptp ptphpep pipnpsptpaplplpaptpipopnp.p p p pｳp       ｳ pﾚpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpｿ pｳp       ｳ pｳp p p |U~s~a~g~e~ p p p p p p pQpupipcpkp psptpaprptp p-p pHpopwp ptpop pupspep ptphpipsp pmpepnpup pspypsptpepmp p p p p p p p p p p pｳ pｳp       ｳ pｳp p pS|t~a~n~d~a~r~d~ p p p p pBpepgpipnp pap psptpapnpdpaprpdp pipnpsptpaplplpaptpipopnp p(prpepcpopmpmpepnpdpepdp)p p p p p p p p p pｳ pｳp       ｳ pｳp p pE|x~p~r~e~s~s~ p p p p p pBpepgpipnp pap pqpupipcpkp pipnpsptpaplplpaptpipopnp p(pfpoprp ptphpep pipmpppaptpipepnptp)p p p p p p pｳ pｳp       ｳ pｳp p p |C~u~s~t~o~m~ p p p p p pBpepgpipnp pap pcpupsptpopmp pipnpsptpaplplpaptpipopnp p(pfpoprp pepxpppeprptpsp)p p p p p p p p p p p pｳ pｳp       ｳ pｳp p pC|o~n~f~i~g~u~r~e~ p p p pDpop pppopsptp-pipnpsptpaplplp pcpopnpfpipgpuprpaptpipopnp popfp pFprpepepBpSpDp p p p p p p p p p p p pｳ pｳp       ｳ pｳp p pD|o~c~ p p p p p p p p p pIpnpsptpaplplpaptpipopnp pipnpsptprpupcptpipopnpsp,p pRpEpApDpMpEp,p peptpcp.p p p p p p p p p p p p p pｳ pｳp       ｳ pｳp p pK|e~y~m~a~p~ p p p p p p pSpeplpepcptp pkpepypbpopaprpdp ptpypppep p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳ pｳp       ｳ pｳp p pOptions p p p p p pView/Set various installation options p p p p p p p p p p p p p p pｳ pｳp       ｳ pｳp p pF|i~x~i~t~ p p p p p p p pEpnptpeprp prpepppapiprp pmpopdpep pwpiptphp pCpDpRpOpMp/pfplpopppppyp poprp psptpaprptp psphpeplplp p pｳ pｳp       ｳ pｳp p pU|p~g~r~a~d~e~ p p p p p pUpppgprpapdpep papnp pepxpipsptpipnpgp pspypsptpepmp p p p p p p p p p p p p p p p p p p p p p p p p p pｳ pｳp       ｳ pｳp p pL|o~a~d~ ~C~o~n~f~i~g~ p pLpopapdp pdpepfpapuplptp pipnpsptpaplplp pcpopnpfpipgpuprpaptpipopnp p p p p p p p p p p p p p p p p p pｳ pｳp       ｳ pｳp p pI|n~d~e~x~ p p p p p p p pGplpopspspaprpyp popfp pfpupnpcptpipopnpsp p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳ pｳp       ｳ pﾀpﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾙ pｳp       ﾃﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｴp       ｳ p p p p p p p p p p p p p p p p p p p p p p p p[Select] p p p pXt pEpxpiptp pIpnpsptpaplplp p p p p p p p p p p p p p p p p p p p p pｳp       ﾀﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄp[~ ~P~r~e~s~s~ ~F~1~ ~f~o~r~ ~I~n~s~t~a~l~l~a~t~i~o~n~ ~G~u~i~d~e~ ~]~ﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾙp                                                                                                                                                                    
\ No newline at end of file
diff --git a/en_US.ISO8859-1/books/handbook/install/main-std.scr b/en_US.ISO8859-1/books/handbook/install/main-std.scr
new file mode 100644
index 0000000000..3ac1801fa8
--- /dev/null
+++ b/en_US.ISO8859-1/books/handbook/install/main-std.scr
@@ -0,0 +1 @@
+SCRSHOT_P                                                                                   ﾚﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄ ~/~s~t~a~n~d~/~s~y~s~i~n~s~t~a~l~l~ ~M~a~i~n~ ~M~e~n~u~ ~ﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｿp       ｳ pWpeplpcpopmpep ptpop ptphpep pFprpepepBpSpDp pipnpsptpaplplpaptpipopnp papnpdp pcpopnpfpipgpuprpaptpipopnp ptpopoplp.p p pPplpepapspep p p pｳp       ｳ pspeplpepcptp popnpep popfp ptphpep poppptpipopnpsp pbpeplpopwp pbpyp pupspipnpgp ptphpep paprprpopwp pkpepypsp poprp ptpypppipnpgp ptphpep pｳp       ｳ pfpiprpsptp pcphpaprpapcptpeprp popfp ptphpep poppptpipopnp pnpapmpep pypopup'prpep pipnptpeprpepsptpepdp pipnp.p p pIpnpvpopkpep papnp p p pｳp       ｳ poppptpipopnp pbpyp ppprpepspspipnpgp p[pEpNpTpEpRp]p poprp p[pTpApBp-pEpNpTpEpRp]p ptpop pepxpiptp ptphpep pipnpsptpaplplpaptpipopnp.p p p pｳp       ｳ pﾚpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpｿ pｳp       ｳ pｳp p p |U~s~a~g~e~ p p p p p p pQpupipcpkp psptpaprptp p-p pHpopwp ptpop pupspep ptphpipsp pmpepnpup pspypsptpepmp p p p p p p p p p p pｳ pｳp       ｳ pｳp p pStandard p p p p pBegin a standard installation (recommended) p p p p p p p p pｳ pｳp       ｳ pｳp p pE|x~p~r~e~s~s~ p p p p p pBpepgpipnp pap pqpupipcpkp pipnpsptpaplplpaptpipopnp p(pfpoprp ptphpep pipmpppaptpipepnptp)p p p p p p pｳ pｳp       ｳ pｳp p p |C~u~s~t~o~m~ p p p p p pBpepgpipnp pap pcpupsptpopmp pipnpsptpaplplpaptpipopnp p(pfpoprp pepxpppeprptpsp)p p p p p p p p p p p pｳ pｳp       ｳ pｳp p pC|o~n~f~i~g~u~r~e~ p p p pDpop pppopsptp-pipnpsptpaplplp pcpopnpfpipgpuprpaptpipopnp popfp pFprpepepBpSpDp p p p p p p p p p p p pｳ pｳp       ｳ pｳp p pD|o~c~ p p p p p p p p p pIpnpsptpaplplpaptpipopnp pipnpsptprpupcptpipopnpsp,p pRpEpApDpMpEp,p peptpcp.p p p p p p p p p p p p p pｳ pｳp       ｳ pｳp p pK|e~y~m~a~p~ p p p p p p pSpeplpepcptp pkpepypbpopaprpdp ptpypppep p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳ pｳp       ｳ pｳp p pO|p~t~i~o~n~s~ p p p p p pVpipepwp/pSpeptp pvpaprpipopupsp pipnpsptpaplplpaptpipopnp poppptpipopnpsp p p p p p p p p p p p p p p pｳ pｳp       ｳ pｳp p pF|i~x~i~t~ p p p p p p p pEpnptpeprp prpepppapiprp pmpopdpep pwpiptphp pCpDpRpOpMp/pfplpopppppyp poprp psptpaprptp psphpeplplp p pｳ pｳp       ｳ pｳp p pU|p~g~r~a~d~e~ p p p p p pUpppgprpapdpep papnp pepxpipsptpipnpgp pspypsptpepmp p p p p p p p p p p p p p p p p p p p p p p p p p pｳ pｳp       ｳ pｳp p pL|o~a~d~ ~C~o~n~f~i~g~ p pLpopapdp pdpepfpapuplptp pipnpsptpaplplp pcpopnpfpipgpuprpaptpipopnp p p p p p p p p p p p p p p p p p pｳ pｳp       ｳ pｳp p pI|n~d~e~x~ p p p p p p p pGplpopspspaprpyp popfp pfpupnpcptpipopnpsp p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳ pｳp       ｳ pﾀpﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾙ pｳp       ﾃﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｴp       ｳ p p p p p p p p p p p p p p p p p p p p p p p p[Select] p p p pXt pEpxpiptp pIpnpsptpaplplp p p p p p p p p p p p p p p p p p p p p pｳp       ﾀﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄp[~ ~P~r~e~s~s~ ~F~1~ ~f~o~r~ ~I~n~s~t~a~l~l~a~t~i~o~n~ ~G~u~i~d~e~ ~]~ﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾙp                                                                                                                                                                    
\ No newline at end of file
diff --git a/en_US.ISO8859-1/books/handbook/install/main1.scr b/en_US.ISO8859-1/books/handbook/install/main1.scr
new file mode 100644
index 0000000000..1a85390e50
--- /dev/null
+++ b/en_US.ISO8859-1/books/handbook/install/main1.scr
@@ -0,0 +1 @@
+SCRSHOT_P                                                                                   ﾚﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄ ~/~s~t~a~n~d~/~s~y~s~i~n~s~t~a~l~l~ ~M~a~i~n~ ~M~e~n~u~ ~ﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｿp       ｳ pWpeplpcpopmpep ptpop ptphpep pFprpepepBpSpDp pipnpsptpaplplpaptpipopnp papnpdp pcpopnpfpipgpuprpaptpipopnp ptpopoplp.p p pPplpepapspep p p pｳp       ｳ pspeplpepcptp popnpep popfp ptphpep poppptpipopnpsp pbpeplpopwp pbpyp pupspipnpgp ptphpep paprprpopwp pkpepypsp poprp ptpypppipnpgp ptphpep pｳp       ｳ pfpiprpsptp pcphpaprpapcptpeprp popfp ptphpep poppptpipopnp pnpapmpep pypopup'prpep pipnptpeprpepsptpepdp pipnp.p p pIpnpvpopkpep papnp p p pｳp       ｳ poppptpipopnp pbpyp ppprpepspspipnpgp p[pEpNpTpEpRp]p poprp p[pTpApBp-pEpNpTpEpRp]p ptpop pepxpiptp ptphpep pipnpsptpaplplpaptpipopnp.p p p pｳp       ｳ pﾚpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpｿ pｳp       ｳ pｳp p p Usage p p p p p p pQuick start - How to use this menu system p p p p p p p p p p pｳ pｳp       ｳ pｳp p pS|t~a~n~d~a~r~d~ p p p p pBpepgpipnp pap psptpapnpdpaprpdp pipnpsptpaplplpaptpipopnp p(prpepcpopmpmpepnpdpepdp)p p p p p p p p p pｳ pｳp       ｳ pｳp p pE|x~p~r~e~s~s~ p p p p p pBpepgpipnp pap pqpupipcpkp pipnpsptpaplplpaptpipopnp p(pfpoprp ptphpep pipmpppaptpipepnptp)p p p p p p pｳ pｳp       ｳ pｳp p p |C~u~s~t~o~m~ p p p p p pBpepgpipnp pap pcpupsptpopmp pipnpsptpaplplpaptpipopnp p(pfpoprp pepxpppeprptpsp)p p p p p p p p p p p pｳ pｳp       ｳ pｳp p pC|o~n~f~i~g~u~r~e~ p p p pDpop pppopsptp-pipnpsptpaplplp pcpopnpfpipgpuprpaptpipopnp popfp pFprpepepBpSpDp p p p p p p p p p p p pｳ pｳp       ｳ pｳp p pD|o~c~ p p p p p p p p p pIpnpsptpaplplpaptpipopnp pipnpsptprpupcptpipopnpsp,p pRpEpApDpMpEp,p peptpcp.p p p p p p p p p p p p p pｳ pｳp       ｳ pｳp p pK|e~y~m~a~p~ p p p p p p pSpeplpepcptp pkpepypbpopaprpdp ptpypppep p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳ pｳp       ｳ pｳp p pO|p~t~i~o~n~s~ p p p p p pVpipepwp/pSpeptp pvpaprpipopupsp pipnpsptpaplplpaptpipopnp poppptpipopnpsp p p p p p p p p p p p p p p pｳ pｳp       ｳ pｳp p pF|i~x~i~t~ p p p p p p p pEpnptpeprp prpepppapiprp pmpopdpep pwpiptphp pCpDpRpOpMp/pfplpopppppyp poprp psptpaprptp psphpeplplp p pｳ pｳp       ｳ pｳp p pU|p~g~r~a~d~e~ p p p p p pUpppgprpapdpep papnp pepxpipsptpipnpgp pspypsptpepmp p p p p p p p p p p p p p p p p p p p p p p p p p pｳ pｳp       ｳ pｳp p pL|o~a~d~ ~C~o~n~f~i~g~ p pLpopapdp pdpepfpapuplptp pipnpsptpaplplp pcpopnpfpipgpuprpaptpipopnp p p p p p p p p p p p p p p p p p pｳ pｳp       ｳ pｳp p pI|n~d~e~x~ p p p p p p p pGplpopspspaprpyp popfp pfpupnpcptpipopnpsp p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳ pｳp       ｳ pﾀpﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾙ pｳp       ﾃﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｴp       ｳ p p p p p p p p p p p p p p p p p p p p p p p p[Select] p p p pXt pEpxpiptp pIpnpsptpaplplp p p p p p p p p p p p p p p p p p p p p pｳp       ﾀﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄp[~ ~P~r~e~s~s~ ~F~1~ ~f~o~r~ ~I~n~s~t~a~l~l~a~t~i~o~n~ ~G~u~i~d~e~ ~]~ﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾙp                                                                                                                                                                    
\ No newline at end of file
diff --git a/en_US.ISO8859-1/books/handbook/install/mainexit.scr b/en_US.ISO8859-1/books/handbook/install/mainexit.scr
new file mode 100644
index 0000000000..ad20b6b603
--- /dev/null
+++ b/en_US.ISO8859-1/books/handbook/install/mainexit.scr
@@ -0,0 +1 @@
+SCRSHOT_P                                                                                   ﾚﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄ ~/~s~t~a~n~d~/~s~y~s~i~n~s~t~a~l~l~ ~M~a~i~n~ ~M~e~n~u~ ~ﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｿp       ｳ pWpeplpcpopmpep ptpop ptphpep pFprpepepBpSpDp pipnpsptpaplplpaptpipopnp papnpdp pcpopnpfpipgpuprpaptpipopnp ptpopoplp.p p pPplpepapspep p p pｳp       ｳ pspeplpepcptp popnpep popfp ptphpep poppptpipopnpsp pbpeplpopwp pbpyp pupspipnpgp ptphpep paprprpopwp pkpepypsp poprp ptpypppipnpgp ptphpep pｳp       ｳ pfpiprpsptp pcphpaprpapcptpeprp popfp ptphpep poppptpipopnp pnpapmpep pypopup'prpep pipnptpeprpepsptpepdp pipnp.p p pIpnpvpopkpep papnp p p pｳp       ｳ poppptpipopnp pbpyp ppprpepspspipnpgp p[pEpNpTpEpRp]p poprp p[pTpApBp-pEpNpTpEpRp]p ptpop pepxpiptp ptphpep pipnpsptpaplplpaptpipopnp.p p p pｳp       ｳ pﾚpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpｿ pｳp       ｳ pｳp p p |U~s~a~g~e~ p p p p p p pQpupipcpkp psptpaprptp p-p pHpopwp ptpop pupspep ptphpipsp pmpepnpup pspypsptpepmp p p p p p p p p p p pｳ pｳp       ｳ pｳp p pStandard p p p p pBegin a standard installation (recommended) p p p p p p p p pｳ pｳp       ｳ pｳp p pE|x~p~r~e~s~s~ p p p p p pBpepgpipnp pap pqpupipcpkp pipnpsptpaplplpaptpipopnp p(pfpoprp ptphpep pipmpppaptpipepnptp)p p p p p p pｳ pｳp       ｳ pｳp p p |C~u~s~t~o~m~ p p p p p pBpepgpipnp pap pcpupsptpopmp pipnpsptpaplplpaptpipopnp p(pfpoprp pepxpppeprptpsp)p p p p p p p p p p p pｳ pｳp       ｳ pｳp p pC|o~n~f~i~g~u~r~e~ p p p pDpop pppopsptp-pipnpsptpaplplp pcpopnpfpipgpuprpaptpipopnp popfp pFprpepepBpSpDp p p p p p p p p p p p pｳ pｳp       ｳ pｳp p pD|o~c~ p p p p p p p p p pIpnpsptpaplplpaptpipopnp pipnpsptprpupcptpipopnpsp,p pRpEpApDpMpEp,p peptpcp.p p p p p p p p p p p p p pｳ pｳp       ｳ pｳp p pK|e~y~m~a~p~ p p p p p p pSpeplpepcptp pkpepypbpopaprpdp ptpypppep p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳ pｳp       ｳ pｳp p pO|p~t~i~o~n~s~ p p p p p pVpipepwp/pSpeptp pvpaprpipopupsp pipnpsptpaplplpaptpipopnp poppptpipopnpsp p p p p p p p p p p p p p p pｳ pｳp       ｳ pｳp p pF|i~x~i~t~ p p p p p p p pEpnptpeprp prpepppapiprp pmpopdpep pwpiptphp pCpDpRpOpMp/pfplpopppppyp poprp psptpaprptp psphpeplplp p pｳ pｳp       ｳ pｳp p pU|p~g~r~a~d~e~ p p p p p pUpppgprpapdpep papnp pepxpipsptpipnpgp pspypsptpepmp p p p p p p p p p p p p p p p p p p p p p p p p p pｳ pｳp       ｳ pｳp p pL|o~a~d~ ~C~o~n~f~i~g~ p pLpopapdp pdpepfpapuplptp pipnpsptpaplplp pcpopnpfpipgpuprpaptpipopnp p p p p p p p p p p p p p p p p p pｳ pｳp       ｳ pｳp p pI|n~d~e~x~ p p p p p p p pGplpopspspaprpyp popfp pfpupnpcptpipopnpsp p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳ pｳp       ｳ pﾀpﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾙ pｳp       ﾃﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｴp       ｳ p p p p p p p p p p p p p p p p p p p p p p p p pSteplpepcptp p p p p[X Exit Install] p p p p p p p p p p p p p p p p p p p pｳp       ﾀﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄp[~ ~P~r~e~s~s~ ~F~1~ ~f~o~r~ ~I~n~s~t~a~l~l~a~t~i~o~n~ ~G~u~i~d~e~ ~]~ﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾙp                                                                                                                                                                    
\ No newline at end of file
diff --git a/en_US.ISO8859-1/books/handbook/install/media.scr b/en_US.ISO8859-1/books/handbook/install/media.scr
new file mode 100644
index 0000000000..f7943163fd
--- /dev/null
+++ b/en_US.ISO8859-1/books/handbook/install/media.scr
@@ -0,0 +1 @@
+SCRSHOT_P                                                                                                                                                                   ﾚﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄ ~C~h~o~o~s~e~ ~I~n~s~t~a~l~l~a~t~i~o~n~ ~M~e~d~i~a~ ~ﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｿp      ｳ pFprpepepBpSpDp pcpapnp pbpep pipnpsptpaplplpepdp pfprpopmp pap pvpaprpipeptpyp popfp pdpipfpfpeprpepnptp pipnpsptpaplplpaptpipopnp p p p p p pｳp      ｳ pmpepdpipap,p prpapnpgpipnpgp pfprpopmp pfplpopppppipepsp ptpop papnp pIpnptpeprpnpeptp pFpTpPp pspeprpvpeprp.p p pIpfp pypopup'prpep p p p p pｳp      ｳ pipnpsptpaplplpipnpgp pFprpepepBpSpDp pfprpopmp pap pspupppppoprptpepdp pCpDpRpOpMp pdprpipvpep ptphpepnp ptphpipsp pipsp pgpepnpeprpaplplpyp pｳp      ｳ ptphpep pbpepsptp pmpepdpipap ptpop pupspep pipfp pypopup phpapvpep pnpop popvpeprprpipdpipnpgp prpepapspopnp pfpoprp pupspipnpgp poptphpeprp pｳp      ｳ pmpepdpipap.p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳp      ｳ pﾚpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpｿ pｳp      ｳ pｳp p p p1 CDROM p p p p p p p pInstall from a FreeBSD CDROM p p p p p p p p p p p p p p p p p p p p p pｳ pｳp      ｳ pｳp p p p2| ~F~T~P~ p p p p p p p p p pIpnpsptpaplplp pfprpopmp papnp pFpTpPp pspeprpvpeprp p p p p p p p p p p p p p p p p p p p p p p p pｳ pｳp      ｳ pｳp p p p3| ~F~T~P~ ~P~a~s~s~i~v~e~ p pIpnpsptpaplplp pfprpopmp papnp pFpTpPp pspeprpvpeprp ptphprpopupgphp pap pfpiprpepwpaplplp p p p p pｳ pｳp      ｳ pｳp p p p4| ~H~T~T~P~ p p p p p p p p pIpnpsptpaplplp pfprpopmp papnp pFpTpPp pspeprpvpeprp ptphprpopupgphp pap phptptppp ppprpopxpyp p p pｳ pｳp      ｳ pｳp p p p5| ~D~O~S~ p p p p p p p p p pIpnpsptpaplplp pfprpopmp pap pDpOpSp pppaprptpiptpipopnp p p p p p p p p p p p p p p p p p p p p p pｳ pｳp      ｳ pｳp p p p6| ~N~F~S~ p p p p p p p p p pIpnpsptpaplplp popvpeprp pNpFpSp p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳ pｳp      ｳ pｳp p p p7| ~F~i~l~e~ ~S~y~s~t~e~m~ p pIpnpsptpaplplp pfprpopmp papnp pepxpipsptpipnpgp pfpiplpepspypsptpepmp p p p p p p p p p p p p p p pｳ pｳp      ｳ pｳp p p p8| ~F~l~o~p~p~y~ p p p p p p pIpnpsptpaplplp pfprpopmp pap pfplpopppppyp pdpipspkp pspeptp p p p p p p p p p p p p p p p p p p p pｳ pｳp      ｳ pｳp p p p9| ~T~a~p~e~ p p p p p p p p pIpnpsptpaplplp pfprpopmp pSpCpSpIp poprp pQpIpCp ptpapppep p p p p p p p p p p p p p p p p p p p p pｳ pｳp      ｳ pｳp p p pX| ~O~p~t~i~o~n~s~ p p p p p pGpop ptpop ptphpep pOppptpipopnpsp pspcprpepepnp p p p p p p p p p p p p p p p p p p p p p p p p p pｳ pｳp      ｳ pﾀpﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾙ pｳp      ﾃﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｴp      ｳ p p p p p p p p p p p p p p p p p p p p p p p p p[  OK  ] p p p p p p pCtapnpcpeplp p p p p p p p p p p p p p p p p p p p p p p p p p pｳp      ﾀﾄpﾄpﾄpﾄpﾄpﾄp[~ ~P~r~e~s~s~ ~F~1~ ~f~o~r~ ~m~o~r~e~ ~i~n~f~o~r~m~a~t~i~o~n~ ~o~n~ ~t~h~e~ ~v~a~r~i~o~u~s~ ~m~e~d~i~a~ ~t~y~p~e~s~ ~]~ﾄpﾄpﾄpﾄpﾄpﾄpﾙp                                                                                                                                                                   
\ No newline at end of file
diff --git a/en_US.ISO8859-1/books/handbook/install/mouse1.scr b/en_US.ISO8859-1/books/handbook/install/mouse1.scr
new file mode 100644
index 0000000000..a68a694b9f
--- /dev/null
+++ b/en_US.ISO8859-1/books/handbook/install/mouse1.scr
@@ -0,0 +1 @@
+SCRSHOT_P                                                                                                                                                                   ﾚﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄ ~P~l~e~a~s~e~ ~c~o~n~f~i~g~u~r~e~ ~y~o~u~r~ ~m~o~u~s~e~ ~ﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｿp      ｳ pYpopup pcpapnp pcpuptp papnpdp pppapsptpep ptpepxptp pipnp ptphpep ptpepxptp pcpopnpspoplpep pbpyp prpupnpnpipnpgp ptphpep pmpopupspep p p p pｳp      ｳ pdpapepmpopnp.p p pSpppepcpipfpyp pap pppoprptp papnpdp pap ppprpoptpopcpoplp ptpypppep popfp pypopuprp pmpopupspep papnpdp pepnpapbplpep p p pｳp      ｳ ptphpep pmpopupspep pdpapepmpopnp.p p pIpfp pypopup pdpopnp'ptp pwpapnptp ptphpipsp pfpepaptpuprpep,p pspeplpepcptp p6p ptpop pdpipspapbplpep pｳp      ｳ ptphpep pdpapepmpopnp.p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳp      ｳ pOpnpcpep pypopup'pvpep pepnpapbplpepdp ptphpep pmpopupspep pdpapepmpopnp,p pypopup pcpapnp pspppepcpipfpyp p"p/pdpepvp/pspypspmpopupspep"p p pｳp      ｳ papsp pypopuprp pmpopupspep pdpepvpipcpep papnpdp p"pSpypspMpopupspep"p poprp p"pMpopupspepSpypsptpepmpsp"p papsp pmpopupspep p p p p p p p p pｳp      ｳ ppprpoptpopcpoplp pwphpepnp prpupnpnpipnpgp ptphpep pXp pcpopnpfpipgpuprpaptpipopnp puptpiplpiptpyp p(pspepep pCpopnpfpipgpuprpaptpipopnp p p pｳp      ｳ pmpepnpup)p.p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳp      ｳ pﾚpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpｿ pｳp      ｳ pｳp p p p p p p p p pX| ~E~x~i~t~ p p p p pEpxpiptp ptphpipsp pmpepnpup p(prpeptpuprpnpipnpgp ptpop ppprpepvpipopupsp)p p p p p p p p p p pｳ pｳp      ｳ pｳp p p p p p p p p p2| ~E~n~a~b~l~e~ p p pTpepsptp papnpdp prpupnp ptphpep pmpopupspep pdpapepmpopnp p p p p p p p p p p p p p p p p p p pｳ pｳp      ｳ pｳp p p p p p p p p p3 Type p p p p pSelect mouse protocol type p p p p p p p p p p p p p p p p p p p p p pｳ pｳp      ｳ pｳp p p p p p p p p p4| ~P~o~r~t~ p p p p pSpeplpepcptp pmpopupspep pppoprptp p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳ pｳp      ｳ pｳp p p p p p p p p p5| ~F~l~a~g~s~ p p p pSpeptp papdpdpiptpipopnpaplp pfplpapgpsp p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳ pｳp      ｳ pｳp p p p p p p p p p6| ~D~i~s~a~b~l~e~ p pDpipspapbplpep ptphpep pmpopupspep pdpapepmpopnp p p p p p p p p p p p p p p p p p p p p p p p pｳ pｳp      ｳ pﾀpﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾙ pｳp      ﾃﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｴp      ｳ p p p p p p p p p p p p p p p p p p p p p p p p p[  OK  ] p p p p p p pCtapnpcpeplp p p p p p p p p p p p p p p p p p p p p p p p p p pｳp      ﾀﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾙp                                                                                                                                                                                                                                                   
\ No newline at end of file
diff --git a/en_US.ISO8859-1/books/handbook/install/mouse2.scr b/en_US.ISO8859-1/books/handbook/install/mouse2.scr
new file mode 100644
index 0000000000..2767270702
--- /dev/null
+++ b/en_US.ISO8859-1/books/handbook/install/mouse2.scr
@@ -0,0 +1 @@
+SCRSHOT_P                                                                                 ﾚﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄ ~S~e~l~e~c~t~ ~a~ ~p~r~o~t~o~c~o~l~ ~t~y~p~e~ ~f~o~r~ ~y~o~u~r~ ~m~o~u~s~e~ ~ﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｿp   ｳ pIpfp pypopuprp pmpopupspep pipsp paptptpapcphpepdp ptpop ptphpep pPpSp/p2p pmpopupspep pppoprptp poprp ptphpep pbpupsp pmpopupspep pppoprptp,p p p pｳp   ｳ pypopup psphpopuplpdp paplpwpapypsp pcphpopopspep p"pApuptpop"p,p prpepgpaprpdplpepspsp popfp ptphpep pmpopdpeplp papnpdp ptphpep pbprpapnpdp p p p pｳp   ｳ popfp ptphpep pmpopupspep.p p pAplplp poptphpeprp ppprpoptpopcpoplp ptpypppepsp paprpep pfpoprp pspeprpipaplp pmpipcpep papnpdp psphpopuplpdp p p p pｳp   ｳ pnpoptp pbpep pupspepdp pwpiptphp ptphpep pPpSp/p2p pppoprptp pmpopupspep poprp ptphpep pbpupsp pmpopupspep.p p pIpfp pypopup phpapvpep p p p p p p pｳp   ｳ pap pspeprpipaplp pmpopupspep papnpdp paprpep pnpoptp pspuprpep papbpopuptp piptpsp ppprpoptpopcpoplp,p pypopup psphpopuplpdp paplpspop ptprpyp p p pｳp   ｳ p"pApuptpop"p.p p pIptp pmpapyp pnpoptp pwpoprpkp pfpoprp ptphpep pspeprpipaplp pmpopupspep pipfp ptphpep pmpopupspep pdpopepsp pnpoptp p p p p p p pｳp   ｳ pspupppppoprptp ptphpep pPpnpPp psptpapnpdpaprpdp.p p pBpuptp,p piptp pwpopnp'ptp phpuprptp.p p pMpapnpyp p2p-pbpuptptpopnp pspeprpipaplp pmpipcpep pｳp   ｳ paprpep pcpopmpppaptpipbplpep pwpiptphp p"pMpipcprpopspopfptp"p poprp p"pMpopupspepMpapnp"p.p p p3p-pbpuptptpopnp pspeprpipaplp pmpipcpep p p p p p pｳp   ｳ pmpapyp pbpep pcpopmpppaptpipbplpep pwpiptphp p"pMpopupspepSpypsptpepmpsp"p poprp p"pMpopupspepMpapnp"p.p p pIpfp ptphpep pspeprpipaplp p p p p p p pｳp   ｳ pmpopupspep phpapsp pap pwphpepeplp,p piptp pmpapyp pbpep pcpopmpppaptpipbplpep pwpiptphp p"pIpnptpeplplpipMpopupspep"p.p p p p p p p p p p p p p p pｳp   ｳ pﾚpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpｿ pｳp   ｳ pｳp p(*) p1 Auto p p p p p p p p p p pBus mouse, PS/2 style mouse or PnP serial mouse p pｳ pｳp   ｳ pｳp p(p p)p p2| ~G~l~i~d~e~P~o~i~n~t~ p p p p pApLpPpSp pGplpipdpepPpopipnptp pppapdp p(pspeprpipaplp)p p p p p p p p p p p p p p p p p p p p p pｳ pｳp   ｳ pｳp p(p p)p p3| ~H~i~t~a~c~h~i~ p p p p p p p pHpiptpapcphpip ptpapbplpeptp p(pspeprpipaplp)p p p p p p p p p p p p p p p p p p p p p p p p p p pｳ pｳp   ｳ pｳp p(p p)p p4| ~I~n~t~e~l~l~i~M~o~u~s~e~ p p pMpipcprpopspopfptp pIpnptpeplplpipMpopupspep p(pspeprpipaplp)p p p p p p p p p p p p p p p p p p pｳ pｳp   ｳ pｳp p(p p)p p5| ~L~o~g~i~t~e~c~h~ p p p p p p pLpopgpiptpepcphp ppprpoptpopcpoplp p(poplpdp pmpopdpeplpsp)p p(pspeprpipaplp)p p p p p p p p p p pｳ pｳp   ｳ pｳp p(p p)p p6| ~M~i~c~r~o~s~o~f~t~ p p p p p pMpipcprpopspopfptp ppprpoptpopcpoplp p(pspeprpipaplp)p p p p p p p p p p p p p p p p p p p p p p pｳ pｳp   ｳ pﾀpﾄﾄﾄﾄﾄz(z+z)zﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾙ pｳp   ﾃﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｴp   ｳ p p p p p p p p p p p p p p p p p p p p p p p p p p[  OK  ] p p p p p p pCtapnpcpeplp p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳp   ﾀﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾙp                                                                                                                                                                  
\ No newline at end of file
diff --git a/en_US.ISO8859-1/books/handbook/install/mouse3.scr b/en_US.ISO8859-1/books/handbook/install/mouse3.scr
new file mode 100644
index 0000000000..3039e1d60d
--- /dev/null
+++ b/en_US.ISO8859-1/books/handbook/install/mouse3.scr
@@ -0,0 +1 @@
+SCRSHOT_P                                                                                                                                                                   ﾚﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄ ~P~l~e~a~s~e~ ~c~o~n~f~i~g~u~r~e~ ~y~o~u~r~ ~m~o~u~s~e~ ~ﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｿp      ｳ pYpopup pcpapnp pcpuptp papnpdp pppapsptpep ptpepxptp pipnp ptphpep ptpepxptp pcpopnpspoplpep pbpyp prpupnpnpipnpgp ptphpep pmpopupspep p p p pｳp      ｳ pdpapepmpopnp.p p pSpppepcpipfpyp pap pppoprptp papnpdp pap ppprpoptpopcpoplp ptpypppep popfp pypopuprp pmpopupspep papnpdp pepnpapbplpep p p pｳp      ｳ ptphpep pmpopupspep pdpapepmpopnp.p p pIpfp pypopup pdpopnp'ptp pwpapnptp ptphpipsp pfpepaptpuprpep,p pspeplpepcptp p6p ptpop pdpipspapbplpep pｳp      ｳ ptphpep pdpapepmpopnp.p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳp      ｳ pOpnpcpep pypopup'pvpep pepnpapbplpepdp ptphpep pmpopupspep pdpapepmpopnp,p pypopup pcpapnp pspppepcpipfpyp p"p/pdpepvp/pspypspmpopupspep"p p pｳp      ｳ papsp pypopuprp pmpopupspep pdpepvpipcpep papnpdp p"pSpypspMpopupspep"p poprp p"pMpopupspepSpypsptpepmpsp"p papsp pmpopupspep p p p p p p p p pｳp      ｳ ppprpoptpopcpoplp pwphpepnp prpupnpnpipnpgp ptphpep pXp pcpopnpfpipgpuprpaptpipopnp puptpiplpiptpyp p(pspepep pCpopnpfpipgpuprpaptpipopnp p p pｳp      ｳ pmpepnpup)p.p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳp      ｳ pﾚpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpｿ pｳp      ｳ pｳp p p p p p p p p pX| ~E~x~i~t~ p p p p pEpxpiptp ptphpipsp pmpepnpup p(prpeptpuprpnpipnpgp ptpop ppprpepvpipopupsp)p p p p p p p p p p pｳ pｳp      ｳ pｳp p p p p p p p p p2| ~E~n~a~b~l~e~ p p pTpepsptp papnpdp prpupnp ptphpep pmpopupspep pdpapepmpopnp p p p p p p p p p p p p p p p p p p pｳ pｳp      ｳ pｳp p p p p p p p p p3| ~T~y~p~e~ p p p p pSpeplpepcptp pmpopupspep ppprpoptpopcpoplp ptpypppep p p p p p p p p p p p p p p p p p p p p p pｳ pｳp      ｳ pｳp p p p p p p p p p4 Port p p p p pSelect mouse port p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳ pｳp      ｳ pｳp p p p p p p p p p5| ~F~l~a~g~s~ p p p pSpeptp papdpdpiptpipopnpaplp pfplpapgpsp p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳ pｳp      ｳ pｳp p p p p p p p p p6| ~D~i~s~a~b~l~e~ p pDpipspapbplpep ptphpep pmpopupspep pdpapepmpopnp p p p p p p p p p p p p p p p p p p p p p p p pｳ pｳp      ｳ pﾀpﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾙ pｳp      ﾃﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｴp      ｳ p p p p p p p p p p p p p p p p p p p p p p p p p[  OK  ] p p p p p p pCtapnpcpeplp p p p p p p p p p p p p p p p p p p p p p p p p p pｳp      ﾀﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾙp                                                                                                                                                                                                                                                   
\ No newline at end of file
diff --git a/en_US.ISO8859-1/books/handbook/install/mouse4.scr b/en_US.ISO8859-1/books/handbook/install/mouse4.scr
new file mode 100644
index 0000000000..7620914d83
--- /dev/null
+++ b/en_US.ISO8859-1/books/handbook/install/mouse4.scr
@@ -0,0 +1 @@
+SCRSHOT_P                                                                                                                                                                                                                                                                                                                                                                                                                    ﾚﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄ ~S~e~l~e~c~t~ ~y~o~u~r~ ~m~o~u~s~e~ ~p~o~r~t~ ~f~r~o~m~ ~t~h~e~ ~f~o~l~l~o~w~i~n~g~ ~m~e~n~u~ ~ﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｿp        ｳ pTphpep pbpupiplptp-pipnp pppopipnptpipnpgp pdpepvpipcpep popfp plpappptpoppp/pnpoptpepbpopopkp pcpopmpppuptpeprpsp pipsp pupspupaplplpyp pｳp        ｳ pap pPpSp/p2p psptpyplpep pdpepvpipcpep.p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳp        ｳ pﾚpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpｿ pｳp        ｳ pｳp p p p p(*) p1 PS/2 p p p p p pPS/2 style mouse (/dev/psm0) p p p p p p p p p p p p p p p p p pｳ pｳp        ｳ pｳp p p p p(p p)p p2| ~C~O~M~1~ p p p p p pSpeprpipaplp pmpopupspep popnp pCpOpMp1p p(p/pdpepvp/pcpupapap0p)p p p p p p p p p p p p p pｳ pｳp        ｳ pｳp p p p p(p p)p p3| ~C~O~M~2~ p p p p p pSpeprpipaplp pmpopupspep popnp pCpOpMp2p p(p/pdpepvp/pcpupapap1p)p p p p p p p p p p p p p pｳ pｳp        ｳ pｳp p p p p(p p)p p4| ~C~O~M~3~ p p p p p pSpeprpipaplp pmpopupspep popnp pCpOpMp3p p(p/pdpepvp/pcpupapap2p)p p p p p p p p p p p p p pｳ pｳp        ｳ pｳp p p p p(p p)p p5| ~C~O~M~4~ p p p p p pSpeprpipaplp pmpopupspep popnp pCpOpMp4p p(p/pdpepvp/pcpupapap3p)p p p p p p p p p p p p p pｳ pｳp        ｳ pｳp p p p p(p p)p p6| ~B~u~s~M~o~u~s~e~ p pLpopgpiptpepcphp,p pApTpIp poprp pMpSp pbpupsp pmpopupspep p(p/pdpepvp/pmpspep0p)p p p p p pｳ pｳp        ｳ pﾀpﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾙ pｳp        ﾃﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｴp        ｳ p p p p p p p p p p p p p p p p p p p p p p p p[  OK  ] p p p p p p pCtapnpcpeplp p p p p p p p p p p p p p p p p p p p p p p p p pｳp        ﾀﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾙp                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                    
\ No newline at end of file
diff --git a/en_US.ISO8859-1/books/handbook/install/mouse5.scr b/en_US.ISO8859-1/books/handbook/install/mouse5.scr
new file mode 100644
index 0000000000..94137d2434
--- /dev/null
+++ b/en_US.ISO8859-1/books/handbook/install/mouse5.scr
@@ -0,0 +1 @@
+SCRSHOT_P                                                                                                                                                                   ﾚﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄ ~P~l~e~a~s~e~ ~c~o~n~f~i~g~u~r~e~ ~y~o~u~r~ ~m~o~u~s~e~ ~ﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｿp      ｳ pYpopup pcpapnp pcpuptp papnpdp pppapsptpep ptpepxptp pipnp ptphpep ptpepxptp pcpopnpspoplpep pbpyp prpupnpnpipnpgp ptphpep pmpopupspep p p p pｳp      ｳ pdpapepmpopnp.p p pSpppepcpipfpyp pap pppoprptp papnpdp pap ppprpoptpopcpoplp ptpypppep popfp pypopuprp pmpopupspep papnpdp pepnpapbplpep p p pｳp      ｳ ptphpep pmpopupspep pdpapepmpopnp.p p pIpfp pypopup pdpopnp'ptp pwpapnptp ptphpipsp pfpepaptpuprpep,p pspeplpepcptp p6p ptpop pdpipspapbplpep pｳp      ｳ ptphpep pdpapepmpopnp.p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳp      ｳ pOpnpcpep pypopup'pvpep pepnpapbplpepdp ptphpep pmpopupspep pdpapepmpopnp,p pypopup pcpapnp pspppepcpipfpyp p"p/pdpepvp/pspypspmpopupspep"p p pｳp      ｳ papsp pypopuprp pmpopupspep pdpepvpipcpep papnpdp p"pSpypspMpopupspep"p poprp p"pMpopupspepSpypsptpepmpsp"p papsp pmpopupspep p p p p p p p p pｳp      ｳ ppprpoptpopcpoplp pwphpepnp prpupnpnpipnpgp ptphpep pXp pcpopnpfpipgpuprpaptpipopnp puptpiplpiptpyp p(pspepep pCpopnpfpipgpuprpaptpipopnp p p pｳp      ｳ pmpepnpup)p.p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳp      ｳ pﾚpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpｿ pｳp      ｳ pｳp p p p p p p p p pX| ~E~x~i~t~ p p p p pEpxpiptp ptphpipsp pmpepnpup p(prpeptpuprpnpipnpgp ptpop ppprpepvpipopupsp)p p p p p p p p p p pｳ pｳp      ｳ pｳp p p p p p p p p p2 Enable p p pTest and run the mouse daemon p p p p p p p p p p p p p p p p p p pｳ pｳp      ｳ pｳp p p p p p p p p p3| ~T~y~p~e~ p p p p pSpeplpepcptp pmpopupspep ppprpoptpopcpoplp ptpypppep p p p p p p p p p p p p p p p p p p p p p pｳ pｳp      ｳ pｳp p p p p p p p p p4| ~P~o~r~t~ p p p p pSpeplpepcptp pmpopupspep pppoprptp p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳ pｳp      ｳ pｳp p p p p p p p p p5| ~F~l~a~g~s~ p p p pSpeptp papdpdpiptpipopnpaplp pfplpapgpsp p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳ pｳp      ｳ pｳp p p p p p p p p p6| ~D~i~s~a~b~l~e~ p pDpipspapbplpep ptphpep pmpopupspep pdpapepmpopnp p p p p p p p p p p p p p p p p p p p p p p p pｳ pｳp      ｳ pﾀpﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾙ pｳp      ﾃﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｴp      ｳ p p p p p p p p p p p p p p p p p p p p p p p p p[  OK  ] p p p p p p pCtapnpcpeplp p p p p p p p p p p p p p p p p p p p p p p p p p pｳp      ﾀﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾙp                                                                                                                                                                                                                                                   
\ No newline at end of file
diff --git a/en_US.ISO8859-1/books/handbook/install/mouse6.scr b/en_US.ISO8859-1/books/handbook/install/mouse6.scr
new file mode 100644
index 0000000000..3111e72779
--- /dev/null
+++ b/en_US.ISO8859-1/books/handbook/install/mouse6.scr
@@ -0,0 +1 @@
+SCRSHOT_P                                                                                                                                                                   ﾚﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄ ~P~l~e~a~s~e~ ~c~o~n~f~i~g~u~r~e~ ~y~o~u~r~ ~m~o~u~s~e~ ~ﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｿp      ｳ pYpopup pcpapnp pcpuptp papnpdp pppapsptpep ptpepxptp pipnp ptphpep ptpepxptp pcpopnpspoplpep pbpyp prpupnpnpipnpgp ptphpep pmpopupspep p p p pｳp      ｳ pdpapepmpopnp.p p pSpppepcpipfpyp pap pppoprptp papnpdp pap ppprpoptpopcpoplp ptpypppep popfp pypopuprp pmpopupspep papnpdp pepnpapbplpep p p pｳp      ｳ ptphpep pmpopupspep pdpapepmpopnp.p p pIpfp pypopup pdpopnp'ptp pwpapnptp ptphpipsp pfpepaptpuprpep,p pspeplpepcptp p6p ptpop pdpipspapbplpep pｳp      ｳ ptphpep pdpapepmpopnp.p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳp      ｳ pOpnpcpep pypopup'pvpep pepnpapbplpepdp ptphpep pmpopupspep pdpapepmpopnp,p pypopup pcpapnp pspppepcpipfpyp p"p/pdpepvp/pspypspmpopupspep"p p pｳp      ｳ papsp pypopuprp pﾚﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄ ~U~s~e~r~ ~C~o~n~f~i~r~m~a~t~i~o~n~ ~R~e~q~u~e~s~t~e~d~ ~ﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｿp p p p p p p p p pｳp      ｳ ppprpoptpopcpoplpｳ pNpopwp pmpopvpep ptphpep pmpopupspep papnpdp pspepep pipfp piptp pwpoprpkpsp.p p p p p p p p p p p p pｳpratpipopnp p p pｳp      ｳ pmpepnpup)p.p p pｳ p(pNpoptpep ptphpaptp pbpuptptpopnpsp pdpopnp'ptp phpapvpep papnpyp pepfpfpepcptp pfpoprp pnpopwp.p)p pｳp   p p p p p p pｳp      ｳ pﾚpﾄpﾄpﾄpﾄpﾄpﾄpﾄpｳ p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳpﾄﾄﾄpﾄpﾄpﾄpﾄpｿ pｳp      ｳ pｳp p p p p p p pｳ p p p p p p p p p pIpsp ptphpep pmpopupspep pcpuprpspoprp pmpopvpipnpgp?p p p p p p p p p p p p p p p pｳp   p p p p pｳ pｳp      ｳ pｳp p p p p p p pｳ p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳp   p p p p pｳ pｳp      ｳ pｳp p p p p p p pﾃﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｴp   p p p p pｳ pｳp      ｳ pｳp p p p p p p pｳ p p p p p p p p p p p p p p p p[ Yes ] p p p p p p p p pNtop p p p p p p p p p p p p p p p p p pｳp   p p p p pｳ pｳp      ｳ pｳp p p p p p p pﾀﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾙp   p p p p pｳ pｳp      ｳ pｳp p p p p p p p p p6 Disable  Disable the mouse daemon                    p p p p pｳ pｳp      ｳ pﾀpﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾙ pｳp      ﾃﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｴp      ｳ p p p p p p p p p p p p p p p p p p p p p p p p p[  OK  ] p p p p p p pCtapnpcpeplp p p p p p p p p p p p p p p p p p p p p p p p p p pｳp      ﾀﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾙp                                                                                                                                                                                                                                                   
\ No newline at end of file
diff --git a/en_US.ISO8859-1/books/handbook/install/nfs-server-edit.scr b/en_US.ISO8859-1/books/handbook/install/nfs-server-edit.scr
new file mode 100644
index 0000000000..ed7040a522
--- /dev/null
+++ b/en_US.ISO8859-1/books/handbook/install/nfs-server-edit.scr
@@ -0,0 +1 @@
+SCRSHOT_P^[ (escape) menu ^y search prompt ^k delete line    ^p prev line  ^g prev page  ^o ascii code    ^x search        ^l undelete line  ^n next line  ^v next page  ^u end of file   ^a begin of line ^w delete word    ^b back char  ^z next word  ^t begin of file ^e end of line   ^r restore word   ^f forward char             ^c command       ^d delete char   ^j undelete char              ESC-Enter: exit =p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p=p #The following examples export /usr to 3 machines named after ducks,            #/home and all directories under it to machines named after dead rock stars     #and, finally, /a to 2 privileged machines allowed to write on it as root.      #/usr                huey louie dewie                                           #/home   -alldirs    janice jimmy frank                                         #/a      -maproot=0  bill albert                                                #                                                                               # You should replace these lines with your actual exported filesystems.                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                         file "/etc/exports", 9 lines                                                    
\ No newline at end of file
diff --git a/en_US.ISO8859-1/books/handbook/install/options.scr b/en_US.ISO8859-1/books/handbook/install/options.scr
new file mode 100644
index 0000000000..9d7c18ae3d
--- /dev/null
+++ b/en_US.ISO8859-1/books/handbook/install/options.scr
@@ -0,0 +1 @@
+SCRSHOT_POppptpipopnpsp pEpdpiptpoprp                                                                                                                                                  Name            Value                   Name            Value                   ----            -----                   ----            -----                   NFS Secure      NO                      Media Type      <not yet set>           NFS Slow        NO                      Media Timeout   300                     Debugging       NO                      Package Temp    /usr/tmp                No Warnings     NO                      Newfs Args      -b 8192 -f 1024         Yes to All      NO                      Fixit Console   serial                  DHCP            NO                      Config save     YES                     IPv6            NO                      Re-scan Devices <*>                     FTP username    ftp                     Use Defaults    [RESET!]                Editor          vi                                                              Tape Blocksize  20                                                              Extract Detail  high                                                            Release Name    4.3-RELEASE                                                     Install Root    /                                                               Browser package lynx                                                            Browser Exec    /usr/local/bin/lynx                                                                                                                             Use SPACE to select/toggle an option, arrow keys to move,                       ? or F1 for more help.  When you're done, type Q to Quit.                                                                                                       NFS server talks only on a secure port                                                                                                                          
\ No newline at end of file
diff --git a/en_US.ISO8859-1/books/handbook/install/pkg-cat.scr b/en_US.ISO8859-1/books/handbook/install/pkg-cat.scr
new file mode 100644
index 0000000000..1b1aa44c1c
--- /dev/null
+++ b/en_US.ISO8859-1/books/handbook/install/pkg-cat.scr
@@ -0,0 +1 @@
+SCRSHOT_P ﾚﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄ ~P~a~c~k~a~g~e~ ~S~e~l~e~c~t~i~o~n~ ~ﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｿp   ｳ pTpop pmpaprpkp pap pppapcpkpapgpep,p pmpopvpep ptpop piptp papnpdp ppprpepspsp pSpPpApCpEp.p p pIpfp ptphpep pppapcpkpapgpep pipsp p p p p p p p p pｳp   ｳ paplprpepapdpyp pmpaprpkpepdp,p piptp pwpiplplp pbpep pupnpmpaprpkpepdp poprp pdpeplpeptpepdp p(pipfp pipnpsptpaplplpepdp)p.p p p p p p p p p p p p pｳp   ｳ pIptpepmpsp pmpaprpkpepdp pwpiptphp pap p`pDp'p paprpep pdpepppepnpdpepnpcpipepsp pwphpipcphp pwpiplplp pbpep papuptpop-plpopapdpepdp.p p p p p p p pｳp   ｳ pTpop pspepaprpcphp pfpoprp pap pppapcpkpapgpep pbpyp pnpapmpep,p ppprpepspsp pEpSpCp.p p pTpop pspeplpepcptp pap pcpaptpepgpoprpyp,p p p p p p p p pｳp   ｳ ppprpepspsp pRpEpTpUpRpNp.p p pNpOpTpEp:p p pTphpep pAplplp pcpaptpepgpoprpyp pspeplpepcptpipopnp pcprpepaptpepsp pap pvpeprpyp plpaprpgpep p p p p pｳp   ｳ pspupbpmpepnpup!p p pIpfp pypopup pspeplpepcptp piptp,p ppplpepapspep pbpep pppaptpipepnptp pwphpiplpep piptp pcpopmpepsp puppp.p p p p p p p p p p pｳp   ｳ pﾚpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpｿ pｳp   ｳ pｳp pAll p p p p p p p p p p pAll available packages in all categories. p p p p p p p p p p p p p p pｳ pｳp   ｳ pｳp pa|f~t~e~r~s~t~e~p~ p p p p pPpoprptpsp ptpop pspupppppoprptp ptphpep pApfptpeprpSptpeppp pwpipnpdpopwp pmpapnpapgpeprp.p p p p p p p p p p pｳ pｳp   ｳ pｳp pa|r~c~h~i~v~e~r~s~ p p p p pUptpiplpiptpipepsp pfpoprp paprpcphpipvpipnpgp papnpdp pupnpaprpcphpipvpipnpgp pdpaptpap.p p p p p p p p p p p pｳ pｳp   ｳ pｳp pa|s~t~r~o~ p p p p p p p p pAppppplpipcpaptpipopnpsp prpeplpaptpepdp ptpop papsptprpopnpopmpyp.p p p p p p p p p p p p p p p p p p p p p p pｳ pｳp   ｳ pｳp pa|u~d~i~o~ p p p p p p p p pApupdpipop puptpiplpiptpipepsp p-p pmpopsptp prpepqpupiprpep pap pspupppppoprptpepdp pspopupnpdp pcpaprpdp.p p pｳ pｳp   ｳ pｳp pb|e~n~c~h~m~a~r~k~s~ p p p pUptpiplpiptpipepsp pfpoprp pmpepapspuprpipnpgp pspypsptpepmp pppeprpfpoprpmpapnpcpep.p p p p p p p p p p p p p pｳ pｳp   ｳ pｳp pb|i~o~l~o~g~y~ p p p p p p pSpopfptpwpaprpep prpeplpaptpepdp ptpop pbpipoplpopgpyp.p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳ pｳp   ｳ pｳp pc|a~d~ p p p p p p p p p p pCpopmpppuptpeprp pApipdpepdp pDpepspipgpnp puptpiplpiptpipepsp.p p p p p p p p p p p p p p p p p p p p p p p p pｳ pｳp   ｳ pｳp pc|h~i~n~e~s~e~ p p p p p p pPpoprptpepdp pspopfptpwpaprpep pfpoprp ptphpep pCphpipnpepspep pmpaprpkpeptp.p p p p p p p p p p p p p p p p p pｳ pｳp   ｳ pｳp pc|o~m~m~s~ p p p p p p p p pCpopmpmpupnpipcpaptpipopnpsp puptpiplpiptpipepsp.p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳ pｳp   ｳ pｳp pc|o~n~v~e~r~t~e~r~s~ p p p pFpoprpmpaptp pcpopnpvpeprpspipopnp puptpiplpiptpipepsp.p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳ pｳp   ｳ pｳp pd|a~t~a~b~a~s~e~s~ p p p p pDpaptpapbpapspep pspopfptpwpaprpep.p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳ pｳp   ｳ pﾀpﾄz(z+z)zﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾙ pｳp   ﾃﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｴp   ｳ p p p p p p p p p p p p p p p p p p p p p p p p p p[OK] p p p pItnpsptpaplplp p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳp   ﾀﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾙp                                                                                  
\ No newline at end of file
diff --git a/en_US.ISO8859-1/books/handbook/install/pkg-confirm.scr b/en_US.ISO8859-1/books/handbook/install/pkg-confirm.scr
new file mode 100644
index 0000000000..4e74798563
--- /dev/null
+++ b/en_US.ISO8859-1/books/handbook/install/pkg-confirm.scr
@@ -0,0 +1 @@
+SCRSHOT_P                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                      ﾚﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄ ~P~a~c~k~a~g~e~ ~T~a~r~g~e~t~s~ ~ﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｿp             ｳ pTphpepspep paprpep ptphpep pppapcpkpapgpepsp pypopup'pvpep pspeplpepcptpepdp pfpoprp pepxptprpapcptpipopnp.p p p p p p p p p p pｳp             ｳ p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳp             ｳ pIpfp pypopup'prpep pspuprpep popfp ptphpepspep pcphpopipcpepsp,p pspeplpepcptp pOpKp.p p p p p p p p p p p p p p p p p p p p p pｳp             ｳ pIpfp pnpoptp,p pspeplpepcptp pCpapnpcpeplp ptpop pgpop pbpapcpkp ptpop ptphpep pppapcpkpapgpep pspeplpepcptpipopnp pmpepnpup.p pｳp             ｳ p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳp             ｳ pﾚpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpｿ pｳp             ｳ pｳp p p p p p pbash-2.05      p p[/usr/ports/shells/bash2]        p p p p p p pｳ pｳp             ｳ pﾀpﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾙ pｳp             ﾃﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｴp             ｳ p p p p p p p p p p p p p p p p p p p p p[  OK  ] p p p p p p pCtapnpcpeplp p p p p p p p p p p p p p p p p p p p p p p pｳp             ﾀﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾙp                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                       Port scan detection and active defense                                          
\ No newline at end of file
diff --git a/en_US.ISO8859-1/books/handbook/install/pkg-install.scr b/en_US.ISO8859-1/books/handbook/install/pkg-install.scr
new file mode 100644
index 0000000000..37a86240d1
--- /dev/null
+++ b/en_US.ISO8859-1/books/handbook/install/pkg-install.scr
@@ -0,0 +1 @@
+SCRSHOT_P ﾚﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄ ~P~a~c~k~a~g~e~ ~S~e~l~e~c~t~i~o~n~ ~ﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｿp   ｳ pTpop pmpaprpkp pap pppapcpkpapgpep,p pmpopvpep ptpop piptp papnpdp ppprpepspsp pSpPpApCpEp.p p pIpfp ptphpep pppapcpkpapgpep pipsp p p p p p p p p pｳp   ｳ paplprpepapdpyp pmpaprpkpepdp,p piptp pwpiplplp pbpep pupnpmpaprpkpepdp poprp pdpeplpeptpepdp p(pipfp pipnpsptpaplplpepdp)p.p p p p p p p p p p p p pｳp   ｳ pIptpepmpsp pmpaprpkpepdp pwpiptphp pap p`pDp'p paprpep pdpepppepnpdpepnpcpipepsp pwphpipcphp pwpiplplp pbpep papuptpop-plpopapdpepdp.p p p p p p p pｳp   ｳ pTpop pspepaprpcphp pfpoprp pap pppapcpkpapgpep pbpyp pnpapmpep,p ppprpepspsp pEpSpCp.p p pTpop pspeplpepcptp pap pcpaptpepgpoprpyp,p p p p p p p p pｳp   ｳ ppprpepspsp pRpEpTpUpRpNp.p p pNpOpTpEp:p p pTphpep pAplplp pcpaptpepgpoprpyp pspeplpepcptpipopnp pcprpepaptpepsp pap pvpeprpyp plpaprpgpep p p p p pｳp   ｳ pspupbpmpepnpup!p p pIpfp pypopup pspeplpepcptp piptp,p ppplpepapspep pbpep pppaptpipepnptp pwphpiplpep piptp pcpopmpepsp puppp.p p p p p p p p p p pｳp   ｳ pﾚpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpｿ pｳp   ｳ pｳp pAll p p p p p p p p p p pAll available packages in all categories. p p p p p p p p p p p p p p pｳ pｳp   ｳ pｳp pa|f~t~e~r~s~t~e~p~ p p p p pPpoprptpsp ptpop pspupppppoprptp ptphpep pApfptpeprpSptpeppp pwpipnpdpopwp pmpapnpapgpeprp.p p p p p p p p p p pｳ pｳp   ｳ pｳp pa|r~c~h~i~v~e~r~s~ p p p p pUptpiplpiptpipepsp pfpoprp paprpcphpipvpipnpgp papnpdp pupnpaprpcphpipvpipnpgp pdpaptpap.p p p p p p p p p p p pｳ pｳp   ｳ pｳp pa|s~t~r~o~ p p p p p p p p pAppppplpipcpaptpipopnpsp prpeplpaptpepdp ptpop papsptprpopnpopmpyp.p p p p p p p p p p p p p p p p p p p p p p pｳ pｳp   ｳ pｳp pa|u~d~i~o~ p p p p p p p p pApupdpipop puptpiplpiptpipepsp p-p pmpopsptp prpepqpupiprpep pap pspupppppoprptpepdp pspopupnpdp pcpaprpdp.p p pｳ pｳp   ｳ pｳp pb|e~n~c~h~m~a~r~k~s~ p p p pUptpiplpiptpipepsp pfpoprp pmpepapspuprpipnpgp pspypsptpepmp pppeprpfpoprpmpapnpcpep.p p p p p p p p p p p p p pｳ pｳp   ｳ pｳp pb|i~o~l~o~g~y~ p p p p p p pSpopfptpwpaprpep prpeplpaptpepdp ptpop pbpipoplpopgpyp.p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳ pｳp   ｳ pｳp pc|a~d~ p p p p p p p p p p pCpopmpppuptpeprp pApipdpepdp pDpepspipgpnp puptpiplpiptpipepsp.p p p p p p p p p p p p p p p p p p p p p p p p pｳ pｳp   ｳ pｳp pc|h~i~n~e~s~e~ p p p p p p pPpoprptpepdp pspopfptpwpaprpep pfpoprp ptphpep pCphpipnpepspep pmpaprpkpeptp.p p p p p p p p p p p p p p p p p pｳ pｳp   ｳ pｳp pc|o~m~m~s~ p p p p p p p p pCpopmpmpupnpipcpaptpipopnpsp puptpiplpiptpipepsp.p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳ pｳp   ｳ pｳp pc|o~n~v~e~r~t~e~r~s~ p p p pFpoprpmpaptp pcpopnpvpeprpspipopnp puptpiplpiptpipepsp.p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳ pｳp   ｳ pｳp pd|a~t~a~b~a~s~e~s~ p p p p pDpaptpapbpapspep pspopfptpwpaprpep.p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳ pｳp   ｳ pﾀpﾄz(z+z)zﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾙ pｳp   ﾃﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｴp   ｳ p p p p p p p p p p p p p p p p p p p p p p p p p p pOtKp p p p p[Install] p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳp   ﾀﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾙp                                                                                  
\ No newline at end of file
diff --git a/en_US.ISO8859-1/books/handbook/install/pkg-sel.scr b/en_US.ISO8859-1/books/handbook/install/pkg-sel.scr
new file mode 100644
index 0000000000..7121f3bd28
--- /dev/null
+++ b/en_US.ISO8859-1/books/handbook/install/pkg-sel.scr
@@ -0,0 +1 @@
+SCRSHOT_P                                                                                                                                                                                                                                                     ﾚﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄ ~A~l~l~ ~ﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｿp           ｳ p p p p p p p p p p p pAplplp papvpapiplpapbplpep pppapcpkpapgpepsp pipnp paplplp pcpaptpepgpoprpipepsp.p p p p p p p p p p p p p p pｳp           ｳ pﾚpﾄpﾄpﾄpﾄpﾄpz(z-z)zﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpｿ pｳp           ｳ pｳp p[p p]p pb|a~b~e~l~-~1~.~6~_~1~ p p p p p p p p p p p p p p p p p p p p p p p p p p p p p[p/pupsprp/pppoprptpsp/pbpipoplpop pｳ pｳp           ｳ pｳp p[p p]p pb|a~c~k~f~r~a~c~t~-~1~.~1~.~2~ p p p p p p p p p p p p p p p p p p p p p p p p p[p/pupsprp/pppoprptpsp/pgprpappphp pｳ pｳp           ｳ pｳp p[p p]p pb|a~c~o~n~-~1~.~0~7~1~9~9~9~ p p p p p p p p p p p p p p p p p p p p p p p p p p[p/pupsprp/pppoprptpsp/pwpwpwp/pbp pｳ pｳp           ｳ pｳp p[p p]p pb|a~d~u~k~i~-~0~.~2~.~9~ p p p p p p p p p p p p p p p p p p p p p p p p p p p p[p/pupsprp/pppoprptpsp/pgpapmpepsp pｳ pｳp           ｳ pｳp p[p p]p pb|a~l~a~n~c~e~-~2~.~2~4~ p p p p p p p p p p p p p p p p p p p p p p p p p p p p[p/pupsprp/pppoprptpsp/pnpeptp/pbp pｳ pｳp           ｳ pｳp p[p p]p pb|a~s~e~6~4~-~0~.~1~ p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p[p/pupsprp/pppoprptpsp/pcpopnpvpep pｳ pｳp           ｳ pｳp p[X] pbash-2.05 p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p[/usr/ports/shell pｳ pｳp           ｳ pｳp p[p p]p pb|a~t~t~l~e~b~a~l~l~-~2~.~1~ p p p p p p p p p p p p p p p p p p p p p p p p p p[p/pupsprp/pppoprptpsp/pgpapmpepsp pｳ pｳp           ｳ pｳp p[p p]p pb|a~t~t~s~t~a~t~-~a~p~p~l~e~t~-~2~.~0~.~4~ p p p p p p p p p p p p p p p p p p p[p/pupsprp/pppoprptpsp/pspypspuptp pｳ pｳp           ｳ pｳp p[p p]p pb|b~d~a~t~e~-~0~.~2~.~1~ p p p p p p p p p p p p p p p p p p p p p p p p p p p p[p/pupsprp/pppoprptpsp/pxp1p1p-pcp pｳ pｳp           ｳ pｳp p[p p]p pb|b~j~d~-~1~.~0~1~ p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p[p/pupsprp/pppoprptpsp/pmpipspcp/p pｳ pｳp           ｳ pｳp p[p p]p pb|b~k~e~y~s~-~0~.~3~.~6~ p p p p p p p p p p p p p p p p p p p p p p p p p p p p[p/pupsprp/pppoprptpsp/pxp1p1p-pwp pｳ pｳp           ｳ pﾀpﾄﾄﾄﾄﾄz(z+z)zﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾙ pｳp           ﾃﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｴp           ｳ p p p p p p p p p p p p p p p p p p p p p p[  OK  ] p p p p p p pCtapnpcpeplp p p p p p p p p p p p p p p p p p p p p p p p pｳp           ﾀﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾙp                                                                                                                                                                      The GNU Bourne Again Shell                                                      
\ No newline at end of file
diff --git a/en_US.ISO8859-1/books/handbook/install/probstart.scr b/en_US.ISO8859-1/books/handbook/install/probstart.scr
new file mode 100644
index 0000000000..6fff054563
--- /dev/null
+++ b/en_US.ISO8859-1/books/handbook/install/probstart.scr
@@ -0,0 +1 @@
+SCRSHOT_P---Active-Drivers----------------------------------------------Dev---IRQ--Port--  Storage :                                                                        pApTpAp/pApTpApPpIp pcpopmpppaptpipbplpep pdpipspkp pcpopnptprpoplplpeprp p p p p p p p p p p p p p p p p p p p p p p paptpap0p p p p p p1p4p p0pxp1pfp0p p   ATA/ATAPI compatible disk controller                       ata1     15 0x170    Floppy disk controller                                     fdc0     6  0x3f0   Network :                                                                        NE1000,NE2000,3C503,WD/SMC80xx Ethernet adapters           ed0      10 0x280   Communications :                                                                 Parallel Port chipset                                      ppc0     7        ---Inactive-Drivers--------------------------------------------Dev--------------  Storage :          (Collapsed)                                                  Network :          (Collapsed)                                                  Communications :   (Collapsed)                                                  Input :                                                                         Multimedia :                                                                    Miscellaneous :    (Collapsed)                                                                                                                                -------------------------------------------------------------------------------- Port address : 0x1f0                                                            IRQ number   : 14                                                               Flags        : 0x0                                                             --------------------------------------------------------------------------------  [Enter] Edit device parameters  [DEL] Disable device                            [TAB]   Change fields           [Q]   Save and Exit             [?] Help                                                                                      
\ No newline at end of file
diff --git a/en_US.ISO8859-1/books/handbook/install/security.scr b/en_US.ISO8859-1/books/handbook/install/security.scr
new file mode 100644
index 0000000000..1958963c3b
--- /dev/null
+++ b/en_US.ISO8859-1/books/handbook/install/security.scr
@@ -0,0 +1 @@
+SCRSHOT_P                                                                                                                                                                                                                                                                                                                                                                                                                            ﾚﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄ ~D~e~f~a~u~l~t~ ~s~y~s~t~e~m~ ~s~e~c~u~r~i~t~y~ ~p~r~o~f~i~l~e~ ~ﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｿp                        ｳ pEpapcphp piptpepmp pipnp ptphpipsp plpipsptp pwpiplplp pspeptp pwphpaptp piptp pcpopnpspipdpeprpsp ptpop pｳp                        ｳ pbpep p"pappppprpoppprpipaptpep"p pvpaplpupepsp pipnp ptphpaptp pcpaptpepgpoprpyp pfpoprp pvpaprpipopupsp pｳp                        ｳ pspepcpuprpiptpyp-prpeplpaptpepdp pkpnpopbpsp pipnp p/peptpcp/prpcp.pcpopnpfp.p p p p p p p p p p p p p p pｳp                        ｳ pﾚpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpｿ pｳp                        ｳ pｳp pX Exit p p pExit this menu (returning to previous) p pｳ pｳp                        ｳ pｳp pL|o~w~ p p p p p pFpapiprplpyp pwpipdpep-popppepnp p(plpiptptplpep)p pspepcpuprpiptpyp.p p p p p pｳ pｳp                        ｳ pｳp pM|e~d~i~u~m~ p p pMpopdpeprpaptpep pspepcpuprpiptpyp pspeptptpipnpgpsp p[pDpEpFpApUpLpTp]p.p p p pｳ pｳp                        ｳ pｳp pH|i~g~h~ p p p p pFpapiprplpyp pspapfpep pspepcpuprpiptpyp pspeptptpipnpgpsp.p p p p p p p p p p pｳ pｳp                        ｳ pｳp pE|x~t~r~e~m~e~ p pVpeprpyp prpepsptprpipcptpipvpep pspepcpuprpiptpyp pspeptptpipnpgpsp.p p p p p pｳ pｳp                        ｳ pﾀpﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾙ pｳp                        ﾃﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｴp                        ｳ p p p p p p p p p p p p p p p p[  OK  ] p p p p p p pCtapnpcpeplp p p p p p p p p p p p p p p p p pｳp                        ﾀﾄpﾄp[~ ~S~e~l~e~c~t~ ~a~ ~c~a~n~n~e~d~ ~s~e~c~u~r~i~t~y~ ~p~r~o~f~i~l~e~ ~-~ ~F~1~ ~f~o~r~ ~h~e~l~p~ ~]~ﾄpﾄpﾙp                                                                                                                                                                                                                                                                                                                                                                                                                                                                                                            
\ No newline at end of file
diff --git a/en_US.ISO8859-1/books/handbook/install/sysinstall-exit.scr b/en_US.ISO8859-1/books/handbook/install/sysinstall-exit.scr
new file mode 100644
index 0000000000..82448cc964
--- /dev/null
+++ b/en_US.ISO8859-1/books/handbook/install/sysinstall-exit.scr
@@ -0,0 +1 @@
+SCRSHOT_P                                                                                   ﾚﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄ ~/~s~t~a~n~d~/~s~y~s~i~n~s~t~a~l~l~ ~M~a~i~n~ ~M~e~n~u~ ~ﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｿp       ｳ pWpeplpcpopmpep ptpop ptphpep pFprpepepBpSpDp pipnpsptpaplplpaptpipopnp papnpdp pcpopnpfpipgpuprpaptpipopnp ptpopoplp.p p pPplpepapspep p p pｳp       ｳ pspeplpepcptp popnpep popfp ptphpep poppptpipopnpsp pbpeplpopwp pbpyp pupspipnpgp ptphpep paprprpopwp pkpepypsp poprp ptpypppipnpgp ptphpep pｳp       ｳ pfpiprpsptp pcphpaprpapcptpeprp popfp ptphpep poppptpipopnp pnpapmpep pypopup'prpep pipnptpeprpepsptpepdp pipnp.p p pIpnpvpopkpep papnp p p pｳp       ｳ poppptpipopnp pbpyp ppprpepspspipnpgp p[pEpNpTpEpRp]p poprp p[pTpApBp-pEpNpTpEpRp]p ptpop pepxpiptp ptphpep pipnpsptpaplplpaptpipopnp.p p p pｳp       ｳ pﾚpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpｿ pｳp       ｳ pｳp p p Usage p p p p p p pQuick start - How to use this menu system p p p p p p p p p p pｳ pｳp       ｳ pｳp p pS|t~a~n~d~a~r~d~ p p p p pBpepgpipnp pap psptpapnpdpaprpdp pipnpsptpaplplpaptpipopnp p(prpepcpopmpmpepnpdpepdp)p p p p p p p p p pｳ pｳp       ｳ pｳp p pE|x~p~r~e~s~s~ p p p p p pBpepgpipnp pap pqpupipcpkp pipnpsptpaplplpaptpipopnp p(pfpoprp ptphpep pipmpppaptpipepnptp)p p p p p p pｳ pｳp       ｳ pｳp p p |C~u~s~t~o~m~ p p p p p pBpepgpipnp pap pcpupsptpopmp pipnpsptpaplplpaptpipopnp p(pfpoprp pepxpppeprptpsp)p p p p p p p p p p p pｳ pｳp       ｳ pｳp p pC|o~n~f~i~g~u~r~e~ p p p pDpop pppopsptp-pipnpsptpaplplp pcpopnpfpipgpuprpaptpipopnp popfp pFprpepepBpSpDp p p p p p p p p p p p pｳ pｳp       ｳ pｳp p pD|o~c~ p p p p p p p p p pIpnpsptpaplplpaptpipopnp pipnpsptprpupcptpipopnpsp,p pRpEpApDpMpEp,p peptpcp.p p p p p p p p p p p p p pｳ pｳp       ｳ pｳp p pK|e~y~m~a~p~ p p p p p p pSpeplpepcptp pkpepypbpopaprpdp ptpypppep p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳ pｳp       ｳ pｳp p pO|p~t~i~o~n~s~ p p p p p pVpipepwp/pSpeptp pvpaprpipopupsp pipnpsptpaplplpaptpipopnp poppptpipopnpsp p p p p p p p p p p p p p p pｳ pｳp       ｳ pｳp p pF|i~x~i~t~ p p p p p p p pEpnptpeprp prpepppapiprp pmpopdpep pwpiptphp pCpDpRpOpMp/pfplpopppppyp poprp psptpaprptp psphpeplplp p pｳ pｳp       ｳ pｳp p pU|p~g~r~a~d~e~ p p p p p pUpppgprpapdpep papnp pepxpipsptpipnpgp pspypsptpepmp p p p p p p p p p p p p p p p p p p p p p p p p p pｳ pｳp       ｳ pｳp p pL|o~a~d~ ~C~o~n~f~i~g~ p pLpopapdp pdpepfpapuplptp pipnpsptpaplplp pcpopnpfpipgpuprpaptpipopnp p p p p p p p p p p p p p p p p p pｳ pｳp       ｳ pｳp p pI|n~d~e~x~ p p p p p p p pGplpopspspaprpyp popfp pfpupnpcptpipopnpsp p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳ pｳp       ｳ pﾀpﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾙ pｳp       ﾃﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｴp       ｳ p p p p p p p p p p p p p p p p p p p p p p p p pSteplpepcptp p p p p[X Exit Install] p p p p p p p p p p p p p p p p p p p pｳp       ﾀﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄp[~ ~P~r~e~s~s~ ~F~1~ ~f~o~r~ ~I~n~s~t~a~l~l~a~t~i~o~n~ ~G~u~i~d~e~ ~]~ﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾙp                                                                                                                                                                    
\ No newline at end of file
diff --git a/en_US.ISO8859-1/books/handbook/install/timezone1.scr b/en_US.ISO8859-1/books/handbook/install/timezone1.scr
new file mode 100644
index 0000000000..c87c311772
--- /dev/null
+++ b/en_US.ISO8859-1/books/handbook/install/timezone1.scr
@@ -0,0 +1 @@
+SCRSHOT_P                                                                                                                                                                                                                                                                                                                                                     ﾚﾄﾄﾄﾄﾄﾄﾄ ~T~i~m~e~ ~Z~o~n~e~ ~S~e~l~e~c~t~o~r~ ~ﾄﾄﾄﾄﾄﾄﾄﾄｿp                                           ｳ p p p p p p p p pSpeplpepcptp pap prpepgpipopnp p p p p p p p p p p pｳp                                           ｳ pﾚpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpｿ pｳp                                           ｳ pｳp p1| p pApfprpipcpap p p p p p p p p p p p p p p p p p p p p pｳ pｳp                                           ｳ pｳp p2 p pAmerica -- North and South pｳ pｳp                                           ｳ pｳp p3| p pApnptpaprpcptpipcpap p p p p p p p p p p p p p p p p pｳ pｳp                                           ｳ pｳp p4| p pAprpcptpipcp pOpcpepapnp p p p p p p p p p p p p p p pｳ pｳp                                           ｳ pｳp p5| p pApspipap p p p p p p p p p p p p p p p p p p p p p p pｳ pｳp                                           ｳ pｳp p6| p pAptplpapnptpipcp pOpcpepapnp p p p p p p p p p p p p pｳ pｳp                                           ｳ pｳp p7| p pApupsptprpaplpipap p p p p p p p p p p p p p p p p p pｳ pｳp                                           ｳ pｳp p8| p pEpuprpopppep p p p p p p p p p p p p p p p p p p p p pｳ pｳp                                           ｳ pｳp p9| p pIpnpdpipapnp pOpcpepapnp p p p p p p p p p p p p p p pｳ pｳp                                           ｳ pｳp p0| p pPpapcpipfpipcp pOpcpepapnp p p p p p p p p p p p p p pｳ pｳp                                           ｳ pﾀpﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾙ pｳp                                           ﾃﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｴp                                           ｳ p p p p p p[  OK  ] p p p p p p pCtapnpcpeplp p p p p p p p pｳp                                           ﾀﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾙp                                                                                                                                                                                                                                                                                                                                                      
\ No newline at end of file
diff --git a/en_US.ISO8859-1/books/handbook/install/timezone2.scr b/en_US.ISO8859-1/books/handbook/install/timezone2.scr
new file mode 100644
index 0000000000..fb98142138
--- /dev/null
+++ b/en_US.ISO8859-1/books/handbook/install/timezone2.scr
@@ -0,0 +1 @@
+SCRSHOT_P                                                                                                  ﾚ ~C~o~u~n~t~r~i~e~s~ ~i~n~ ~A~m~e~r~i~c~a~ ~-~-~ ~N~o~r~t~h~ ~a~n~d~ ~S~o~u~t~h~ ~ﾄｿp                                    ｳ p p p p p p p p p p p pSpeplpepcptp pap pcpopupnptprpyp p p p p p p p p p p p p p pｳp                                    ｳ pﾚpﾄpz(z-z)zﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpｿ pｳp                                    ｳ pｳp p3|4~ p pPpapnpapmpap p p p p p p p p p p p p p p p p p p p p p p p p p p pｳ pｳp                                    ｳ pｳp p3|5~ p pPpaprpapgpupapyp p p p p p p p p p p p p p p p p p p p p p p p p pｳ pｳp                                    ｳ pｳp p3|6~ p pPpeprpup p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳ pｳp                                    ｳ pｳp p3|7~ p pPpupeprptpop pRpipcpop p p p p p p p p p p p p p p p p p p p p p pｳ pｳp                                    ｳ pｳp p3|8~ p pSpapipnptp pKpiptptpsp papnpdp pNpepvpipsp p p p p p p p p p p p pｳ pｳp                                    ｳ pｳp p3|9~ p pSpapipnptp pLpupcpipap p p p p p p p p p p p p p p p p p p p p p pｳ pｳp                                    ｳ pｳp p4|0~ p pSpapipnptp pVpipnpcpepnptp papnpdp ptphpep pGprpepnpapdpipnpepsp pｳ pｳp                                    ｳ pｳp p4|1~ p pSptp.p pPpipeprprpep papnpdp pMpipqpupeplpopnp p p p p p p p p p pｳ pｳp                                    ｳ pｳp p4|2~ p pSpuprpipnpapmpep p p p p p p p p p p p p p p p p p p p p p p p p pｳ pｳp                                    ｳ pｳp p4|3~ p pTprpipnpipdpapdp papnpdp pTpopbpapgpop p p p p p p p p p p p p p pｳ pｳp                                    ｳ pｳp p4|4~ p pTpuprpkpsp papnpdp pCpapipcpopsp pIpsplpapnpdpsp p p p p p p p p pｳ pｳp                                    ｳ pｳp p45 p pUnited States p p p p p p p p p p p p p p p p p p p pｳ pｳp                                    ｳ pｳp p4|6~ p pUprpupgpupapyp p p p p p p p p p p p p p p p p p p p p p p p p p pｳ pｳp                                    ｳ pｳp p4|7~ p pVpepnpepzpupeplpap p p p p p p p p p p p p p p p p p p p p p p p pｳ pｳp                                    ｳ pｳp p4|8~ p pVpiprpgpipnp pIpsplpapnpdpsp p(pBprpiptpipsphp)p p p p p p p p p pｳ pｳp                                    ｳ pｳp p4|9~ p pVpiprpgpipnp pIpsplpapnpdpsp p(pUp.pSp.p)p p p p p p p p p p p p pｳ pｳp                                    ｳ pﾀpﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾙ pｳp                                    ﾃﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｴp                                    ｳ p p p p p p p p p p[  OK  ] p p p p p p pCtapnpcpeplp p p p p p p p p p p pｳp                                    ﾀﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾙp                                                                                                  
\ No newline at end of file
diff --git a/en_US.ISO8859-1/books/handbook/install/timezone3.scr b/en_US.ISO8859-1/books/handbook/install/timezone3.scr
new file mode 100644
index 0000000000..aefdf9435e
--- /dev/null
+++ b/en_US.ISO8859-1/books/handbook/install/timezone3.scr
@@ -0,0 +1 @@
+SCRSHOT_P                                                                                        ﾚﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄ ~U~n~i~t~e~d~ ~S~t~a~t~e~s~ ~T~i~m~e~ ~Z~o~n~e~s~ ~ﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｿp                ｳ pSpeplpepcptp pap pzpopnpep pwphpipcphp popbpspeprpvpepsp ptphpep pspapmpep ptpipmpep papsp pypopuprp plpopcpaplpiptpyp.p pｳp                ｳ pﾚpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpｿ pｳp                ｳ pｳp p1 p p pEastern Time p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳ pｳp                ｳ pｳp p2| p p pEpapsptpeprpnp pTpipmpep p-p pMpipcphpipgpapnp p-p pmpopsptp plpopcpaptpipopnpsp p p p p p p p p p p p p pｳ pｳp                ｳ pｳp p3| p p pEpapsptpeprpnp pTpipmpep p-p pKpepnptpupcpkpyp p-p pLpopupipspvpiplplpep paprpepap p p p p p p p p p p p pｳ pｳp                ｳ pｳp p4| p p pEpapsptpeprpnp pTpipmpep p-p pKpepnptpupcpkpyp p-p pWpapypnpep pCpopupnptpyp p p p p p p p p p p p p p p pｳ pｳp                ｳ pｳp p5| p p pEpapsptpeprpnp pSptpapnpdpaprpdp pTpipmpep p-p pIpnpdpipapnpap p-p pmpopsptp plpopcpaptpipopnpsp p p p p pｳ pｳp                ｳ pｳp p6| p p pEpapsptpeprpnp pSptpapnpdpaprpdp pTpipmpep p-p pIpnpdpipapnpap p-p pCprpapwpfpoprpdp pCpopupnptpyp p p p pｳ pｳp                ｳ pｳp p7| p p pEpapsptpeprpnp pSptpapnpdpaprpdp pTpipmpep p-p pIpnpdpipapnpap p-p pSptpaprpkpep pCpopupnptpyp p p p p p pｳ pｳp                ｳ pｳp p8| p p pEpapsptpeprpnp pSptpapnpdpaprpdp pTpipmpep p-p pIpnpdpipapnpap p-p pSpwpiptpzpeprplpapnpdp pCpopupnptpyp pｳ pｳp                ｳ pｳp p9| p p pCpepnptprpaplp pTpipmpep p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳ pｳp                ｳ pｳp p1|0~ p pCpepnptprpaplp pTpipmpep p-p pMpipcphpipgpapnp p-p pWpipspcpopnpspipnp pbpoprpdpeprp p p p p p p p p p p pｳ pｳp                ｳ pｳp p1|1~ p pMpopupnptpapipnp pTpipmpep p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳ pｳp                ｳ pｳp p1|2~ p pMpopupnptpapipnp pTpipmpep p-p pspopuptphp pIpdpaphpop p&p pepapsptp pOprpepgpopnp p p p p p p p p p p p pｳ pｳp                ｳ pｳp p1|3~ p pMpopupnptpapipnp pTpipmpep p-p pNpapvpapjpop p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳ pｳp                ｳ pｳp p1|4~ p pMpopupnptpapipnp pSptpapnpdpaprpdp pTpipmpep p-p pAprpipzpopnpap p p p p p p p p p p p p p p p p p p p p pｳ pｳp                ｳ pｳp p1|5~ p pPpapcpipfpipcp pTpipmpep p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳ pｳp                ｳ pｳp p1|6~ p pAplpapspkpap pTpipmpep p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳ pｳp                ｳ pﾀpﾄz(z+z)zﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾙ pｳp                ﾃﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｴp                ｳ p p p p p p p p p p p p p p p p p p p p[  OK  ] p p p p p p pCtapnpcpeplp p p p p p p p p p p p p p p p p p p p p pｳp                ﾀﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾙp                                                                                        
\ No newline at end of file
diff --git a/en_US.ISO8859-1/books/handbook/install/userconfig.scr b/en_US.ISO8859-1/books/handbook/install/userconfig.scr
new file mode 100644
index 0000000000..c46077e6c7
--- /dev/null
+++ b/en_US.ISO8859-1/books/handbook/install/userconfig.scr
@@ -0,0 +1 @@
+SCRSHOT_P                                                                                                                                                                                         Kernel Configuration Menu                                                                                                                                                                                                         Skip kernel configuration and continue with installation                        pSptpaprptp pkpeprpnpeplp pcpopnpfpipgpuprpaptpipopnp pipnp pfpuplplp-pspcprpepepnp pvpipspupaplp pmpopdpep p p p p                       Start kernel configuration in CLI mode                                                                                                                                                                                                 Here you have the chance to go into kernel configuration mode, making           any changes which may be necessary to properly adjust the kernel to             match your hardware configuration.                                                                                                                              If you are installing FreeBSD for the first time, select Visual Mode            (press Down-Arrow then ENTER).                                                                                                                                  If you need to do more specialized kernel configuration and are an              experienced FreeBSD user, select CLI mode.                                                                                                                      If you are cpeprptpapipnp that you do not need to configure your kernel                then simply press ENTER or Q now.                                                                                                                                                                                                                                                                                             
\ No newline at end of file
diff --git a/en_US.ISO8859-1/books/handbook/install/userconfig2.scr b/en_US.ISO8859-1/books/handbook/install/userconfig2.scr
new file mode 100644
index 0000000000..9ff67a781b
--- /dev/null
+++ b/en_US.ISO8859-1/books/handbook/install/userconfig2.scr
@@ -0,0 +1 @@
+SCRSHOT_P---Active-Drivers----------------------------7p pcpopnpfplpipcptpsp-p------Dev---IRQ--Port--  Sptpoprpapgpep p:p p p p p p p p p p p(pCpoplplpapppspepdp)p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p  Network :          (Collapsed)                                                  Communications :   (Collapsed)                                                  Input :            (Collapsed)                                                  Multimedia :                                                                    Miscellaneous :    (Collapsed)                                                                                                                                                                                                                ---Inactive-Drivers--------------------------------------------Dev--------------  Storage :                                                                       Network :                                                                       Communications :   (Collapsed)                                                  Input :                                                                         Multimedia :                                                                    Miscellaneous :    (Collapsed)                                                                                                                                --------------------------------------------------------------------------------                                                                                                                                                                                                                                                --------------------------------------------------------------------------------  [Enter] Expand device list      [X]    Expand all lists                         [TAB]   Change fields           [Q]   Save and Exit             [?] Help                                                                                      
\ No newline at end of file
diff --git a/en_US.ISO8859-1/books/handbook/install/xf86setup.scr b/en_US.ISO8859-1/books/handbook/install/xf86setup.scr
new file mode 100644
index 0000000000..75b6b65813
--- /dev/null
+++ b/en_US.ISO8859-1/books/handbook/install/xf86setup.scr
@@ -0,0 +1 @@
+SCRSHOT_P                                                                                                                                                                                                                                                                                                                                     ﾚﾄﾄ ~P~l~e~a~s~e~ ~s~e~l~e~c~t~ ~t~h~e~ ~X~F~r~e~e~8~6~ ~c~o~n~f~i~g~u~r~a~t~i~o~n~ ~t~o~o~l~ ~y~o~u~ ~w~a~n~t~ ~t~o~ ~u~s~e~.~ ~ﾄﾄﾄｿp          ｳ pTphpep pfpiprpsptp ptpopoplp,p pXpFp8p6pSpeptpuppp,p pipsp pfpuplplpyp pgprpappphpipcpaplp papnpdp prpepqpupiprpepsp ptphpep p p p p pｳp          ｳ pVpGpAp1p6p pspeprpvpeprp pipnp poprpdpeprp ptpop pwpoprpkp p(psphpopuplpdp phpapvpep pbpepepnp pspeplpepcptpepdp pbpyp p p p p p p p pｳp          ｳ pdpepfpapuplptp,p pbpuptp pipfp pypopup pdpep-pspeplpepcptpepdp piptp ptphpepnp pypopup pwpopnp'ptp pbpep papbplpep ptpop p p p p p p pｳp          ｳ pupspep ptphpipsp pfpapnpcpyp pspeptpuppp ptpopoplp)p.p p pTphpep pspepcpopnpdp ptpopoplp,p pxpfp8p6pcpopnpfpipgp,p pipsp p p p p p p pｳp          ｳ pap pmpoprpep pspipmppplpipsptpipcp psphpeplplp-pspcprpippptp pbpapspepdp ptpopoplp papnpdp plpepspsp pfprpipepnpdplpyp ptpop p p p p pｳp          ｳ pnpepwp pupspeprpsp,p pbpuptp piptp pmpapyp pwpoprpkp pipnp pspiptpupaptpipopnpsp pwphpeprpep ptphpep pfpapnpcpipeprp popnpep p p p p pｳp          ｳ pdpopepsp pnpoptp.p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p p pｳp          ｳ pﾚpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpｿ pｳp          ｳ pｳp pX| ~E~x~i~t~ p p p p p p p pEpxpiptp ptphpipsp pmpepnpup p(prpeptpuprpnpipnpgp ptpop ppprpepvpipopupsp)p p p p p p p p p p p pｳ pｳp          ｳ pｳp p2 XF86Setup p p pFully graphical XFree86 configuration tool. p p p p p pｳ pｳp          ｳ pｳp p3| ~x~f~8~6~c~o~n~f~i~g~ p pSphpeplplp-pspcprpippptp pbpapspepdp pXpFprpepep8p6p pcpopnpfpipgpuprpaptpipopnp ptpopoplp.p p p pｳ pｳp          ｳ pｳp pD| ~X~D~e~s~k~t~o~p~ p p p pXp paplprpepapdpyp pspeptp puppp,p pjpupsptp pdpop pdpepspkptpoppp pcpopnpfpipgpuprpaptpipopnp.p pｳ pｳp          ｳ pﾀpﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾙ pｳp          ﾃﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄﾄｴp          ｳ p p p p p p p p p p p p p p p p p p p p p p p[  OK  ] p p p p p p pCtapnpcpeplp p p p p p p p p p p p p p p p p p p p p p p p pｳp          ﾀﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾄpﾙp                                                                                                                                                                                                                                                                                                                                     
\ No newline at end of file

File Metadata

Mime Type
application/octet-stream
Expires
Sun, Jun 30, 9:50 PM (2 d)
Storage Engine
blob
Storage Format
Raw Data
Storage Handle
10218927
Default Alt Text
(371 KB)

Event Timeline